Các dạng bài tập Este

Chia sẻ: Ngô Hoàng Anh Bop | Ngày: | Loại File: DOC | Số trang:6

1
1.622
lượt xem
567
download

Các dạng bài tập Este

Mô tả tài liệu
  Download Vui lòng tải xuống để xem tài liệu đầy đủ

Tham khảo tài liệu 'các dạng bài tập este', tài liệu phổ thông, ôn thi đh-cđ phục vụ nhu cầu học tập, nghiên cứu và làm việc hiệu quả

Chủ đề:
Lưu

Nội dung Text: Các dạng bài tập Este

  1. CÁC DẠNG BÀI TẬP ESTE I. ĐỒNG PHÂN. DANH PHÁP. * Viết các đồng phân este: đơn chức, đa chức, no, không no(có đồng phân hình học). Bài 1: Viết các đồng phân este ứng với các công thức phân tử sau và gọi tên chúng: C 2H4O2; C3H6O2; C3H4O2. Bài 2: Viết các đồng phân este ứng với công thức phân tử: C 4H8O2, C4H6O2, C4H4O4, C7H6O2(hợp chất thơm). Gọi tên các este đã viết? Bài 3: Viết các đồng phân este ứng ứng công thức phân tử C 5H8O2. Bài 4: Viết các đồng phân este thơm ứng với công thức phân tử: C8H8O2; C9H8O2. Bài 2: Một hợp chất X có công thức phân tử C xHyO2 mạch hở chỉ chứa các nhóm chức ancol, anđehit, este và axit. Hỏi mối quan hệ giữa các giá trị x và y phải như thế nào để cho X là hợp chất no? II. TÍNH CHẤT. * Viết các phương trình tính chất của các este(chú ý các dạng este đ ặc biệt) Bài 1: Hoàn thành các phương trình phản ứng sau 0 0 1/ RCOOR’ + NaOH t →  2/ (RCOO)nR’ + NaOH t →  0 0 t →  t →  3/ R(COOR’)n + NaOH 4/ RCOOCH=CH-R’ + NaOH 0 0 5/ RCOOC6H4-R’ + NaOH t → t →  6/ ROOCR’ + NaOH 0 0 7/ RCOOR’COOR” + NaOH t →  t →  8/ RCOOR’OOCR” + NaOH 0 0 9/ ROCOR’COOR” + NaOH t →  10/ ROCOR’OCOR” + NaOH t →  0 11/ O=CHO-R’ + NaOH t →  Bài 2: Hợp chất A có công thức phân tử C3H4O2 . Cho A tác dụng với dung dịch NaOH được hai chất hữu cơ A1 và A2 đều có phản ứng tráng gương. Viết công thức cấu tạo của A1, A2, A và các phương trình phản ứng nói trên. Bài 3: Viết phương trình phản ứng của các este ứng với công thức phân tử: C4H8O2 với dung dịch NaOH đun nóng. Bài 4: Viết phương trình phản ứng của các este ứng với công thức phân tử: C4H6O2 với dung dịch NaOH đun nóng. Bài 5: Viết phương trình phản ứng của các este ứng với công thức phân tử: C5H8O2 với dung dịch NaOH đun nóng. Bài 6: Viết phương trình phản ứng của các este ứng với công thức phân tử: C4H4O4 với dung dịch NaOH đun nóng. Bài 7: Viết phương trình phản ứng của các este ứng với công thức phân tử: C7H6O2 với dung dịch NaOH đun nóng. Bài 8: Viết phương trình phản ứng của các este ứng với công thức phân tử: C8H8O2 với dung dịch NaOH đun nóng. Bài 9: Viết phương trình phản ứng của các este ứng với công thức phân tử: C9H8O2 với dung dịch NaOH đun nóng. III. TÍNH TOÁN. IV. XÁC ĐỊNH 1 ESTE. * Xác định công thức phân tử, công thức cấu tạo của este đơn ch ức(1 este) Bài 1: Thuỷ phân một este trong môi trường kiềm ta được ancol etylic. Hãy xác định công thức của este biết khối lượng phân tử của ancol bằng 62% khối lượng phân tử của este. Bài 2: Muốn xà phòng hoá 17,4(g) este được tạo thành từ axit đơn chức no phải dùng 300ml dung dịch NaOH 0,5M. a) Xác định công thức của este. b) Nếu đem cô cạn dung dịch thu được sau phản ứng xà phòng hoá rồi lấy muối khan thu được đem nung với vôi tôi xút thì thấy có khí metan bay ra. Hãy tính thể tích khí metan thu được ở đktc. c) Ancol thu được trong phản ứng xà phòng hoá ứng với bậc cao nhất. Hãy xác định công thức cấu tạo của este. Bài 3: Làm bay hơi 0,37 gam một este nó chiếm thể