Đề thi giải Toán trên Casio năm 2008 cấp THCS

Chia sẻ: Trần Bá Trung4 | Ngày: | Loại File: PDF | Số trang:22

1
614
lượt xem
289
download

Đề thi giải Toán trên Casio năm 2008 cấp THCS

Mô tả tài liệu
  Download Vui lòng tải xuống để xem tài liệu đầy đủ

Đề thi giải Toán trên Casio năm 2008 cấp THCS này giúp các em học sinh ôn tập kiến thức, ôn tập kiểm tra, thi cuối kỳ, rèn luyện kỹ năng để các em nắm được toàn bộ kiến thức chương trình Toán cấp THCS.

Chủ đề:
Lưu

Nội dung Text: Đề thi giải Toán trên Casio năm 2008 cấp THCS

  1. TRƯỜNG.............................. Đề thi Trung Học Cơ Sở Casio 2008 và tài liệu ôn thi Casio
  2. Tµi liÖu «n luyÖn gi¶i to¸n casio fx500MS-570MS fx500MS- dïng casio fx500ms-fx570MS fx500ms- §Ó gi¶i to¸n $1 TÝnh gi¸ trÞ biÓu thøc A) Lo¹i mét biÕn bµi 1: Cho p(x)=3x3+2x2-5x+7. TÝnh: a) p(4)=211 b) p(1,213)=9,232049791 c) p(-2,031)= 0,271534627 bµi 2: Cho tanx=2,324 (x nhän) . 8cos 3 x − 2sin 3 x + cosx TÝnh: p= =-0,799172966 2cosx − sin 3 x + sin 2 x bµi 3: T×m m ®Ó p(x)=x4 +5x3-4x2+3x+m chia hÕt cho x-2 m=-46 bµi 4: T×m sè d− p(x)=x4 +5x3-4x2+3x+m chia cho 2x+1 bµi 5: Cho f(x)=x2-1 .Tinh f(f(f(f(f(2))))) =15745023 2= ANS2-1 = … = f(f(f(f(f(f(2)))))) =2479057493 x 1014 B) T×m giíi h¹n 3 n + 2 n +1 bµi 1: I = lim n → +∞ 5n + 3 n +1 3 A + 2 A+1 Ghi vµo mµn h×nh 5 A + 3 A+1 CALC m¸y hái A? 10= hiÖn 0,587… CALC m¸y hái A? 100= hiÖn 0,57735… ………… ……….. …………………. CALC m¸y hái A? 200= hiÖn 0,577350269 CALC m¸y hái A? 208= hiÖn 0,577350269 3 =>I=0,577350269…= 3 bµi 2: I = lim ( 3x 2 + x + 1 − x 3 ) x → +∞ Ghi vµo mµn h×nh 3x 2 + x + 1 − x 3 CALC m¸y hái X? 10= hiÖn 0,3147… CALC m¸y hái X? 100= hiÖn 0,2913… ………… ……….. …………………. CALC m¸y hái X? 100 000= hiÖn 0,28867… CALC m¸y hái X? 1000 000= hiÖn 0,28867… 3 =>I=0,28867…= 6 Π bµi 3: I = lim ( − x) tan x x→ Π 2 2 1
  3. Tµi liÖu «n luyÖn gi¶i to¸n casio fx500MS-570MS fx500MS- Π Π Ghi vµo mµn h×nh X = − A : ( − A) tan A 2 2 CALC m¸y hái A? Ên 0,1= m¸y hiÖn X=1,470… Ên = m¸y hiÖn 0,996677… CALC m¸y hái A? Ên 0,01= m¸y hiÖn X=1,560… Ên = m¸y hiÖn 0,999997… CALC m¸y hái A? Ên 0,001= m¸y hiÖn X=1,569… Ên = m¸y hiÖn 0,999999… CALC m¸y hái A? Ên 0,0001= m¸y hiÖn X=1,570... Ên = m¸y hiÖn 1,000000… =>I=1 øng dông tæng tÝch ph©n ®Ó t×m giíi h¹n 1 1 2 n 1 n i bµi 4: I = lim ( 1 + + 1 + + ... + 1 + ) = Lim n → +∞ n n n n n → +∞ n ∑ 1+ n i =1 HD: Chän hµm sè f(x) trªn ®o¹n [a;b] chia ®o¹n [a;b] thµnh n ®o¹n b»ng nhau 1 ∆ i = [xi −1 ; xi ] = n b 1 1 2 n 1 n i lim S n = lim ( 1 + + 1 + + ... + 1 + ) = Lim ∑ 1 + = ∫ f ( x)dx n → +∞ n n n n n → +∞ n → +∞ n n a i =1 1 1 1 2 n 1 n i 2 I = lim ( 1 + + 1 + + ... + 1 + ) = Lim ∑ 1 + = ∫ 1 + x dx = (2 2 − 1) n → +∞ n n n n n → +∞ n i =1 n 0 3 =1,218951416 n 1 2 n i bµi 5: I = lim ( 2 + 2 2 + ... + 2 2 ) = Lim ∑ 2 2 n → +∞ n + 1 n +2 n +n i =1 n + i n → +∞ x HD: Chän f(x)= trªn ®o¹n [0;1] chia ®o¹n [0;1] thµnh n ®o¹n b»ng nhau 1+ x2 1 ∆ i = [xi −1 ; xi ] = n i 1 1 2 n 1 n x 1 I = lim ( 2 + 2 2 + ... + 2 2 ) = Lim ∑ n =∫ 2 dx = ln 2 n → +∞ n + 1 n +2 n +n n → +∞ n i 2 i =1 1+ ( )2 0 1+ x n =0,34657359 3 n n n bµi 6: I = lim [1 + + + ... + ] n → +∞ n n+3 n+6 n + 3(n − 1) HD: Chän hµm sè f(x) trªn ®o¹n [0;3] chia ®o¹n [0;3] thµnh n ®o¹n b»ng nhau 3 ∆ i = [xi −1 ; xi ] = n 3 3 n n n 3 n 1 1 I = lim [1 + + + ... + ] = Lim ∑ =∫ dx = 2 n → +∞ n n+3 n+6 n + 3( n − 1) n → +∞ n i =1 i −1 0 1+ x 1+ n =2,00000000 1 bµi 7: I = lim (1 + )(1 + )...(1 + ) 1 2 n n  n  n → +∞  n n  2
