Bài 2: Lipit

Chia sẻ: Nguyen Thi Gioi | Ngày: | Loại File: PDF | Số trang:19

0
470
lượt xem
83
download

Bài 2: Lipit

Mô tả tài liệu
  Download Vui lòng tải xuống để xem tài liệu đầy đủ

Viết phương trình phản ứng khi cho glixerin tác dụng với axit stearic (C17H35COOH) và axit panmitic (C15H31COOH). - Lipit là những hợp chất hữu cơ có trong tế bào sống, không hòa tan trong nước nhưng tan trong nhiều dung môi hữu cơ không phân cực

Chủ đề:
Lưu

Nội dung Text: Bài 2: Lipit

  1. Kiểm tra bài cũ Viết phương trình phản ứng khi cho glixerin tác dụng với axit stearic (C17H35COOH) và axit panmitic (C15H31COOH).
  2. LIPIT LIPIT
  3. I. KHÁI NIỆM - Lipit là những hợp chất hữu cơ có trong tế bào sống, không hòa tan trong nước nhưng tan trong nhiều dung môi hữu cơ không phân cực - Lipit là những este phức tạp, gồm các loại: chất béo, sáp, steroit, photpholipit,...
  4. II. CHẤT BÉO. 1. Khái niệm Lipit là trieste của Glixerol và axit béo, gọi chung là triglixerit (triaxylglixerol). CH2 O C R1 Axit béo là những axit đơn O chức có mạnh cacbon dài, CH O C R2 không phân nhánh. O R1, R2, R3 có thể giống hay khác nhau. CH2 O C R3 O
  5. II. CHẤT BÉO. 1. Khái niệm Các axit béo no thường gặp CH3(-CH2-)14COOH (C15H31COOH) : axit panmitic CH3(-CH2-)16COOH (C17H35COOH) : axit stearic Các axit béo không no thường gặp CH3(-CH2-)7CH=CH(-CH2-)7COOH (C17H33COOH) axit oleic CH3(-CH2-)4CH=CH-CH2-CH=CH(-CH2-)7COOH (C17H31COOH) : axit linoleic
  6. Ví dụ CH2 O C C17H33 CH 2 O C C 17 H 35 O O Ni,t o + CH O C C17H33 H2 CH O C C 17 H 35 2-15atm O O CH 2 O C C 17 H 35 CH2 O C C17H33 O O tristearin triolein tristearoylglixerol trioleoylglixerol
  7. Chất béo trong tự nhiên.
  8. Dầu Oliu Dầu đậu nành Dầu đậu phộng
  9. II. CHẤT BÉO. 2. Tính chất vật lý Ở nhiệt độ thường, Chất béo ở trạng trái lỏng hoặc rắn. Khi trong phân tử có gốc hiđrocacbon no thì chất béo ở trạng rắn. Khi trong phân tử có gốc hiđrocacbon không no thì chất rắn ở trạng thái lỏng. Các Lipit đều nhẹ hơn nước, không tan trong nước, nhưng tan nhiều trong các chất hữu cơ như benzen, xăng, clorofom …
  10. II. CHẤT BÉO. 3. Tính chất hóa học a. Phản ứng thủy phân CH2 O C R1 R1COOH CH2 OH O H+,to + + 3H O R2COOH CH OH CH O C R2 2 O R3COOH CH2 OH CH2 O C R3 O Chất béo Glixerol Axit béo
  11. Ví dụ CH2 O C C17H33 O + H2O +H ? CH O C C17H33 2 O CH2 O C C17H33 O
  12. II. CHẤT BÉO. 3. Tính chất hóa học b. Phản ứng xà phòng hóa CH2 O C R1 O R1COONa CH2 OH to + 3NaOH + CH O C R2 R2COONa CH OH O R3COONa CH2 OH CH2 O C R3 O Chất béo Glixerol Xà phòng
  13. Ví dụ CH 2 O C C 17 H 35 O Ni,t o CH O C C 17 H 35 + NaOH ? 2-15atm O CH 2 O C C 17 H 35 O
  14. II. CHẤT BÉO. 3. Tính chất hóa học c. Phản ứng cộng H2 (Hiđro hóa lipit lỏng) CH2 O C C17H33 CH2 O C C17H35 O O + 3H Ni,to CH O C C17H33 CH O C C17H35 2 2-15atm O O CH2 O C C17H35 CH2 O C C17H33 O O Chất béo lỏng Chất béo rắn
  15. II. CHẤT BÉO. 3. Ứng dụng (SGK) Thực phẩm Công nghiệp
  16. Câu hỏi củng cố Bài 1. Chọn phát biểu không đúng A. Chất béo không tan trong nước. B. Chất béo nhẹ hơn nước. C. Chất béo là este của glixerol và axit béo. D. Từ chất béo có thể điều chế xà phòng.
  17. Câu hỏi củng cố Bài 2. Để trung hoà 2,8 gam chất béo cần 3ml dung dịch KOH 0,1M. Tính chỉ số axit của mẩu chất béo trên. Bài 3. Tính chỉ số xà phòng hoá của mẫu chất béo có chỉ số axit bằng 7 chứa tristearin còn lẫn một lượng axit stearic.
  18. KẾT THÚC BÀI HỌC
Đồng bộ tài khoản