tích bằng thể tích của 0,16 gam oxi ở cùng điều kiện. Xác định công thức phân tử và viết các công thức cấu tạo của các đồng phân este. Bài 4: Đốt cháy hoàn toàn 0,528 gam chất hữu cơ đơn chức thì thu được 1,055 gam CO2 và 0,432 gam H2O. a) Tìm công thức thực nghiệm và công thức đơn giản nhất của hợp chất. b) Tìm công thức cấu tạo gọi tên hợp chất. Biết rằng khi thuỷ phân hợp chất bằng dung dịch NaOH thì thu được muối natri mà khi cho tác dụng với vôi tôi xút thì thu được khí metan. Bài 5: Thuỷ phân một este có tỉ khối hơi so với H2 là 37 thì thu được muối natri có khối lượng bằng 41/37 khối lượng este. a) Xác định công thức cấu tạo của este. 1
  2. b) Lấy 1gam este đem thuỷ phân, sau một thời gian thu được một lượng axit. Để trung hoà lượng axit này cần 4,5ml dung dịch NaOH 1M. Tìm tỉ lệ este chưa bị thuỷ phân. Bài 6: Xà phòng hoá hoàn toàn 0,15mol một este A bằng dung dịch NaOH 1,25M thì dùng 200ml. Cô cạn dung dịch thu được 14,2 gam chất rắn khan. Nếu đốt cháy hoàn toàn 0,1mol A rồi cho sản phẩm cháy vào bình đựng dung dịch Ba(OH) 2 thì thu được 19,7 gam kết tủa. Nếu thêm tiếp xút dư vào dung dịch thì thu được 19,7 gam kết tủa nữa. a) Xác định công thức cấu tạo của A. b) Gọi B là đồng phân của A. Nếu cho 0,1mol B tác dụng hoàn toàn với 200ml dung dịch NaOH 1,25M rồi cô cạn dung dịch sau phản ứng thì thu được 14,2 gam chất rắn khan. Xác định B. Bài 7: Đốt cháy hoàn toàn 15ml hơi của một este A phải dùng 150ml oxi,sau phản ứng thu được hỗn hợp sản phẩm gồm CO2 và hơi nước, trong đó thể tích của CO 2 bằng 9/4 lần thể tích của hơi nước. Khi ngưng tụ sản phẩm cháy thấy thể tích hỗn hợp giảm 60ml. Mặt khác nếu đốt cháy hoàn toàn 15ml hơi của axit tạo thành A thì cần 45ml oxi. Các khí được đo ở cùng điều kiện về nhiệt độ áp suất. a) Xác định công thức cấu tạo của A. b) Đun nóng 2,96 gam A với dung dịch HCl loãng đến khi phản ứng thuỷ phân xảy ra hoàn toàn thu được dung dịch X. Tính thể tích dung dịch nước brôm(16g/l) cần để phản ứng vừa đủ với dung dịch X. Bài 8: Đốt cháy hoàn toàn 0,4995 gam một este thì thu được 0,981 gam CO2. a) Tìm công thức của este. b) Thuỷ phân este này trong môi trường NaOH thì thu được một muối mà khối lượng của nó bằng 34/37 khối lượng este. Xác định công thức cấu tạo của este. Bài 9: Đun nóng 0,1 mol este no đơn chức E với 30 ml dung dịch 20% (d = 1,2g/ml) của một hidroxit kim loại kiềm M. Sau khi kết thúc phản ứng xà phòng hoá, cô cạn dung dịch thì thu được chất rắn A và 4,6 gam ancol B, biết rằng B bị oxi hoá bởi CuO thành sản phẩm có khả năng phản ứng tráng gương. Đốt cháy chất rắn A thì thu được 9,54 gam muối cacbonat, 8,26 gam hỗn hợp CO2 và hơi nước. a) Viết phương trình phản ứng dạng tổng quát. b) Xác định tên kim loại M. c) Tìm CTCT của E. Bài 10: Chất A là este của axit đơn chức và ancol đơn chức. Để thuỷ phân hoàn toàn 4,4 gam chất A người ta dùng 22,73 ml dung dịch NaOH 10% ( d = 1,1 g/ml). Lượng NaOH này dư 25% so với lý thuyết. a) Xác định CTPT, viết CTCT và gọi tên A. b) Đốt cháy hoàn toàn 1,32 gam chất A và cho sản phẩm hấp thụ hoàn toàn vào nước vôi chứa 3,7 gam Ca(OH) 2. Tính lượng kết tủa tạo thành. Cho 1,76 gam chất A bay hơi trong một bình kín dung tích 896 ml, thấy áp suất trong bình 0,75 atm. Hỏi nhiệt độ bay hơi là bao nhiêu. V. XÁC ĐỊNH HỖN HỢP ESTE. * Xác định công thức phân tử, công thức cấu tạo c ủa hỗn este