Bài tập ôn tập Hóa - Phần 3

Chia sẻ: Nguyen Van Duc | Ngày: | Loại File: DOC | Số trang:6

0
42
lượt xem
12
download

Bài tập ôn tập Hóa - Phần 3

Mô tả tài liệu
  Download Vui lòng tải xuống để xem tài liệu đầy đủ

Tham khảo tài liệu 'bài tập ôn tập hóa - phần 3', tài liệu phổ thông, hóa học phục vụ nhu cầu học tập, nghiên cứu và làm việc hiệu quả

Chủ đề:
Lưu

Nội dung Text: Bài tập ôn tập Hóa - Phần 3

  1. DẪN XUẤT HALOGEN - ANCOL – PHENOL Dữ liệu cho các câu 1; 2; 3 Cho các chất sau: CH3-CH2-CH2-Cl (1); CH3-CHCl-CH3 (2); (CH3)3CCl (3); (CH3)2CH-CH2Cl (4); CH3-CHF-CH3 (5); (CH3)2CCl-CH2-CH3 (6); BrCH2-CH2-CH2-CH2Br (7). Câu 1. Các dẫn xuất bậc I là: A. (1); (4); (7). B. (1); (4). C. (1); (3); (4). D. (1); (3); (4); (7). Câu 2. Các dẫn xuất bậc II là: A. (2); (6). B. (2); (5). C. (2); (5); (6). D. (2); (5); (6); (7). Câu 3. Các dẫn xuất bậc III là: A. (2); (3); (6). B. (5); (7). C. (3); (6). D. (3). Câu 4. Dẫn etilen vào dung dịch nước brom dư. Hiện tượng quan sát được là; A. Tạo hỗn hợp đồng nhất không màu. B. Tạo 2 lớp chất lỏng đều không màu. C. Tạo 2 lớp chất lỏng, lớp dưới không màu. D. Tạo 2 lớp chất lỏng, lớp trên không màu. Câu 5. Dãy chất được xếp theo chiều tăng dần nhiệt độ sôi là: A. CCl4; CHCl3; CH3Cl; CH3F; CH4. B. CH3Cl; CHCl3; CCl4; CH3F; CH4. C. CH4; CH3F; CH3Cl; CHCl3, CCl4. D. CH4; CCl4; CHCl3; CH3Cl; CH3F. Câu 6. Tên gọi nào dưới đây không đúng với công thức: A. CHCl3: triclometan. B. CHCl3: clorofom. C. CH2=CH-CH2Cl: anlyl clorua. D. CH2=CH-CH2Cl: clopropen. Câu 7. Số đồng phân cấu tạo có cùng phân thức phân tử C3H5Cl là: A. 3. B. 4. C. 5. D. 6. Câu 8. Số đồng phân cấu tạo có cùng phân thức phân tử C3H6Cl2 là: A. 4. B. 5. C. 6. D. 3. Câu 9. Khi nhỏ vài giọt AgNO3 vào ống nghiệm chứa CH2=CH-CH2Cl, lắc nhẹ. Quan sát thấy: A. Không có hiện tượng gì xảy ra. B. Tạo 2 lớp chất lỏng không màu. C. Tạo hỗn hợp đồng nhất không màu. D. Xuất hiện kết tủa trắng. Câu 10. Nhận xét nào sau đây không đúng: A. Anlyl bromua dễ tham gia phản ứng thế hơn phenyl bromua. B. Vinyl clorua có thể điều chế từ 1,2-đicloetan. C. Etyl clorua thuộc loại halogen dẫn xuất bậc II. D. Ứng với công thức C3H5Br có 4 đồng phân cấu tạo. Câu 11. Khi đun nóng etyl clorua trong dung dịch chứa KOH và C2H5OH, thu được: A. Etanol. B. Etilen. C. Axetilen. D. Etan. Câu 12. Có 2 ống nghiệm: ống 1 đựng 1 ml etylbromua, ống 2 đựng 1 ml brombenzen. Thêm tiếp vào mỗi ống 1 ml dung dịch AgNO3. Đun sôi 2 ống nghiệm. Quan sát thấy: Â. Cả 2 ống không có hiện tượng gì.