  4. Tµi liÖu «n luyÖn gi¶i to¸n casio fx500MS-570MS fx500MS- 1  1 2 n n 1 1 2 n  HD: Pn = (1 + )(1 + )...(1 + ) ⇒ S n = ln Pn = ln(1 + n ) + ln(1 + n ) + ... + ln(1 + n )  n n n  n  1 1 1 2 n  ⇒ lim S n = lim ln Pn = lim ln(1 + ) + ln(1 + ) + ... + ln(1 + ) = ∫ ln(1 + x)dx = 2 2 − 1 n → +∞ n → +∞ n → +∞ n  n n n  0 1 1  1 2 n n ∫ ln(1+ x ) dx I = lim (1 + )(1 + )...(1 + ) = e 0 = e 2 ln 2−1 n → +∞  n n n  =6,22408924 Chän hµm sè f(x) trªn ®o¹n [0;3] chia ®o¹n [0;3] thµnh n ®o¹n b»ng nhau 3 ∆ i = [xi −1 ; xi ] = n C) Lo¹i nhiÒu biÕn 15m3 n 2 p − 4mn 2 p 4 + 17 mnp bµi 1: TÝnh:A= víi m=0,267; n=1,34; p=2,53. 2m 2 np 3 + 3m 2 np − 13n 2 p 3 0,729959094 3x − 4 x y 2 + 7 x 2 z 4 2 2 bµi 2: TÝnh:A= víi x=1,523; y=3,13; z=22,3. 9,237226487 2 x2 z + 4 y2 z3 x 2 (3 y − 5 z + 4) + 2 x( y 3 z 2 − 4) + 2 y 2 + z − 6 9 7 bµi 3: TÝnh:A= 2 2 4 víi x = , y = , z = 4 x ( x + 5 y − 7) + z + 8 4 2 65358 A= 8479 $2 Gi¶i hÖ ph−¬ng tr×nh bµi 1: Cho xf(x)-2f(1-x)=1 a) TÝnh f(2,123)=? b) TÝnh f(f(f(2,123)))=? NÕu bµi to¸n chØ cã c©u a) ®Æt: 2,123=A,1-A=B th×: 1-B=A nªn ta ®−îc hÖ:  Af ( A) − 2 f ( B) = 1 B+2 A−3  ⇔ f ( A) = = 2 −2 f ( A) + Bf ( B) = 1 AB − 4 A − A + 4 C1: 2,123 → A:1-A → B:(B+2):(AB-4) =-0,13737191 C2: 2,123 → A 1-A → B Vµo hÖ 2 Èn a1=A b1=-2 c1=1 a2=-2 b2=B c2=1 x=f(2,123)=-0,13737191 NÕu bµi to¸n cã c¶ c©u a) & b cã c©u C3: 2,123= (ANS-3):(ANS2 –ANS+4) = f(2,123)=-0,13737191 =f(f(2,123))=-0,754857679 =f(f(f(2,123)))=-0,705181585 bµi 2: Cho f ( x) + f  x +1    = x . TÝnh f(3,123)  1 − 3x   f ( A) + f ( B) = A A +1 B +1 C +1  §Æt 2,123=A, = B, = C th× = A nªn ta ®−îc hÖ  f ( B) + f (C ) = B 1− 3A 1 − 3B 1 − 3C  f (C ) + f ( A) = C  3
  5. Tµi liÖu «n luyÖn gi¶i to¸n casio fx500MS-570MS fx500MS- A +1 B +1 A− B+C C1 2,123 → A: → B: →C : =1,9105 1 − 3A 1 − 3B 2 C2 Vµo hÖ 3 Èn a1=1 b1=1 c1=0 d1=A a2=0 b2=1 c2=1 d2=B x=f(3,123)=1,910198182 a3=1 b3=0 c3=1 d1=C A − B + C 9 A3 + 6 A2 − A + 2 C3 Ta cã: f ( A) = = 2 18 A 2 − 2 3,123= 9 ANS 3 + 6 ANS 2 − ANS + 2 = 18 ANS 2 − 2 1f=1,910198182 2f=1,330308848 3f=1,087808394 4f=1,015407591 9f=1,000000514 10f=1,000000064 11f=1,000000008 12f=1,000000001 bµi 3: T×m m,n ®Ó p(x)=x4 +mx3-55x2+nx-156 chia hÕt cho x-2 & x-3 m=2,n=172 bµi 4: Cho p(x)=x5 +ax4+bx3+cx2+dx+132005. BiÕt r»ng khi x lÇn l−ît nhËn c¸c gi¸ trÞ:1,2,3,4.Th× gi¸ trÞ t−¬ng øng cña p(x) lµ:8,11,14,17. TÝnh gi¸ trÞ cña p(x) khi x lµ: 11,12,13,14,15. Do (1;8),(2;11),(3;14),(4;15) thuéc d: y=3x+5 XÐt: f(x)=p(x)-(3x+5) th×: f(1)=f(2)=f(3)=f(4)=0 suy ra f(x)=p(x)-(3x+5)=(x-1)(x-2)(x-3)(x-4).q(x) v× bËc f(x) lµ 5 nªn q(x)=x+r r=f(0)=5500 p(11)=27775478 p(12)=43655081 p(13)=65494484 p(14)=94620287 bµi 5: Cho p(x)=x4 +ax3+bx2+cx+d cã: p(1)=7, p(2)=28, p(3)=63. p (100) − p (−96) TÝnh p = 8 Cã (1;7),(2;28),(3;53) tháa y=7x2 XÐt: f(x)=p(x)-7x2 th×: f(1)=f(2)=f(3)=0 suy ra f(x)=p(x)-7x2=(x-1)(x-2)(x-3).q(x) v× bËc f(x) lµ 4 nªn q(x)=x+r p (100) − p (−96) 99.98.97.(100 − r + 96 + r ) + 7.100 2 + 7.96 2 = =23073617 8 8 bµi 6: §−êng trßn (C): x2+y2+px+qy+r=0 ®i qua A(5;4),B(-2;8),C(4;7).T×m p,q,r? − 15 − 141 − 58 §/S: p = ,q = ,r = 17 17 17 $3 NghiÖm gÇn ®óng cña ph−¬ng tr×nh A) T×m mét nghiÖm gÇn ®óng bµi 1: x- 4 x = 2 ⇔ x = 4 x + 2 1= 4 SHIFT x ANS +2=...= =3,35209964 bµi 2: 2x+x2-2x-5=0 ⇒ x = 2 x + 5 − 2 x =2,193755377 bµi 3: 2x+3x+4x=10x ⇒ x = lg(2 x + 3x + 4 x ) =0,90990766 bµi 4: cosx=tanx §Ó mµn h×nh ë radian 2= SHIFT tan-1 cos ANS =...= 0,666239432 bµi 5: x=cotx =>tanx =1/x §Ó mµn h×nh ë radian 4