đ ơn ch ức(2 este đ ồng phân ho ặc khác nhau) Bài 1. Hỗn hợp Y gồm 2 este đơn chức, mạch hở, là đồng phân của nhau. Cho mg hỗn hợp Y tác dụng vừa đủ với 100 ml dung dịch NaOH 0,5M thu được muối của 1 axit hữu cơ và 2 ancol. Mặt khác đốt cháy hoàn toàn m gam hỗn hợp Y cần dùng 5,6 lít O2 và thu được 4,48 lít CO2. Các thể tích khí đều đo ở đktc. * Xác định CTPT, CTCT của các chất trong Y. * Cho Y lần lượt tác dụng với dung dịch AgNO3/NH3 và Cu(OH)2/NaOH. Viết phương trình phản ứng xảy ra. Bài 2: Làm bay hơi 5,98gam hỗn hợp hai este của axit axetic với 2 ancol là đồng đẳng kế tiếp trong dãy đồng đẳng của ancol metylic, nó chiếm thể tích là 1,344lít(đktc). Xác định công thức của 2 este. Bài 3: Hỗn hợp A gồm hai chất hữu cơ đơn chức mạch hở chứa C, H, O. Cho A tác dụng vừa đủ với 200 ml dung dịch NaOH 1M thu được muối của một axit hữu cơ no B và một ancol C. Thực hiện phản ứng tách nước ancol C ở điều kiện thích hợp, sau khi phản ứng xảy ra hoàn toàn thu được chất hữu cơ D có tỉ khối hơi so với H 2 bằng 37. Lượng nước thu được sau phản ứng tách nước cho tác dụng với Na dư được 0,196 lít khí. a) Xác định CTCT của ancol C b) Đốt cháy hoàn toàn hỗn hợp A cần dùng 4,592 lít O 2. Sản phẩm cháy cho hấp thụ hết vào bình đựng 100 gam dung dịch NaOH 8% được dung dịch E. Xác định CTCT của B và tính nồng độ % của dung dịch E. Bài 4: Cho 35,2 gam hỗn hợp A là hai este no đơn chức đồng phân của nhau có tỉ khối hơi đối với H 2 bằng 44 tác dụng với 2 lít dung dịch NaOH 0,4 M rồi cô cạn dung dịch thu được ta thu được 44,6 gam chất rắn B. a) Hãy xác định CTPT của hai este. b) Tính % các chất trong A theo số mol Bài 5: Có một hỗn hợp Z gồm hai este X, Y tạo bởi hai axit no đơn chức với cùng một ancol đơn chức. Đốt cháy hoàn toàn 0,15 mol Z và cho toàn bộ sản phẩm cháy hấp thụ vào bình đựng lượng dư dung dịch Ba(OH) 2 thấy khối lượng bình tăng 23,25 gam và trong bình xuất hiện 73,875 gam kết tủa. Xác định CTPT, CTCT của X và Y, gọi tên chúng biết khối lượng phân tử MX : MY = 18,5 : 15. Cho 15,52 gam hỗn hợp Z phản ứng khi đun nóng với 680 ml dung dịch Ba(OH) 2 0,25 M (h = 100%). Lượng dư dung dịch bazơ phản ứng vừa đủ với 50 ml dung dịch HCl 2M. 2
  3. a) Tính thành phần % khối lượng của mỗi este trong Z. b) Viết phương trình chuyển hoá Y thành X. Bài 6: Cho 1,22 gam một hợp chất hữu cơ A phản ứng vừa đủ với 200 ml dung dịch KOH 0,1M chỉ thu được dung dịch chứa 2,16 gam muối khan. Đốt cháy lượng muối này thu được a gam K2CO3, 2,64 gam CO2 và 0,54 gam nước. Xác định CTPT, CTCT của A, tính a. Biết MA < 140. Bài 7: Hỗn hợp Y gồm 2 chất hữu cơ A, B có cùng chức hóa học . Nếu đun nóng 15,7 gam hỗn hợp Y tác dụng với lượng dư NaOH thì tạo muối của axit hữu cơ đơn chức và 7,6 gam hỗn hợp 2 ancol no đơn chức, bậc một kế tiếp nhau trong dãy đồng đẳng. Đốt cháy hoàn toàn 15,7 gam Y cần 21,84 lít O2 thu được 17,92 lít khí CO2. Xác định công thức phân tử và công thức cấu tạo , tính % khối lượng của từng chất trong hỗn hợp Y. (Các khí đo ở điều kiện tiêu chuẩn). Bài 8: Hỗn hợp A gồm 2 chất hữu cơ mạch hở X, Y chỉ chứa C, H, O tác dụng vừa đủ với 200 ml dung dịch NaOH 2M thu được 1 ancol đơn chức và 2 muối của 2 axit hữu cơ đơn chức là đồng đẳng kế tiếp nhau. Lượng ancol thu được cho tác dụng với Na dư thu được 4,48 lít H2 (đktc). Cho 41,2 gam hỗn hợp A tác dụng vừa đủ với dung dịch NaOH thu được 