  2. B. Ống 1 xuất hiện kết tủa vàng nhạt; ống 2 không có kết tủa. C. Ống 1 không có hiện tượng; ống 2 xuất hiện kết tủa vàng nhạt. D. Ống 1 tạo hỗn hợp đồng nhất; ống 2 tạo 2 lớp chất lỏng. Câu 13. Để phân biệt các chất: CH3-CH2-CH2-Cl; CH3-CH2-CH2-Br; CH3-CH2-CH2I, người ta dùng: A. Bột Mg(ete khan). B. dd NaOH. C. dd HBr. D. dd AgNO3. Câu 14. Để phân biệt 3 lọ đựng 3 chất là butyl clorua, anlyl clorua, m-điclobenzen người ta dùng: A. dd AgNO3. B. dd NaOH và dd Br2. C. dd NaOH và dd AgNO3. D. dd Br2. Câu 15. Cho sơ đồ chuyển hóa sau: X1, X2 lần lượt là: A. CH2=CH-CH2-CH3; CH3-CHOH-CH2-CH3. B. CH3-CHOH-CH2-CH3; CH2=CH-CH2-CH3. C. CH3-CHOH-CH2-CH3; CH3-CH=CH-CH3. D. CH2=CH-CH2-CH3; CH3-CH=CH-CH3. Câu 16. Sản phẩm chính của phản ứng tách nước của 2-metylpentan-3-ol là: A. 4-metylpent-2-en. B. 4-metylpent-3-en. C. 2-metylpent-3-en. D. 2-metylpent-2-en. Câu 17. X có công thức phân tử là C4H10O. X tách nước cho 3 anken đồng phân. X là: A. Butan-2-ol. B. Ancol isobutylic. C. Ancol butylic. D. metylpropan-1-ol. Câu 18. Số chất đồng phân có cùng công thức phân tử C4H10O thỏa mãn tính chất: tách nước thu được anken, khi oxi hóa có xúc tác thu được sản phẩm có khả năng tham gia phản ứng tráng bạc là: A. 2. B. 3. C. 4. D. 1. Câu 19. Đun nóng rượu X với H2SO4 đặc ở 170 C, chỉ thu được 1 anken duy nhất. Công thức o cấu tạo của X là: A. CH3-CH(CH3)CH2-OH. B. CH3-CH(OH)-CH2-CH3. C. CH3-CH2-CHOH-CH(CH3)2. D. C6H5-CH2-CH2-OH. Câu 20. Chất nào sau đây khi bị oxi hóa ( có xúc tác) tạo ra anđehit: A. CH3CHOHCH3. B. (CH3)3COH. C. CH3CH2OCH3. D. CH3CH2CH2OH. Câu 21. Cho dãy chuyển hóa sau: Y là sản phẩm chính của phản ứng, công thức cấu tạo của X, Y lần lượt là: A. CH3-CH2-CH2-CH2OH; CH3-CH=CH-CH3. B. CH3-CH(CH3)-CH2OH; CH3-CH=CH-CH3.
  3. C. CH3-CHOH-CH2-CH3; CH3-CH=CH-CH3. D. CH3-CHOH-CH2-CH3; CH2=CH-CH2-CH3. Câu 40. Ancol nào dưới đây thuộc dãy đồng đẳng có công thức chung CnH2nO: A. CH3CH2OH. B. CH2=CH-CH2OH. C. C6H5CH2OH. D. CH2OH-CH2OH. Câu 41. Để phân biệt: etylbenzen, xiclopropaan, o-crosol và phenol người ta có thể dùng thuốc thử: A. dd Br2 dư và dd HNO3. B. dd KMnO4 và Na. C. dd Br2 dư và Na. D. dd Br2 và Cu(OH)2. Câu 42. Để phân biệt các chất: NH4HCO3, C6H5ONa, C3H7OH, C6H6 có thể dùng thuốc thử: A. dd Br2. B. dd NaOH. C. dd HCl. D. Nước. Câu 43. Có 4 lọ mất nhãn đựng: etilen glycol, phenol, stieren, etanol. Để nhận biết 4 lọ trên có thể dùng: A. dd NaOH và Na. B. Na và Cu(OH)2. C. dd Br2 và Cu(OH)2. D. dd Br2 và Na. Câu 44. Công thức tổng quát của ancol no, mạch hở, đơn chức, bậc I là: A. R-CH2OH. B. CnH2n+1OH. C. CnH2n+1CH2OH. D. CnH2n+2O. Câu 45. Đốt cháy ancol X, thu