  6. Tµi liÖu «n luyÖn gi¶i to¸n casio fx500MS-570MS fx500MS- 0,5= SHIFT tan-1 (1: ANS ) =...= 0,860333589 B) B Gi¶i nghiÖm gÇn ®óng ph−¬ng tr×nh: c b acosx+bsinx=c ⇔ cos( x − α ) = víi tan α = a>0 2 a +b 2 a b c x = tan −1 cos −1 + k 2Π k∈Z a a + b2 2 bµi 1: cosx+ 3 sinx= 2 1050;150 bµi 2: cosx-3sinx=3 -5307,48" ;-900 6 bµi 3: cosx+sinx= 750;150 2 bµi 4: sinx+ 3 cosx= 2 750;-150 bµi 5: 5cosx-12sinx=13 -67022,48" bµi 6: 5cosx+3sinx=4 2 450;16055,39" bµi 7: 5cosx+2sinx=-4 116010,3";200013,47" $4 T−¬ng giao gi÷a 2 ®−êng;cùc trÞ,®iÓm uèn,..cña hµm sè bµi 1: T×m gÇn ®óng to¹ ®é giao ®iÓm cña prabol (P): y2=4x vµ ®−êng trßn (C): x2+y2+2x-3=0 do y2=4x nªn chØ lÊy hoanh ®é d−¬ng hay nghiÖm d−¬ng cña x2+6x-3=0 (−6 + (62 + 4 ×1× 3)) : 2 :1 → A (0,46101615; 1,362500077) 4A bµi 2: T×m gÇn ®óng to¹ ®é giao ®iÓm cña ®−êng th¼ng (d): 2x-y-3=0 vµ ®−êng trßn (C): x2+y2=4 Do x +y2=4 nªn x , y ≤ 2 ; y=2x-3 & 5x2-12x+5=0 2 (12 + (122 − 4 × 5 × 5)) : 2 : 5 → A (A=1,86324958;B=0,726649916) 2A − 3 → B (12 − (122 − 4 × 5 × 5)) : 2 : 5 → C (C=0,53668504;D=-1,926649..) 2C − 3 → D bµi 3: T×m gÇn ®óng to¹ ®é giao ®iÓm cña x2 y2 ®−êng th¼ng (d): 3x-y-1=0 vµ elÝp (E): + =1 16 9 x2 y2 Do + = 1 nªn x ≤ 4, y ≤ 3 ; y=3x-1 & 153x2-96x-128=0 16 9 (96 + (96 2 + 4 ×153 × 128)) : 2 :153 → A (A=1,280692393;B=2,842077178) 3A −1 → B (96 − (962 + 4 ×153 ×128)) : 2 :153 → C (C=-0,653241412;D=-2,959724237) 3C − 1 → D bµi 4: T×m gÇn ®óng to¹ ®é giao ®iÓm cña x2 y2 ®−êng parabol (P): y2=2x vµ hypebol (H): − =1 16 36 x2 y2 Do − = 1 nªn x ≥ 4 ; 9x2-8x-144=0 16 36 5
  7. Tµi liÖu «n luyÖn gi¶i to¸n casio fx500MS-570MS fx500MS- (8 + (82 + 4 × 8 × 144)) : 2 : 9 → A (A= ;B=2,989668899) 2A → B bµi 5: T×m gÇn ®óng to¹ ®é giao ®iÓm cña x2 y2 ®−êng th¼ng (d): 8x-y-35=0 vµ hypebol (H): − =1 9 16 x2 y2 Do − = 1 nªn x ≥ 3 ; 560x2-5040x-11169=0 9 16 (5040 + (50402 − 4 × 560 ×11169)) : 2 : 560 → A (A=3,947408702;B=5,052591298) 8 A − 35 → B (5040 − (50402 − 4 × 560 × 11169)) : 2 : 560 → C (C=-3,420730386;D=5,420730386) 8C − 35 → D bµi 6: T×m gÇn ®óng gi¸ trÞ C§,CT cña hµm sè y=x3+x2-2x-1 khi a>0 th× xC§0 th× xC§
  8. Tµi liÖu «n luyÖn gi¶i to¸n casio fx500MS-570MS fx500MS- a2=xB b2=1 c2=yB b=-7/9 5 7 AB: y= − x − ph−¬ng tr×nh hoµnh ®é: 106x2-758x-2228=0 9 9 (758 − (7582 + 4 × 106 × 2228)) : 2 :106 → A 5 7 (A=-2,238551503;B=0,465861946) (− A − ) → B 9 9 (758 + (7582 + 4 × 106 × 2228)) : 2 :106 → C 5 7 (C=9,3894949...;D=-5,994163833) (− C − ) → D 9 9 bµi 10: T×m to¹ ®é M,N cña ®−êng trßn (C): x2+y2+10x-6y=30 víi ®−êng th¼ng AB biÕt A(-4;3) & B(5;-3). M(1,94807...;-0,96538...), N(-11,33269...;7,88846...) bµi 11: Cho hµm sè y=x3+x2-2x-1.Gäi A,B lµ ®iÓm cùc ®¹i,cùc tiÓu a) TÝnh gÇn ®óng AB b) t×m a,b ®Ó (d):y=ax+b ®i qua A vµ B. y,=3x2-4x+1 2 a) (4 − (4 − 4 × 3 ×1)) : 2 : 3 → A A3 − 2 A2 + A + 4 → B (4 + (4 2 − 4 × 3 × 1)) : 2 : 3 → C pol(A-C,B-D)=0,682929219 C 3 − 2C 2 + C + 4 → D HoÆc (A-C)2+(B-D)2 b) vµo hÖ 2 Èn a1=A b1=1 c1=B gi¶i ®−îc a=-2/9 a2=C b2=1 c2=D b=38/9 2 x2 − x + 4 bµi 12: Cho hµm sè y= .Gäi A,B lµ ®iÓm cùc ®¹i,cùc tiÓu x+5 a) TÝnh gÇn ®óng AB b) t×m a,b ®Ó (d):y=ax+b ®i qua A vµ B. 2 x 2 + 20 x − 9 Ta cã: y , = ( x + 5) 2 (−20 − (202 + 4 × 2 × 9)) : 2 : 2 → A a) 2 A2 − A + 4 →B A+5 (−20 + (202 + 4 × 2 × 9)) : 2 : 2 → C 2C 2 − C + 4 pol(A-C,B-D)=44,78839155 →D C +5 b) vµo hÖ 2 Èn a1=A b1=1 c1=B gi¶i ®−îc a=4 a2=C b2=1 c2=D b=-1 bµi 13: Cho ®−êng trßn (C1): x2+y2-2x-6y-6=0 vµ ®−êng trßn (C2):x2+y2=4 a)T×m gÇn ®óng to¹ ®é M,N giao ®iÓm cña 2 ®−êng trßn ®ã? M(-1,97305...;0,32450...), N(1,77350...;-0,92450...) b) ViÕt ph−¬ng tr×nh MN MN: x+3y+1=0 7