33,92 gam muối. Mặt khác, đốt cháy hoàn toàn 82,24 gam hỗn hợp A cần 112,896 lít O2 (đktc) thu được nước và 93,184 lít CO2. Xác định công thức cấu tạo của X, Y. Bài 9: Hỗn hợp X gồm 2 chất hữu cơ đơn chức đều tác dụng với NaOH. Cho m gam hỗn hợp X vào 300 ml dung dịch NaOH 1M, đun nóng để các phản ứng xảy ra hoàn toàn , trung hòa lượng kiềm dư sau phản ứng cần 200 ml dung dịch HCl 0,5 M. Cô cạn cẩn thận dung dịch sau phản ứng thu được 22,25 gam hỗn hợp chất rắn Y gồm 2 muối cà 4,6 gam ancol E. Cho toàn bộ E vào dung dịch H2SO4 đặc tại 1700C thu được 1,792 lít anken ( hiệu suất phản ứng đạt 80%). Các khí đo ở đktc. Xác định công thức cấu tạo của 2 chất và tính m(g). Bài 10. A và B là 2 đồng phân, phân tử gồm C, H, O. Mỗi chất chỉ chứa 1 nhóm chức và đều có thể phản ứng được với NaOH. Lấy 12,9g hỗn hợp X của A và B cho tác dụng vừa đủ với 75ml dung dịch NaOH 2M, thu toàn bộ sản phẩm Y. a) Xác định CTPT của A và B. a b) Viết CTCT các đồng phân thỏa mãn điều kiện đầu bài của A và B, viết phương trình phản ứng của chúng với dung dịch NaOH. c) Chia hỗn hợp Y thành 2 phần đều nhau. Một phần cho tác dụng hết với dung dịch AgNO 3/NH3 thu được 21,6g kết tủa . Phần còn lại đem cô cạn ta thu được 6,45g hỗn hợp 2 muối hữu cơ. Xác định CTCT phù hợp của A và B. Tính khối lượng từng chất trong 12,9g hỗn hợp X. Bài 11. Hai hợp chất A và B mạch hở (chỉ chứa C, H, O) đơn chức đều tác dụng với NaOH, không tác dụng với Na. Để đốt cháy mg hỗn hợp X gồm A và B cần 8,4 lít O2 thu được 6,72 lít CO2 và 5,4g H2O. 1. Cho biết A và B thuộc loại chất gì? Chứng minh rằng A và B không làm mất màu dung dịch Br2. 2. Tìm M X , CTPT và CTCT có thể có của A và B. Biết rằng MB - MA = 28. Các khí đều đo ở đktc. * Xác định công thức cấu tạo của este dựa theo sản phẩm và đặc đi ểm c ấu tạo * Hoàn thành sơ đồ phản ứng trong đó có este Bài 1: a) Từ CH4 viết phương trình phản ứng điều chế các hợp chất đơn chức có công thức là C 3H6O2. Chứng minh sự có mặt của các chất đó trong cùng ống nghiệm đã điều chế được. * Xác định công thức cấu tạo dựa vào tính chất khi biết CTPT Bài 1: Các hợp chất A, B, C, D, E, F có cùng công thức phân tử C4H8O2. A, B có phản ứng với Na và với NaOH, các chất còn lại đều chỉ tác dụng với NaOH, riêng hai chất E, F còn tham gia phản ứng tráng gương. Biện luận để viết công thức cấu tạo của chúng. Viết phương trình các phản ứng nói trên. Bài 2: Ba chất X, Y, Z có CTPT dạng (CH2O)n với n ≤ 3. Cho biết: - X chỉ tham gia phản ứng tráng gương. - Y vừa tham gia phản ứng tráng gương, vừa phản ứng với Na. - Z tác dụng với dung dịch NaHCO 3 vừa đủ, làm bay hơi nước dung dịch sau phản ứng, sản phẩm khan còn lại tiếp tục tác dụng với Na. Oxi hóa Z ở điều kiện thích hợp sẽ tạo thành hợp chất chỉ chứa 1 loại nhóm chức. Đốt cháy hoàn toàn X, Y, Z như nhau thì số mol H2O thu được từ X< Y< Z. Hãy: - Xác định CTCT của X, Y, Z. - Viết phương trình phản ứng theo sơ đồ: Z − H→ Z1 + CH → Z2  → P ( polime) 2O  3OH   * Xác định công thức cấu tạo dựa vào tính chất khi biết phân tử khối và thành ph ần nguyên tố * Xác định công thức cấu tạo của este đa chức(chú ý tỉ lệ số mol các muối) Bài 1: Đốt cháy hoàn toàn 1,46 gam A ở trạng thái hơi(có chứa các nguyên tố C, H, O) thì thu được 1,344 lít khí CO 2(đktc) và 0,9 gam H2O. Tỉ khối hơi của A so với H2 bằng 73. Tìm công thức cấu tạo của A. Bài 2: Cho 0,1mol chất hữu cơ A(chỉ chứa một loại nhóm chức) tác dụng với 12 gam NaOH. Sản phẩm thu được gồm 0,1mol ancol B cân nặng 9,2 gam và một muối của axit hữu cơ đơn chức C. Khi đốt cháy 0,1mol C thì bao giờ cũng tạo ra được 1,8 mol CO 2. Mặt khác cũng lượng axit này làm mất màu vừa đủ dung dịch nước brôm có chứa 16 gam brôm nguyên chất. a) Xác định công thức phân tử của A và B. b) Hãy đề nghị công thức cấu tạo thích hợp của A và B. 3