được số mol H2O lớn hơn số mol CO2. X là ancol: A. No, mạch hở. B. No, đơn chức, mạch hở. C. Không no, mạch hở. D. No, đa chức. Câu 46. Ancol nào sau đây đã đọc sai tên: A. 2-metylhexan-1-ol CH3-CH2-CH2-CH2-CH(CH3)-CH2-OH. B. 4,4-đimetylpentan-2-ol CH3-C(CH3)2-CH(OH)-CH3. C. 3-etylbutan-2-ol CH3-CH(C2H5)-CH(OH)-CH3. D. 3-metylpentan-2-ol CH3-CH2-CH(CH3)-CH(OH)-CH3. Câu 47. Cho các hợp chất sau: HO-CH2-CH2OH (1); HO-CH2-CHOH-CH2OH (2); HO-CH2-CH2-CH2OH (3); HO-CH2-CHOH-CH3 (4); HO-CH2-CH2-CHOH-CH2OH (5); HO-CH2-CH2-CHOH-CH2-CH2OH (6). Chất tạo được với Cu(OH)2 phức màu xanh là: A. (1), (2), (3), (4). B. (1), (2), (4), (5), (6). C. (1), (2), (5), (4). D. (1), (2), (4). Câu 48. Dãy các chất đều phản ứng được với C2H5OH là: A. K, HBr, dd Br2, HCOOH, CuO, O2. B. K, NaOH, dd Br2, CuO, O2, C2H5OH. C. Na, HBr, CH3COOH, CuO, O2, CH3OH. D. Na, HCl, CuO, O2, C2H5OH, dd Br2. Câu 49. X có công thức phân tử C4H10O. X tách nước cho 2 anken đồng phân. X là: A. Butan-2-ol. B. Ancol isobutylic. C. Ancol butylic. D. metylpropan-1-ol. Câu 50. A, B có cùng công thức phân tử C3H8O. A tác dụng với Na, khi bị oxi hóa không hoàn toàn thu được sản phẩm tham gia phản ứng tráng bạc. B không tác dụng với Na. A, B lần lượt là: A. Propan-2-ol và etyl metyl ete. B. Propan-1-ol và etyl metyl ete. C. Propan-2-ol và đietyl ete. D. Propan-1-ol và đietyl ete.
  4. Câu 51. Một ancol no, mạch hở có công thức thực nghiệm (C2H5O)n. Vậy CTPT của ancol là: A. C6H15O3. B. C4H10O2. C. C4H10O. D. C6H14O2. Câu 52. Chất nào sau đây không nên dùng để làm khan ancol: A. H2SO4 đặc. B. CaO mới nung. C. CuSO4 khan. D. P2O5 rắn. Câu 53. Đun nóng một ancol A với H2SO4 đậm đặc ở 170 C chỉ thu được một olefin duy nhất. o Công thức tổng quát của ancol A là: A. CnH2n+1CH2OH. B. CnH2n+1OH. C. CnH2nO. D. CnH2n-1CH2OH. Câu 54. Trong số các phương pháp điều chế rượu etylic sau đây, phương pháp nào chỉ dùng trong phòng thí nghiệm: A. Đun nóng anken với nước có xúc tác thích hợp. B. Đun nóng dẫn xuất halogen với dung dịch kiềm. C. Lên men glucozo có xúc tác. D. Hidro hóa anđehit. Câu 55. Có bao nhiêu đồng phân có cùng công thức phân tử là C5H10 khi cộng nước cho sản phẩm là ancol bậc 3: A. 6. B. 2. C. 4. D. 3. Câu 56. Có các chất hữu cơ: C2H5Cl; C2H5OH; n-C4H9OH; CH3OCH3. Chất tan tốt nhất trong nước là: A. C2H5Cl. B. C2H5OH. C. CH3OCH3. D. n-C4H9OH. Câu 57. X là một dẫn xuất của benzen, không phản ứng với dung dịch NaOH, có công thức phân tử C7H8O. Số đồng phân phù hợp của X là: A. 2. B. 3. C. 4. D. 5. Câu 58. Chất hữu cơ X có công thức phân tử C 6H6O2. Biết X là hợp chất thơm và có tác dụng với KOH theo tỉ lệ mol 1:2. Số đồng