  9. Tµi liÖu «n luyÖn gi¶i to¸n casio fx500MS-570MS fx500MS- bµi 14: T×m gÇn ®óng a,b ®Ó ®−êng th¼ng (d): y=ax+b qua A(1;2) x2 y2 vµ lµ tiÕp tuyÕn cña hypebol (H): − =1 25 16  5  xAa + b = y A  a1 = −1  a2 = 6  theo bµi ra ta cã:  2 2 ⇔ & 25a − 16 = b b1 = 3 b = 7  2 6  bµi 15: Gäi M lµ ®iÓm cã c¶ 2 to¹ ®é ®Òu d−¬ng cña x2 y2 ®−êng parabol (P): y2=5x vµ hypebol (H): − =1 4 9 a) T×m gÇn ®óng to¹ ®é cña ®iÓm M M(3,990...;4,1225...) b) TiÕp tuyÕn cña (H) t¹i M cßn c¾t (P) t¹i ®iÓm N (N#M) t×m to¹ ®é N. 2 bµi 16: Cho f(x)= 2 x +3sin x −4cosx +7 Π a) tÝnh f ( ) =29,84042635 7 Π b) T×m a,b ®Ó y=ax+b lµ tiÕp tuyÕn cña ®å thÞ hµm sè ®· cho t¹i x= 7 Π Π Π , Π a) tÝnh f , ( ) =110,3696124; b= f ( ) − f ( ) =-19,69334... 7 7 7 7 $5 D·y sè A) T×m sè h¹ng bµi 1: u1=1;u2=2 & un+1=3un+un-1 víi: n >1.T×m u18, u19 ,u20? 1→ A 1→ A 2→B FX500MS FX570MS 2→B 3B + A → A A = 3B + A : B = 3 A + B 3A + B → B u19=1396700389 u20=4612988018 u21=1523566443 bµi 2: u1=1;u2=2 & un+1= un + un −1 2 2 1→ A 1→ A 2→B FX500MS FX570MS 2→B B 2 + A2 → A 2 2 A = B 2 + A2 : B = A2 + B 2 A +B →B 3 bµi 3: u1=1 & un+1= un .T×m u15 u15=u1q14-1= 0,017817948 4 2 5 + u n + un bµi 4: u1=1 & un+1= 2 n ≥ 1 .T×m u20 u20= 2,117238097 1 + un u bµi 5: u0=5 & un= n −1 n ≥ 1 .T×m u60 2un −1 + 1 5= ANS :(2ANS+1)=...=u60= 8,319467554.10-3 bµi 6: u1=3;u2=4;u3=5 & un+3=3un+2-3un+1+un+1 víi: n >1.T×m u30 ,u50? 8
  10. Tµi liÖu «n luyÖn gi¶i to¸n casio fx500MS-570MS fx500MS- 3→ A 3→ A 4→B 4→B 5→C FX500MS FX570MS 5 → C A − 3B + 3C + 1 → A A = A − 3B + 3C + 1: B = B − 3C + 3 A + 1 B − 3C + 3 A + 1 → B : C = C − 3 A + 3B + 1 C − 3 A + 3B + 1 → C u30=4995; u50=22155 bµi 7: D·y fib«nacci bµi 7.1: Bµi to¸n thá ®Î con Gi¶ sö thá ®Î con theo qui luËt:Mét ®«i thá cø mçi th¸ng ®Î ®−îc 1 ®«i thá con,mét ®«i thá con sau hai th¸ng l¹i sinh ®−îc mét ®«i thá n÷a, råi sau mçi th¸ng l¹i tiÕp tôc sinh ra mét ®«i thá n÷a,… gi¶ sö tÊt c¶ thá sinh ra ®Òu sèng vµ sinh s¶n b×nh th−êng hái cã mét ®«i thá sau 1 n¨m (12 th¸ng) cã bao nhiªu ®«i thá? NÕu gäi sè thá th¸ng n lµ unth×: u1=1;u2=1 & un+1=un+un-1víi: n ≥ 2.T×m u12 =144 bµi 7.2: C©y ®©m nh¸nh Gi¶ sö mét c©y ®©m nh¸nh nh− sau: C©y mäc lªn ®−îc 1 n¨m th× b¾t ®Çu ®©m ra mét nh¸nh,sau ®ã cø 2 n¨m th©n c©y l¹i ®©m ra mét nh¸nh qui luËt Êy cña th©n c©y chÝnh còng ¸p dông cho mäi nh¸nh mäc ra (tøc lµ mçi nh¸nh mäc ra sau 1 n¨m th× ®©m ra mét nh¸nh con),vµ nh¸nh chÝnh th× cø 2 n¨m l¹i ®©m ra mét nh¸nh.Coi th©n c©y lµ mét nh¸nh ®Æc biÖt,tÝnh sè nh¸nh cña c©y trong n¨m thø 5 NÕu gäi sè nh¸nh trong n¨m thø n lµ Snth×: Sn=Sn-1+Sn-2 víi: n ≥ 3.T×m S5 =8 u1=1;u2=1 & un+2=un+1+un víi: n ≥ 1.T×m u30 ,u39u40,u49 ? 1→ A 1→ A 1→ B FX500MS FX570MS 1→ B B+ A→ A A = B + A: B = A+ B A+ B → B  A A 1   1+ 5   1− 5    hoÆc un=    −  5  2   2        u30=832040;u39=63245986;u40=102334155;u49=7778742049 B) T×m tæng bµi 1: TÝnh Sn=1.2.3+2.3.4+...+n(n+1)(n+2) khi n=17 0→ A 1M + FX500MS M ( M + 1)( M + 2) + A → A 1M + ⇑= 1M + ⇑= 9
  11. Tµi liÖu «n luyÖn gi¶i to¸n casio fx500MS-570MS fx500MS- 0→ A 0→B FX570MS 0→C A = A + 1: B = A( A + 1)( A + 2) : C = C + B sè n cã trong RCLM+ n=17;kÕt qu¶ cã trong RCLA: S17=23256 bµi 2: TÝnh Sn=1.3.4+2.5.7+...+n(2n+1)(3n+1) khi n=30 0→ A 1M + FX500MS M (2 M + 1)(3M + 1) + A → A 1M + ⇑= 1M + ⇑= 0→ A 0→B FX570MS 0→C A = A + 1: B = A(2 A + 1)(3 A + 1) : C = C + B sè n cã trong RCLM+ n=30;kÕt qu¶ cã trong RCLA: S30=1345558 1 bµi 3: TÝnh Sn=a1+a2+...+an an = khi n=40 (n + 1) n + n n + 1 0→ A 1M + FX500MS 1: (( M + 1) M + M M + 1) + A → A 1M + ⇑= 1M + ⇑= 0→ A 0→B 0→C FX570MS 1→ D A = A + 1: B = 1: (( A + 1) A + A A + 1) : C = C + B : D = DB sè n cã trong RCLM+ n=40;kÕt qu¶ cã trong RCLA: S40=0,843826238; P40=... bµi 4: TÝnh Sn=1+2.6+3.62+...+n6n-1 khi n=12 0→ A 1M + FX500MS M 6 M −1 + A → A 1M + ⇑= 1M + ⇑= 0→ A 0→B FX570MS 0→C A = A + 1: B = A6 A−1 : C = C + B sè n cã trong RCLM+ n=12;kÕt qu¶ cã trong RCLA: S12=5137206313 10