  4. Bài 3: Một este mạch hở chứa tối đa là 3 chức este. Cho este này tác dụng với dung dịch NaOH có dư thì thu được một muối và 1,24 gam hỗn hợp hai ancol cùng dãy đồng đẳng. Lấy 1,24 gam hỗn hợp hai ancol này đem hoá hơi hoàn toàn thì thu được lượng hơi có thể tích bằng thể tích của 0,96 gam O2 (cùng điều kiện) . Xác định tổng quát của A. Bài 4. Một chất hữu cơ A chỉ chứa C, H, O trong phân tử. Đốt cháy hoàn toàn 1,6g A, dẫn toàn bộ sản phẩm cháy vào bình đựng dung dịch Ba(OH)2 dư thấy khối lượng bình tăng 4,16g và có 13,79g kết tủa. Biết MA < 200 đvC. * Xác định CTPT của A. * Biết A chỉ chứa 1 loại nhóm chức, khi cho 16g A tác dụng vừa đủ với 200g dung dịch NaOH 4% thì thu được 1 ancol B và 17,8g hỗn hợp 2 muối. Xác định CTCT của A và B. Bài 5. Thực hiện phản ứng este hoá giữa 1 axit cacboxylic no X và 1 ancol no Y ta được este A mạch hở. Cho bay hơi a gam este A trong 1 bình kín dung tích 6 lít ở 136,50C. Khi este bay hơi hết thì áp suất trong bình là 0,56atm. Để đốt cháy hoàn toàn 0,1 mol Y cần đủ lượng oxi được điều chế từ phản ứng nhiệt phân hoàn toàn 50,5g KNO 3. Cho a gam chất A phản ứng hoàn toàn với dung dịch NaOH tạo ra 16,4g muối. a) Xác định CTCT của A. b) Cho 120g axit X tác dụng với 31g Y thu được 58,4g chất A. Hãy tính hiệu suất phản ứng este hoá. Bài 6. Cho hỗn hợp M gồm 2 este A và B. Cho a gam hỗn hợp M tác dụng vừa đủ với dung dịch KOH, sau phản ứng thu được b gam ancol D và 2,688g muối kali của 2 axit hữu cơ đơn chức kế tiếp nhau trong dãy đồng đẳng. Đem nung toàn bộ muối trên với vôi tôi xút tới khi phản ứng hoàn toàn thì nhận được 0,672 lít khí E ở đktc. Đem đốt cháy toàn bộ lượng ancol D thu được sản phẩm cháy gồm CO2 và hơi H2O, có tỷ lệ khối lượng là 44:27. Mặt khác cho tất cả hỗn hợp lượng sản phẩm cháy trên hấp thụ vừa hết với 45ml dung dịch Ba(OH)2 0,5M thì nhận được 2,955g kết tủa. * Xác định CTCT có thể có của A và B. * Tính các giá trị a và b. Bài 7. Đun nóng 21,8g chất A với 1 lít dung dịch NaOH 0,5M thu được 24,8g muối của axit đơn chức và 1 lượng ancol B. Nếu cho lượng ancol B đó bay hơi thì ở đktc thể tích khí thu được là 2,24 lít lượng dư NaOH được trung hoà bằng 2 lít dung dịch HCl 0,1M. Xác định CTCT của A. Bài 8. Đun nóng mg hợp chất hữu cơ X chứa C, H, O mạch thẳng với dung dịch chứa 8g NaOH đến khi phản ứng xảy ra hoàn toàn. Trung hoà vừa hết lượng NaOH dư bằng 40ml dung dịch HCl 1M. Làm bay hơi hỗn hợp sau khi trung hoà một cách cẩn thận, thu được 7,36g hỗn hợp 2 ancol đơn chức và 15,14g hỗn hợp gồm 2 muối khan. Xác định CTCT của X. Đ: Bài 9. Cho mg chất X chứa C, H, O tác dụng với 152,5ml dung dịch NaOH 25% d=1,28 g/ml. Sau khi phản ứng xảy ra hoàn toàn thu được dung dịch A chứa muối 1 axit hữu cơ, 2 ancol đơn chức và xút dư. Trung hoà A bằng 255 ml dung dịch HCl 4M. Cô cạn dung dịch sau khi trung hoà thu được hỗn hợp hơi 2 ancol có tỷ khối so với H 2 là 26,5 và 78,67g hỗn hợp muối khan. Xác định