phân cấu tạo của X là: A. 1. B. 2. C. 3. D. 4. Câu 59. Trong số các dẫn xuất của benzene có công thức phân tử C8H10O. Có bao nhiêu đồng phân (X) thỏa mãn: (X) + NaOH → Không phản ứng. A. 1. B. 2. C. 3. D. 4. Câu 60. Cho dãy chuyển hóa: A1 → A2 → A3 → n-C3H7OH. Biết A2, A3 đều là sản phẩm chính của các phản ứng. Công thức cấu tạo của A1, A2, A3 lần lượt là: A. CH≡C-CH3; CH3-CH2-CH3; CH2=CH-CH3. B. CH3-CH2-CH3; CH2=CH-CH3; CH2=CH-CH2Cl. C. CH2=CH-CH3; CH2=CH-CH2Cl; CH2=CH-CH2OH. D. CH2=CH-CH3; CH≡C-CH3; CH3-CH2-CHO. Câu 61. Cho dãy chuyển hóa sau: C3H8 → A → B → CH3-CH(OH)-CH3. Biết B là sản phẩm chính của phản ứng. Công thức cấu tạo của A, B lần lượt là:
  5. A. CH2=CH-CH3; CH3-CH2-CH2Cl. B. C2H2; CH2=CH-CH3. C. (CH3COO)2Ca; CH3-CO-CH3. D. CH2=CH-CH3; CH3-CHCl-CH3. Câu 62. Chất hữu cơ A có công thức phân tử là C3H8O2. A có các tính chất: Tác dụng với Na giải phóng hidro. Hòa tan được Cu(OH)2 tạo dung dịch có màu xanh thẫm. A có công thức cấu tạo là: A. CH3-CH2-CH(OH)2. B. CH2OH-CH2-CH2OH. C. CH3-CHOH-CH2OH. D. CH3-CH2-COOH. Câu 63. Cho dãy chuyển hóa sau: C3H8 → X → Y → Z → glixerin. X, Y, Z đều là sản phẩm chính của các phản ứng. Công thức cấu tạo của X, Y, Z lần lượt là: A. CH2=CH-CH3; CH3-CH2-CH2Cl; CH2Cl-CHCl-CH2OH. B. CH≡C-CH3; CH3-CO-CH3; CH3-CHOH-CH3. C. CH2=CH-CH3; CH3-CH2-CH2Cl; CH2Cl-CHOH-CH2Cl. D. C2H2; CH2=CH-CH3; CH2Cl-CHCl-CH2Cl. Câu 64. . Cho dãy chuyển hóa sau: Y là sản phẩm chính của phản ứng, công thức cấu tạo của X, Y lần lượt là: A. CH3-CH2-CH2-CH2OH; CH3-CH=CH-CH3. B. CH3-CH(CH3)-CH2OH; CH3-CH=CH-CH3. C. CH3-CHOH-CH2-CH3; CH3-CH=CH-CH3. D. CH3-CHOH-CH2-CH3; CH2=CH-CH2-CH3. Câu 65. Chất hữu cơ X mạch hở, có công thức phân tử C4H8O. X tác dụng được với Na giải phóng hidro; X làm mất màu dung dịch brom; tên của X bắt đầu bằng chữ trans. Công thức cấu tạo của X là: A. CH3-CH=CH-CH2OH. B. CH2=CH-CH2-CH2OH. C. CH3-CH(CH3)-CH2OH. D. CH3-CH2-CH=CHOH. Câu 66. Để điều chế C2H4 người ta đun nóng C2H5OH với axit H2SO4 đặc ở 170oC. Hiệu suất của phản ứng đạt 60%. Khối lượng riêng của etylic bằng 0,8 gam/ml. Để thu được 13,44 lít ( đktc) C2H4 thì thể thích rượu 95o cần là: A. 57,5 ml. B. 60,53 ml. C. 36,32 ml. D. 34,50 ml. Câu 67. Cho 1,24 gam hỗn hợp 2 rượu đơn chức tác dụng vừa đủ với Na, thấy thoát ra 336 ml khí H2 ( đktc) và m gam muối natri. m có giá trị bằng: A. 1,93 gam. B. 2,93 gam. C. 1,90 gam. D. 1,47 gam. Câu 68. X, Y là 2 rượu no đơn chức, mạch hở kế tiếp nhau trong dãy đồng đẳng. Cho hỗn hợp gồm 1,6 gam X và 2,8 gam Y tác dụng hết với Na thu được 1,12 lít H 2 ở đktc. X, Y có công thức phân tử lần lượt là: A. CH3OH và C2H5OH. B. C2H5OH và C3H7OH.