  12. Tµi liÖu «n luyÖn gi¶i to¸n casio fx500MS-570MS fx500MS- 2 3 n bµi 5: TÝnh Sn=1+ + 2 + ... + n −1 khi n=50 3 2 2 1 1 2 3 n Ta cã: Sn+ = 0 + 1 + 2 + ... + n −1 3 2 2 2 2 0→ A 1M + FX500MS M : 2 M −1 + A → A 1M + ⇑= 1M + ⇑= 0→ A 0→B FX570MS 0→C 1→ D A = A + 1: B = A : 2 A−1 : C = C + B : D = DB sè n cã trong RCLM+ n=50;kÕt qu¶ cã trong RCLA: S50=4-1/3=14/3 P50=... bµi 6: TÝnh Sn=x+2.x2+3.x3+...+nxn khi n=10;30 vµ x=0,125 0→ A 0,125 → B 1M + FX500MS MB M + A → A 1M + ⇑= 1M + ⇑= 0→ A 0→B FX570MS 0→C A = A + 1: B = A.0,125 A : C = C + B sè n cã trong RCLM+ n=10;30;kÕt qu¶ cã trong RCLA: S10=0,163265304; S12=...=S30=0,163265306 1 1 bµi 7: Cho d·y {an} a1 = 1, a 2 = 2, a n + 2 = a n +1 + a n n ∈ N * .TÝnh S10 3 2 1120643 S10= 104976 1 1 bµi 8: Cho d·y {an} a1 = 1, a 2 = 2, a n +3 = a n + 2 + a n +1 + a n n ∈ N * .TÝnh U15 3 2 26502197 U15= 419904 C) ph−¬ng tr×nh sai ph©n I) Ph−¬ng tr×nh sai ph©n tuyÕn tÝnh thuÇn nhÊt bËc nhÊt. n D¹ng: axn+1+bxn=0 víi a,b kh¸c 0.Cã nghiÖm lµ: xn=  −b   x 0 , n=0,1,2,3,…  a  bµi 1: gi¶i xn+1-2xn=0 ,n=0,1,2,…vµ x0=-1/3.§−îc xn=(-1/3)2n. 11
  13. Tµi liÖu «n luyÖn gi¶i to¸n casio fx500MS-570MS fx500MS- II) Ph−¬ng tr×nh sai ph©n tuyÕn tÝnh kh«ng thuÇn nhÊt bËc nhÊt. D¹ng: axn+1+bxn=dn víi a kh¸c 0,b lµ h»ng sè & dn lµ sè nµo ®ã. n Cã nghiÖm lµ: xn=  −b   x 0 +xd xd lµ nghiÖm riªng cña ph−¬ng tr×nh, n=0,1,2,3,…  a  bµi 1: gi¶i 5xn+1+3xn=2n ,n=0,1,2,…víi x0=1. §−îc: xn=C(-3/5)n nghiÖm tæng qu¸t vÕ tr¸i,xd=C12n lµ nghiÖm riªng.Thay vµo PT 1 1 1 12 cã:5C1.2n+1+3C1.2n=2n ⇒ C1 = , x d = .2 n .do x0=1 nªn C+ = 1 ⇒ C = 13 13 13 13 n 12  − 3  1 n V¹y nghiÖm cña PT lµ: xn=   + .2 13  5  13 L−u ý: 1) NÕu dnlµ ®a thøc bËc k cña n th×: a) a+b ≠ 0 th×: xd=Pk(n) lµ ®a thøc bËc k cña n. b) a+b=0 th×: xd=n.Pk(n) lµ ®a thøc bËc k+1 cña n. bµi 1: gi¶i 3xn+1-2xn=n+1 ,n=0,1,2,…víi x0=1. §−îc: xn=C(2/3)n nghiÖm tæng qu¸t vÕ tr¸i cã a+b=3+(-2)=1 & dn=n+1 nªn: xd=C1n+C2. khi ®ã: 3[C1(n+1)+C2]-2[C1n+C2]=n+1 ®óng víi mäi n n suy ra C1=1,C2=-2 Tõ: xn=  −b n   x 0 +xd = C(3/2) .1+1.n-2 víi n=0 th×:  a  n 1=C-2 hay C=3 VËy: x n = 3  + n − 2 3   2 2 bµi 2: gi¶i xn+1=xn +2n ,n=0,1,2,…víi x0=1. §−îc: xn=C(1/1)n=C nghiÖm tæng qu¸t vÕ tr¸i cã a+b=3+(-2)=0 & dn=2n2 nªn: xd=n.(C1n2+C2n+C3). khi ®ã: (n+1)[C1(n+1)2+C2(n+1)+C3]-n[C1n2+C2n+C3]=2n2 ®óng víi mäi n suy raC1=2/3,C2=-2,C3=4/3 n Tõ: xn=  −b 2 3 4  x 0 +xd = C+ n − 2n + n víi n=0 th×:C=1 2   a  3 3 n VËy: xn=   x0 +xd = 1+ n 3 − 2n 2 + n víi n=0,1,2,… −b 2 4    a  3 3 2) NÕu dnlµ ®a thøc bËc 0 cña n (dn=d) th×: qn −1 −b a) a+b ≠ 0 th×:xd=c lµ ®a thøc bËc 0 cña n. x n = q n x0 + d q= q −1 a b) a+b=0 th×: xd=n.c lµ ®a thøc bËc 1 cña n. xn=x0+nd 3) NÕu dn cã d¹ng tùa ®a thøc dn=pk(n). α n α ≠ 0 th×: −b a) NÕu ≠ α th× xd=Qk(n). α n a −b b) NÕu = α th× xd=n.Qk(n). α n a  qn − α n d q ≠α c) NÕu dn=d. α n α ≠ 0 th×: xn=qnx0+  q − α dnq n −1 q =α  12
  14. Tµi liÖu «n luyÖn gi¶i to¸n casio fx500MS-570MS fx500MS- bµi 3: Cho d·y {un}:u0=2,un=3un-1+2n3-9n2+9n-3 víi n=1,2,3,..T×m sè h¹ng tæng qu¸t a+b=1-3=-2 ≠ 0 ud=C0n3+C1n2+C2n+C3 Tõ C0n3+C1n2+C2n+C3=3(C0(n-1)3+C1(n-1)2+C2(n-1)+C3) +2n3-9n2+9n-3 C0=-1, C1=C2=C3=0 nªn ud=-n3 =>un=C.3n-n3 v× u0=2 nªn C=2 hay un= 2.3n-n3 bµi 4: gi¶i xn+1-3xn =7 ,n=0,1,2,…víi x0=-1. 3n − 1 5 7 xn=3n(-1)+ 7= 3n- 3 −1 2 2 bµi 5: gi¶i xn+1-xn =5n+2 n=0,1,2,…víi x0=4. v× x0=4 nªn xn=C.1n.4=4, xd=n.(an+b) 5 −1 1 5 khi ®ã: (n+1)[a(n+1)+b]-n(an+b)=5n+2 suy ra a = , b = vËy xn= 4 − n + n2 2 2 2 2 bµi 6: gi¶i xn+1=xn +n n=0,1,2,…víi x0 lµ gi¸ trÞ ®Çu. xn=C, xd=n.