CTCT của X và tính m, biết X có cấu tạo mạch thẳng. Bài 10. Hỗn hợp M gồm 2 chất hữu cơ A và B có tỉ lệ mol tương ứng là 2:1. Chất A mạch hở, chỉ chứa một loại nhóm chức, được điều chế từ axit no X và ancol no Y. Chất B là este đơn chức. Cho m gam hỗn hợp M hóa hơi hoàn toàn thì thể tích hơi thu được đúng bằng thể tích của 9,6g O 2 (ở cùng điều kiện về nhiệt độ và áp suất). Khi đốt cháy hoàn toàn 0,1 mol ancol Y cần 0,25 mol O 2. Cho mg hỗn hợp M phản ứng vừa đủ với dung dịch NaOH tạo được 41g muối duy nhất, và hỗn hợp N gồm 2 chất Y và Z. Chất Z có thành phần C, H, O, không tác dụng với Na, không có khả năng phản ứng tráng gương. Nếu đốt cháy hoàn toàn cùng một số mol A hoặc B thì số mol CO 2 thu được từ A luôn bằng số mol CO2 thu được từ B trong cùng điều kiện .Viết phương trình phản ứng và xác định công thức cấu tạo của A, B, X, Y, Z. Bài 11. Hợp chất hữu cơ A có chứa C, H, O không làm mất màu dung dịch Br2, chỉ chứa một loại nhóm chức. Khi thủy phân A tạo ra axit hữu cơ B có 2 liên kết đôi trong phân tử và ancol C. Chất B và C đều là mạch cacbon hở. Trong bình kín dung tích 10 lít chứa 0,1 mol B và một lượng hiđrocacbon no, mạch hở D và 12,8 gam O 2 vừa đủ. Đốt cháy hoàn toàn hỗn hợp này trong bình được CO2, hơi nước có số mol bằng nhau. a) Tính áp suất trong bình sau khi đốt ở 136,50C. Xác đinh CTPT của B, D. b) 0,2 mol A tác dụng hoàn toàn với dung dịch NaOH dư thu được 12,4 gam ancol. Xác định CTCT của A. Bài 12. Hỗn hợp A gồm axit hữu cơ X và este Y của 1 axit hữu cơ đơn chức. Lấy ag hỗn hợp cho phản ứng đủ với dung dịch NaOH, chưng tách sản phẩm ta thu được 9,3g một chất hữu cơ B và 39,4g hỗn hợp muối hữu cơ khan. Cho toàn bộ B phản ứng đủ với Na ta thu được 3,36 lít một khí ở đktc. Biết B có khối lượng phân tử nhỏ hơn 93 và B có phản ứng với Cu(OH)2 tạo thành dung dịch màu xanh trong suốt. Đem toàn bộ lượng muối hữu cơ nung với vôi tôi xút thi thu được 8,96 lít hơi (27,30C, 1,1atm) của một hiđrocacbon D. a) Xác định CTCT của B. b) Tính số mol các chất X, Y trong a(g) hỗn hợp A. Xác định CTCT của X, Y. c) Viết phương trình phản ứng của X với B (theo tỉ lệ 1:1). Bài 13: A là chất hữu cơ mạch hở chứa C, H, O và có 44,45% oxi về khối lượng. Khối lượng phân tử của A là 144 đv.C. Khi cho A tác dụng với NaOH thu được muối B , ancol C và anđehit D. Viết công thức cấu tạo có thể có của A, B, C, D. * Hỗn hợp este và axit. * Este, axit tạp chức 4
  5. Bài 1: Đốt cháy 0,1 mol chất hữu cơ A ( chỉ chứa C, H, O) với O 2 theo tỉ lệ mol 1 : 2. Sản phẩm cháy ( gồm CO 2, CO và nước) được dẫn toàn bộ vào bình 1 chứa PdCl2 (CO + PdCl2 + H2O → CO2 + Pd + 2HCl) rồi bình 2 chứa dung dịch Ca(OH) 2 cả hai bình đều có dư . Sau thí nghiệm bình 1 chỉ tăng 0,4 gam và xuất hiện 21,2 gam kết tủa và ở bình 2 khối lượng kết tủa là 30 gam. 1/ Viết các phương trình phản ứng . 2/ Xác định CTPT của A ( Cho Pd = 106). a) ứng với công thức trên có 3 đồng phân A1, A2, A3 tất cả các đều phản ứng được với dung dịch NaOH để cho lần lượt 9,4 gam; 6,8 gam; và 11,2 gam muối natri nếu ban đầu sử dụng là 0,1 mol mỗi đồng phân. Xác định CTCT của A 1, A2, A3 và viết phương trình phản ứng điều chế A2 từ A1. b) Để trung hoà lượng axit thủy phân trong một dung dịch chứa 77,4 gam X(là este của A 1 với ancol đơn chức B) phải dùng hết 200 ml dung dịch NaOH 1,5M. Để xà phòng hoá lượng este còn lại phải dùng