  6. C. C3H7OH và C4H9OH. D. C4H9OH và C5H11OH. Câu 69. Hỗn hợp X gồm 2 rượu no, đơn chức, mạch hở. Chia một lượng X thành 2 phần bằng nhau. Đốt cháy hoàn toàn phần 1 thu được 0,2 mol CO 2. Tách nước hoàn toàn phần 2, thu được hỗn hợp Y chỉ gồm 2 anken. Đốt cháy hoàn toàn hỗn hợp Y thu được m gam nước. m có giá trị bằng: A. 1,8 gam. B. 3,6 gam. C. 2,7 gam. D. 8,8 gam. Câu 70. Đốt cháy hoàn toàn một rượu đơn chức A thu được 8,8 gam CO 2 và 7,2 gam H2O. Công thức phân tử của A là: A. C2H5OH. B. C3H5OH. C. C3H7OH. D. CH3OH. Câu 71. Trong sản xuất, để điều chế rượu vang, người ta lên men glucozo có trong nước quả nho. Phản ứng lên men glucozo để điều chế rượu etylic đạt hiệu suất 90%. Biết rượu etylic nguyên chất có khối lượng riêng 0,80 g/ml. Khối lượng glucozo cần để điều chế 100 lít rượu vang 9,2o là: A. 14,40 kg. B. 16,00 kg. C. 1,600 kg. D. 1,440 kg. Câu 72. Một rượu đơn chức A tác dụng với HBr cho hợp chất B chứa 58,40% Br về khối lượng. Mặt khác nếu đun nóng A với H2SO4 đặc ở 170oC thu được hỗn hợp 3 anken. Công thức cấu tạo của A là: A. CH3-CHOH-CH2-CH3. B. CH3-CH2-CH2-CH2OH. C. CH3-CHOH-CH3. D. CH3-CH(CH3)-CH2OH. Câu 73. Đốt cháy hoàn toàn một lượng hỗn hợp hai rượu đơn chức ( X, Y) kế tiếp nhau trong dãy đồng đẳng thu được 4,48 lít CO2 ( đktc) và 4,95 gam H2O. Biết rằng khi oxi hóa hoàn toàn X, Y thu được sản phẩm đều có khả năng tham gia phản ứng tráng bạc. Công thức cấu tạo của X, Y là: A. C2H5OH và n-C3H7OH. B. C2H5OH và i-C3H7OH. C. n-C3H7OH và n-C4H9OH. D. CH3OH và C2H5OH. Câu 74. Để điều chế C2H4 người ta đun nóng C2H5OH với axit H2SO4 đặc ở 170oC. Hiệu suất của phản ứng đạt 60%. Khối lượng riêng của etylic bằng 0,8 gam/ml. Để thu được 13,44 lít ( đktc) C2H4 thì thể thích rượu 95o cần là: A. 57,5 ml. B. 60,53 ml. C. 36,32 ml. D. 34,50 ml. Câu 75. Hợp chất B chứa C, H, O có công thức phân tử trùng với công thưc đơn giản. Khi phân tích a gam B, thấy tổng khối lượng C và H trong đó là 0,46 gam. Để đốt cháy hoàn toàn a gam B cần 0,896 lít oxi ( đktc). Cho toàn bộ sản phẩm cháy qua bình đựng dung dịch NaOH dư, thấy khối lượng bình tăng 1,9 gam. B có công thức phân tử là: A. C2H6O. B. C6H6O2. C. C7H8O2. D. C4H8O2. Câu 76. Tại một nhà máy rượu, người ta dùng khoai tây chứa 20% tinh bột để sản xuất rượu etylic. Cần phải dùng bao nhiêu tấn khoai tây để thu được 1 tấn rượu, biết sự hao hụt trong sản xuất là 15%. A. 10,358 tấn. B. 2,0716 tấn. C. 1,7609 tấn. D. 7,484 tấn.
Đồng bộ tài khoản