(an+b) −11 khi ®ã: (n+1)[a(n+1)+b]=n(an+b)+n suy ra a = , b = 2 2 n(n − 1) n(n − 1) vËy xn=C+ nÕu x0 lµ 1 nghiÖm th×: xn=x0+ 2 2 n(n − 1) NÕu x0=0 th×: xn+1=xn +n= xn-1 +(n-1)+n=…=1+2+…+n= 2 bµi 7: gi¶i xn+1=xn +(n+1)2 n=0,1,2,…víi x0 lµ gi¸ trÞ ®Çu. xn=C, xd=n.(an2+bn+c) khi ®ã: (n+1)[a(n+1)2+b(n+1)+c]=n(an2+bn+c)+(n+1)2 1 1 1 1 1 1 suy ra a = , b = , c = vËy xn=C+ n3 + n 2 + 3 2 6 3 2 6 1 1 1 nÕu x0 lµ 1 nghiÖm th×: xn=x0+ n3 + n2 + 3 2 6 NÕu x0=0 th×: xn+1=xn +(n+1)2= xn-1 +n+(n+1)2=…=12+22+…+n2+(n+1)2 1 1 1 n(n + 1)(2n + 1) xn =12+22+…+n2= n3 + n2 + = 3 2 6 6 bµi 8: gi¶i xn+1=xn +(2n+1)2 n=0,1,2,…víi x0 lµ gi¸ trÞ ®Çu. xn=C, V× dn=(2n+1)2 nªn xd=n.(an2+bn+c) khi ®ã: (n+1)[a(n+1)2+b(n+1)+c]=n(an2+bn+c)+(2n+1)2 4 1 4 1 suy ra a = , b = 0, c = − vËy xn=C+ n3 − n 3 3 3 3 4 3 1 nÕu x0 lµ 1 nghiÖm th×: xn=x0+ n − n 3 3 NÕu x0=0 th×: xn+1=xn +(2n+1)2= xn-1 +(2n-1)+(2n+1)2=…=12+32+…+(2n-1)2+(2n+1)2 4 1 1 1 xn =12+32+…+(2n+1)2= n3 − n = n(4n2-1)= n(2n-1)(2n+1) 3 3 3 3 $6 −íc sè chung béi sè chung a b a = Um a m U= = NÕu: (a,b)=U & [a,b]=B th×  ⇒ = ⇒ m n b = Un b n B = an = bm = Umn 13
  15. Tµi liÖu «n luyÖn gi¶i to¸n casio fx500MS-570MS fx500MS- bµi 1: a=24614205, b=10719433 b 10719433 503 = = U=10719433: 503=21311 a 24614205 1155 B=10719433 . 1155=1238094512.1010 bµi 2: a=1234566, b=9876546 U=18,B=677402660502 $7 Bµi to¸n l·i suÊt A) L·i ®¬n L·i ®¬n lµ l·i ®−îc tÝnh theo tØ lÖ phÇn tr¨m trong mét kho¶ng thêi gian cè ®Þnh tr−íc. bµi 1: 1 triÖu ®ång göi ng©n hµng l·i suÊt 5% /n¨m Hái: Sau 1 n¨m,2 n¨m, n n¨m rót ra c¶ vèn lÉn l·i sÏ lµ bao nhiªu? Sau 1 n¨m rót ra ®−îc: 1 000 000+1 × 1 000 000.5%=1 000 000+50 000 x1 =1 050 000 ® Mét triÖu n¨m m−¬i ngµn ®ång Sau 2 n¨m rót ra ®−îc: 1 000 000+2 × 1 000 000.5%=1 000 000+2 × 50 000 x2 =1 100 000 ® Mét triÖu mét tr¨m ngµn ®ång Sau n n¨m rót ra ®−îc: 1 000 000+n × 1 000 000.5%=1 000 000+n × 50 000 xn =1 000 000+n × 50 000 ®. 5 5 2 NÕu l·i suÊt lµ %/th¸ng th× cuèi th¸ng ®Çu sÏ cã: 1 000 000 × %=4166 ® 12 12 3 2 sau 1 n¨m tæng sè tiÒn l·i vÉn nh− tr−íc 50 000=4166 × 12 3 Nh− vËy víi l·i ®¬n kh«ng cã sai kh¸c g× nÕu ta nhËn l·i theo trßn n¨m hay theo tõng th¸ng.Tuy nhiªn nÕu ta rót tiÒn ra gi÷a chõng. 2 Ch¼ng h¹n sau 18 th¸ng sÏ lµ: 1 000 000+ 4166 × 18=1 075 000®. 3 Nh−ng kú h¹n 1 n¨m ChØ lµ: 1 000 000+1 × 1 000 000.5%=1 050 000® mÊt ®i 25 000® VËy nªn c¸ch göi nµy Ýt thu hót kh¸ch hµng. B) L·i kÐp L·i kÐp lµ l·i mµ sau mét ®¬n vÞ thêi gian ( n¨m,th¸ng,ngµy,giê,phót,gi©y,..) l·i ®−îc gép vµo vèn ®Ó tÝnh l·i. Hay lo¹i l·i mÑ ®Î l·i con… C«ng thøc (1): C=a(1+r)N=a (1+r)+a (1+r)2+…+a(1+r)N C TiÒn rót vÒ c¶ gèc lÉn l·i. a TiÒn göi ban ®Çu (tiÒn gèc) r l·i suÊt mçi kú N kú h¹n A=0 B=0 A=A+1:B=B+(1+r)A C«ng thøc (2): Cr=a(1+r)[(1+r)N-1] C TiÒn rót vÒ c¶ gèc lÉn l·i. a TiÒn göi mçi kú (tiÒn gèc) r l·i suÊt mçi kú N kú h¹n 14
  16. Tµi liÖu «n luyÖn gi¶i to¸n casio fx500MS-570MS fx500MS- VÝ dô: 1 triÖu ®ång göi ng©n hµng l·i suÊt 5% /n¨m Hái: Sau 1 n¨m,2 n¨m, n n¨m rót ra c¶ vèn lÉn l·i sÏ lµ bao nhiªu? Sau 1 n¨m rót ra ®−îc: 1 000 000+1 × 1 000 000.5%=1 000 000+50 000 x1 =1 050 000 ® Mét triÖu n¨m m−¬i ngµn ®ång x1=1 000 000(1+5%)=x0(1+5%® Sau 2 n¨m rót ra ®−îc: 1 050 000+1 050 000.5%=1 102 500® x2 =1 102 500 ® Mét triÖu mét tr¨m linh hai ngµnn¨m tr¨m ®ång x2=x1+x1.5%=x1(1+5%) =x0(1+5%)2 ® Sau n n¨m rót ra ®−îc: xn=x0(1+5%)n ® 5 5 2 NÕu l·i suÊt lµ %/th¸ng th× cuèi th¸ng ®Çu sÏ cã: 1 000 000 × %=4166 ® 12 12 3 2 sau 1 n¨m tæng sè tiÒn l·i vÉn nh− tr−íc 50 000=4166 × 12 3 Bµi 1: 1 triÖu ®ång göi ng©n hµng l·i suÊt 0,7% th¸ng Hái: Sau 15 th¸ng rót ra c¶ vèn lÉn l·i sÏ lµ bao nhiªu? 