thêm thể tích gấp đôi NaOH nói trên. Xác định X. c) Một đồng phân Y este khác của X khi xà phòng hoá với KOH cho muối có khối lượng bằng 49/43 khối lượng của este. Xác định este đồng phân Y. d) Trùng hợp X và Y thành polyme X’ và Y’, Sau đó đưa X’ và Y’ phản ứng với dung dịch NaOH. Viết phương trình phản ứng và gọi tên sản phẩm. Bài 2: Xà phòng hoá một este no đơn chức bằng một lượng vừa đủ dung dịch NaOH, chỉ thu được một sản phẩm duy nhất B ( không thu được sản phẩm khác dù chỉ là lượng nhỏ) Cô cạn dung dịch sau phản ứng, nung chất B với vôi tôi xút đến khối lượng không đổi thu được ancol Z và một muối vô cơ. Đốt cháy hoàn toàn ancol Z thu được CO 2 và hơi nước có tỉ lệ thể tích lần lượt là 3: 4. a) Viết các phương trình phản ứng tổng quát và xác định CTCT có thể có của este A biết A có mạch cacbon không phân nhánh. b) Hợp chất đơn chức A1 là đồng phân khác chức hoá học của A; A1 có khả năng phản ứng trùng hợp và có đồng phân hình học. Viết CTCT và đồng phân hình học của A1. Bài 3: Một este đơn chức X ( chứa C, H, O và không có nhóm chức khác). Tỉ khối của X so với O 2 là 32,15. Xác định CTCT của X trong mỗi trường hợp sau đây: a/ Cho 20 gam X tác dụng với 300 ml dung dịch NaOH 1M. Cô cạn dung dịch sau phản ứng thu được 23,2 gam bã rắn. b/ Cho 0,15 mol X tác dụng vừa đủ với dung dịch NaOH. Cô cạn dung dịch sau phản ứng thu được 21 gam muối khan ( X có mạch C không phân nhánh). Bài 4: Đốt cháy hoàn toàn 1,04 gam chất hữu cơ thì thu được 896ml CO2(đktc) và 0,72 gam H2O. a) Xác định công thức phân tử của A. Biết rằng 1,04 gam A ở thể hơi chiếm thể tích bằng thể tích của 0,32 gam oxi ở cùng điều kiện. b) Xác định công thức cấu tạo của A. Biết rằng khi đun nóng A với dung dịch NaOH thì thu được ancol no đơn chức có tỉ khối hơi so với H2 bằng 23 và một chất B. A có khả năng tác dụng với Na giải phóng H2. c) Chất B tác dụng với H2SO4 thì thu được chất hữu cơ C. Cho biết C có những tính chất hoá học gì?. Bài 5: Hợp chất X, Y đều chứa các nguyên tố C, H, O khối lượng phân tử của chúng là MX và MY, trong đó MX < MY < 130 đvC. Hoà tan hỗn hợp hai chất đó vào dung môi trơ, được dung dịch E. Cho E tác dụng với dung dịch NaHCO 3 dư thì số mol CO2 bay ra luôn luôn bằng tổng số mol của X và Y không phụ thuộc vào tổng số mol của chúng trong dung dịch. Lấy một lượng dung dịch E chứa 3,6 gam hỗn hợp X, Y (ứng với tổng số mol của X, Y bằng 0,05 mol), rồi cho tác dụng hết với Na thu được 784 ml H2 (đktc). a) Hỏi X, Y chứa các nhóm chức gì? Xác định CTPT của chúng biết chúng không có phản ứng tráng bạc, không làm mất màu dung dịch nước brom. b) Khi tách một phân tử nước khỏi Y thu được Z là hỗn hợp hai đồng phân hình học của nhau trong đó có một đồng phân có thể tách bớt 1 phân tử nước nửa để tạo thành chất P mạch vòng. P không phản ứng với dung dịch NaHCO 3. Xác định CTCT của Y và viết phương trình phản ứng chuyển hoá. Y → Z → P. Bài 6. Để đốt cháy hết 10ml thể tích hơi 1 hợp chất hữu cơ A cần dùng 30 ml O2 sản phẩm thu được chỉ gồm CO2 và hơi nước có thể tích bằng nhau và bằng thể tích oxi đã phản ứng. 1. Lập CTPT của A, viết CTCT và các đồng phân có thể tác dụng với dung dịch NaOH của A. Biết các thể tích khí và hơi đều đo ở cùng điều kiện về nhiệt độ và áp suất. 2. Trộn 2,7g A và 1,8g CH3COOH thu được hỗn hợp B. Lấy 1/2 hỗn hợp B cho tác dụng với Na dư thu được 0,504 lít khí H2 ở đktc, còn khi dẫn hơi A qua CuO đun nóng sẽ được chất E. E không tác dụng với AgNO 3/NH3 tạo ra Ag. Xác định CTCT và gọi tên A, viết các phương trình phản ứng xảy ra. Bài 7: Hợp chất A có công thức phân tử là C8H12O5. Cho 0,01 mol A tác dụng hết với lượng dung dịch NaOH vừa đủ sau đó cô cạn thu được một lượng ancol 3 lần ancol và 1,76g hỗn hợp chất rắn X gồm 2 muối của 2 axit hữu cơ đơn chức. Xác định công thức cấu tạo có thể có của A (không khai triển công thức gốc hiđrocacbon). 5