1 000 000(1+0,007)15=1.110.304 Bµi 2: Muèn cã 1 triÖu ®ång sau 15 th¸ng th× ph¶i göi ng©n hµng mçi th¸ng sè tiÒn b»ng nhau vµ b»ng bao nhiªu? nÕu l·i suÊt hµng th¸ng lµ 0,6%/th¸ng. C1 Cr=a(1+r)[(1+r)15-1]=>a=63.530® C2 C= a (1+r)+a (1+r)2+…+a(1+r)15 A=0 B=0 A=A+1:B=B+1,006A =… = ®Õn A=15 = 1.000.000:B= Bµi 3: Muèn cã 1 triÖu ®ång sau 15 th¸ng th× ph¶i göi ng©n hµng mçi th¸ng sè tiÒn b»ng nhau vµ b»ng 63.530®.TÝnh l·i suÊt hµng th¸ng. (1+r)+ (1+r)2+…+(1+r)15 = C/ a A+A2+…+A15=1 000 000/63 530 SHIFT SOLVE x=1,006=>r=0,006=0,6%. Bµi 4: Muèn cã 1 triÖu ®ång sau 15 th¸ng th× ph¶i göi ng©n hµng mçi th¸ng sè tiÒn b»ng nhau vµ b»ng 63.530® víi l·i suÊt hµng th¸ng 0,6% trong bao l©u? (1+r)+ a(1+r)2+…+a(1+r)N = C A=0 B=0 A=A+1:B=B+63 530.1,006A =… = ®Õn B=1.000.000 th× gi¸ trÞ cña A liÒn tr−íc ®ã N=15. Bµi 5: Mçi th¸ng göi ng©n hµng mét sè tiÒn b»ng nhau vµ b»ng 63.530® víi l·i suÊt hµng th¸ng 0,6%. Hái: Sau 15 th¸ng khi rót ra c¶ vèn lÉn l·i ®uù¬c bao nhiªu? (1+r)+ a(1+r)2+…+a(1+r)15 = C A=0 B=0 A=A+1:B=B+63 530.1,006A =… = ®Õn A=15 15
  17. Tµi liÖu «n luyÖn gi¶i to¸n casio fx500MS-570MS fx500MS- th× gi¸ trÞ cña B liÒn sau ®ã B=999998. Bµi 6: Theo thÓ thøc l·i kÐp, mét ng−êi göi 10 triÖu ®ång vµo ng©n hµng. a) NÕu kú h¹n 1 n¨m víi l·i xuÊt 7,56% th× sau 2 n¨m ng−êi ®ã thu vÒ ®−îc sè tiÒn lµ bao nhªu? 10.(1+0,0756)2=11,569 triÖu ®ång b) NÕu kú h¹n 3 th¸ng víi l·i xuÊt 1,65% th× sau 2 n¨m ng−êi ®ã thu vÒ ®−îc sè tiÒn lµ bao nhªu? 10.(1+0,0165)8=11,399 triÖu ®ång Bµi 7: Mét ng−êi ®Çu t− 100 triÖu vµo mét c«ng ty theo thÓ thøc l·i kÐp víi l·i suÊt 13% mét n¨m. Hái sau 5 n¨m míi rót l·i ra th× ng−êi ®ã thu ®−îc bao nhiªu tiÒn l·i? 100.(1+0,13)5=184,2435179-100= 84 243 517 9triÖu ®ång Bµi 8: Mét ng−êi göi 15 triÖu vµo ng©n hµng theo thÓ thøc l·i kÐp kú h¹n 1 n¨m víi l·i suÊt 7,56% mét n¨m.Gi¶ sö l·i suÊt kh«ng thay ®æi.Hái sè tiÒn ng−êi ®ã thu ®−îc (c¶ vèn lÉn l·i) sau 5 n¨m lµ bao nhiªu triÖu ®ång? lµm trßn ®Õn ch÷ sè thËp ph©n thø 2. 15.(1+0,0756)5=21,59 triÖu ®ång Bµi 9: Mét ng−êi göi tiÒn tiÕt kiÖm ë ng©n hµng theo thÓ thøc l·i kÐp víi sè tiÒn ban ®Çu lµ 3 triÖu vµ sau ®ã cø 2 th¸ng ng−êi ®ã l¹i göi thªm 1 triÖu biÕt l·i suÊt hµng th¸ng lµ 0,5%. TÝnh sè tiÒn ng−êi ®ã thu ®−îc sau 5 n¨m 2 th¸ng lµ bao nhiªu? 3000 000 A A+A/200 B B+B/200 C (C+1000 000)+ (C+1000 000)/200 A = 39 223 987 Bµi 10: Mét ng−êi lÜnh l−¬ng khëi ®iÓm lµ 700 000®/th¸ng.Cø 3 n¨m l¹i ®−îc t¨ng l−¬ng 7%. Hái: sau 36 n¨m lµm viÖc liªn tôc vµ t¨ng l−¬ng b×nh th−êng th× ng−êi ®ã ®· lÜnh ®−îc bao nhiªu tiÒn l−¬ng? Gäi x0=700 000® (LÜnh trong 36 th¸ng ®Çu =3 n¨m) NÕu møc t¨ng l−¬ng 7% th×: 3 n¨m kÕ sau ®−îc lÜnh x1=x0(1+r/100)® 3 n¨m kÕ sau ®−îc lÜnh x2=x1(1+r/100)= x0(1+r/100)2 ®… VËy cø sau 3n n¨m (n=1,2,..,11) B¾t ®Çu tõ th¸ng thø nhÊt cña n¨m 3n+1 l¹i t¨ng vµ lÇn cuèi cïng vµo th¸ng thø nhÊt cña n¨m thø 34. S=36.x0.(1+r%)12:r%=450 788 972 GÇn 451 triÖu Bµi 11: Mét ng−êi göi tiÕt kiÖm nh− sau: B¾t ®Çu tõ th¸ng l−¬ng ®Çu tiªn anh ta göi tiÕt kiÖm 100 000® víi l·i xuÊt 0,4%/th¸ng. Hái khi vÒ h−u ( sau 36 n¨m c«ng t¸c liªn tôc) anh ta rót tÊt c¶ ra sÏ ®−îc sè tiÒn lµ bao nhiªu? Víi l·i suÊt tiÕt kiÖm lµ m=r%=r/100/th¸ng §Çu th¸ng thø 1 sè tiÒn trong sæ lµ: y0® Cuèi th¸ng thø 1 anh ta nhËn ®−îc y1=y0(1+m)® §Çu th¸ng thø 2 sè tiÒn trong sæ lµ: z1=y1+y0=y0((1+m)+1) Cuèi th¸ng thø 2 sè tiÒn trong sæ lµ: y2=z1(1+m)= y0((1+m)+1)(1+m)=y0((1+m)2+(1+m)) §Çu th¸ng thø 3 sè tiÒn trong sæ lµ: y0 z2=y2+y0=y0((1+m)2+(1+m))+y0= ((1+m)3-1) m y0 Cuèi th¸ng thø 3 sè tiÒn trong sæ lµ:y3= ((1+m)3-1)(1+m) m y Cuèi th¸ng thø n-1 sè tiÒn trong sæ lµ:yn-1= 0 ((1+m)n-1-1)(1+m) m 16