  6. ĐÁP ÁN CÁC DẠNG BÀI TẬP ESTE * Viết các đồng phân este: đơn chức, đa ch ức, no, không no(có đồng phân hình h ọc). Bài 1: C4H8O2 , C4H6O2 , C4H4O4 , C8H8O2 Bài 2: * Viết các phương trình tính chất của các este(chú ý các dạng este đ ặc bi ệt) Bài 1: Bài 2: * Xác định công thức phân tử, công thức cấu tạo của este đơn ch ức(1 este) Bài 1: HCOOC2H5. Bài 2: a/ C6H12O2; b/ CH3COOC4H9; c/ CH3COOC(CH3)3 Bài 3: C3H6O2 có 2 đồng phân Bài 4: a/ C2H4O; b/ CH3COOC2H5 Bài 5: a/ CH3COOCH3; b/ 66,67% Bài 6: a/ HCOOC2H5; b/ CH3COOCH3 Bài 7: C2H3COOC6H5; V = 800ml Bài 8: C3H6O2 Bài 10: a/ C4H8O2( 4 đf); b/ 4 gam; t = 136,50C Bài 9: M: Na; E: CH3COOC2H5 * Xác định công thức phân tử, công thức cấu tạo c ủa hỗn este đ ơn ch ức(2 este đ ồng phân ho ặc khác nhau) Bài 1. HCOOC3H7(2 đf) Bài 2: CH3COOC2H5 và CH3COOC3H7 Bài 3: a/ C2H5OH; b/ HCOOH và HCOOC2H5 Bài 4: HCOOC3H7(75%); CH3COOC2H5(25%) hoặc HCOOC3H7(87,5%); C2H5COOCH3(12,5%) Bài 5: HCOOCH3(44,78%) và CH3COOCH3(55,22%) Bài 6: a = 1,38 gam, HCOOC6H5 Bài 7: C2H5COOH; C2H5OH và C3H7OH Bài 8: CH3COOCH2-C2H3 và C2H5COOCH2-C2H3 Bài 9: CH3COOH và CH3COOC2H5 Bài 10. a/ CTPT C4H6O2, c/ HCOOCH=CH-CH3 (8,6 g) và CH2=CH-COOCH3(4,3 g) Bài 11. a/ CTPT C4H8O2(a =1)→ có 1 pi của nhóm chức, b/ MTB=88; A: C3H6O2; B: C5H10O2 * Xác định công thức cấu tạo của este dựa theo sản phẩm và đặc điểm cấu tạo * Hoàn thành sơ đồ phản ứng trong đó có este Bài 1: * Xác định công thức cấu tạo dựa vào tính chất khi biết CTPT Bài 1: Bài 2: X: HCHO; Y HOCH2CHO; HOCH2CH2COOH * Xác định công thức cấu tạo dựa vào tính chất khi biết phân tử kh ối và thành ph ần nguyên tố * Xác định công thức cấu tạo của este đa chức(chú ý tỉ lệ số mol các mu ối) Bài 1: (COOC2H5)2 Bài 2: A: C3H5(OCOC17H33)3; B: C17H33COOH Bài 3: (C2H5OOC)2RCOOCH3 hay (CH3OOC)2RCOOC3H7 Bài 4. A: C7H12O4; CH3OOC-CH2-CH2COOC2H5 Bài 5. a/ (CH3COO)2C2H4; h =80% Bài 6. (HCOO)2C2H4 và (CH3COO)2C2H4; a = 19,38; b = 0,38 Bài 7. (CH3COO)3C3H5 Bài 8. CH3OOC-CH=CH-COOC3H7 Bài 9. C2H5OOC-C4H8-COOC3H7 hoặc CH3OOC-C4H8-COOC4H9 Bài 10. A: (CH3COO)2C2H4; B: CH3COO-C(CH)3=CH-CH3; Y: C2H4(OH)2; X: CH3COOH Bài 11. a/ p = 2,686 atm; B: (COOH)2; D: C2H6 hoặc B:CH2(COOH)2; D: CH4 Bài 12. a/ B:C2H4(OH)2; b/ X:CH2(COOH)2; Y: (CH3COO)2C2H4; c/ CH2(COO)2C2H4 Bài 13: A: C6H8O4; CH2=CH-OOC-COOC2H5 hoặc CH2=CH-OOC-CH2-COOCH3 * Hỗn hợp este và axit. * Este, axit tạp chức Bài 1: A: C3H4O2; A1:C2H3COOH; A2HCOOC2H3; A3: este vòng; X: C2H3COOCH3; Y: CH3COOC2H3 Bài 2: a/ este vòng C4H6O2; A1: CH3-CH=CH-COOH Bài 3: a/ C2H5COOC2H3; b/ este vòng C5H8O2 Bài 4: a/ C4H8O3; b/ HOCH2COOC2H5; Bài 5: a/ TH1: CH3COOH(0,03); HOC2H4COOH(0,02); TH2: CH3COOH(0,04); (HO)2C3H5COOH(0,01)(3 đf) b/ HO-CH2-CH(OH)-CH2-COOH → HO-CH2-CH=CH-COOH → este vòng Bài 6. a/ C3H6O3; CH3-CH(OH)-COOH Bài 7: CH3COO-CH2-CH(OH)-CH2-OOC-CH3 6

CÓ THỂ BẠN MUỐN DOWNLOAD

Đồng bộ tài khoản