  18. Tµi liÖu «n luyÖn gi¶i to¸n casio fx500MS-570MS fx500MS- y0 §Çu th¸ng thø n sè tiÒn trong sæ lµ: zn= yn+y0= ((1+m)n-1) m y0 Cuèi th¸ng thø n sè tiÒn trong sæ lµ: yn= ((1+m)n-1)(1+m) m y0=100 000®,m=0,4%,n=36.12=432 th¸ng lµ: 115711347.7 gÇn 116 triÖu Bµi 12: Mét ng−êi mua nhµ trÞ gi¸ 200 triÖu ®ång theo ph−¬ng thøc tr¶ gãp.Mçi th¸ng anh ta tr¶ 30 triÖu ®ång Hái: a) Sau bao l©u anh ta tr¶ hÕt sè tiÒn trªn? b) NÕu anh ta ph¶i chÞu l·i suÊt cña sè tiÒn ch−a tr¶ lµ 0,4%/th¸ng vµ mçi th¸ng b¾t ®Çu tõ th¸ng thø 2 anh ta vÉn tr¶ 30 triÖu ®ång sau bao l©u anh ta tr¶ hÕt tiÒn. a) 200 000 000:30 000 000=66.667 th¸ng gÇn 7 n¨m b) A lµ tiÒn nî ban ®Çu,r=r% lµ l·i suÊt hµng th¸ng,x lµ sè tiÒn tr¶ hµng th¸ng A=A 1 + r r  Sau th¸ng thø 1 anh ta nî:A+   = Ak 100  100  khi tr¶ x ® nªn cßn Ak-x Sau th¸ng thø 2 anh ta nî: (Ak-x) 1 + r  2   -x= Ak -x(k+1)  100  Sau th¸ng thø 3 anh ta nî: k 3 −1 (Ak2-x(k+1))k-x= Ak3-x(k2+k+1)=Ak3-x k −1 n k n −1  r   100 x  100 x Sau th¸ng thø n anh ta nî: An=Akn-x = 1 +  A− + k − 1  100   r  r n Sau n th¸ng tr¶ xong nî tøc lµ An=0 suy ra 1 + r  100 x   =  100  100 x − Ar VËy A=200 000 000®,r=0,4%,x=3 000 000® n  r  100.3000000 1 +  = = 1,3636364  100  100.3000000 − 200000000.0,4 =>77
  19. Tµi liÖu «n luyÖn gi¶i to¸n casio fx500MS-570MS fx500MS- 1) a2=b2+c2 2) b2=a2-c2=ab, ; c2=a2-b2=ac, 3) bc=aha 4) ha2 = b, c , 1 1 1 5) 2 = 2+ 2 ha b c 6) *) b=asinB=acosC=ctanB=ccotC *) c=asinC=acosB=btanC=bcotB B) Tam gi¸c: ∆ABC a b c 1) §Þnh lý hµm sè sin: = = = 2R sin A sin B sin C b2 + c2 − a2 2) §Þnh lý hµm sè c« sin: a2=b2+c2-2bccosA ⇒ cos A = 2bc c + a2 − b2 2 b2=c2+a2-2cacosB ⇒ cos B = 2ca a2 + b2 − c 2 c2=a2+b2-2abcosC ⇒ cos C = 2ab 2 2 2 b +c a 3) §Þnh lý ®é dµi trung tuyÕn: 2 ma = − 2 4 2 c + a b2 2 2 mb = − 2 4 a + b c2 2 2 mc2 = − 2 4 4) §é dµi ®−êng ph©n gi¸c: A 2bccos gi¸c *) Ph©n gi¸c trong AD = la = 2 = 2 bcp ( p − a) b+c b+c 2 *) Ph©n gi¸c ngoa× ngoa× AE = bc( p − b)( p − c) b−c 5) DiÖn tÝch tam gi¸c 1 1 1 1. S = aha = bhb = chc 2 2 2 1 1 1 2. S = ab sin C = bc sin A = ca sin B 2 2 2 3. S = pr = ( p − a)ra = ( p − b)rb = ( p − c)rc 4. S=2R2sinAsinBsinC abc 5. S = 4R 1 xB − x A yB − y A 6. 2 xC − x A yC − y A 6) DiÖn tÝch tam gi¸c t¹ä ra bëi 3 ch©n ®−êng ph©n gi¸c trong: A1,B1,C1. gi¸c gi¸c S1 dt (∆A1 B1C1 ) 2abc = = S dt (∆ABC ) (a + b)(b + c)(c + a ) Bµi 1: Cho h×nh thang vu«ng ABCD cã:AB=12,35; BC=10,55 & gãcADC=570. 18
  20. Tµi liÖu «n luyÖn gi¶i to¸n casio fx500MS-570MS fx500MS- TÝnh: a) Chu vi 2p=54,68068285… b) diÖn tÝch S=166,4328443… c) gãc cßn l¹i cña tam gi¸c ACD ACD=40030,20,31” DAC=82029,40” 0 Bµi 2: Cho tam gi¸c ABC cã: B=120 ;AB=6,25;BC=12,50 & ph©n gi¸c trong cña B c¾t AC ë D . TÝnh: a) BD =4,1666667… AD BB , 1 b) TÝnh dt(ABD):dt(ABC) = = = AC B , C 3 c) dt(ABD) =11,27637245 Bµi 3: Cho h×nh ch÷ nhËt ABCD cã BH vu«ng gãc víi ACvµ E,F,G lÇn l−ît lµ trung ®iÓm cña: AH,BH,CD. a) CMR: Tø gi¸c EFCG lµ h×nh b×nh hµnh.Tam gi¸c BEG lµ tam gi¸c g×?v× sao? BEG=900 b) BH=17,25; gãcBAC=38040,.TÝnh diÖn tÝch ABCD. =609,9702859… c) TÝnh AC =35,36059628… dt ( AMN ) 1 Bµi 4: Cho tam gi¸c ABC cã: A=450;C=1050;Mthuéc AB,N thuéc AC biÕt = . dt ( ABC ) 2 TÝnh: AN/AC. *) khi MN kh«ng song song BC dt ( AMN ) AM . AN AN sin M AB sin C = (1) mÆt kh¸c = t−¬ng tù = dt ( ABC ) AB. AC AM SinN AC SinB AN AB sin M sin C ⇒ . = . (2) AC AM SinN sin B tõ ®ã suy ra: 2 1 dt ( AMN ) AN AM sin N sin B  AN  sin 75 0 sin 30 0 AN = = . . . =  0 0 ⇒ = sin 60 0 2 dt ( ABC ) AC AC sin M sin C  AC  sin 60 sin 105 AC =0,930604859… *) khi MN song song BC 2 1 dt ( AMN ) AM . AN  AN  1 AN = = =  = ⇒ =0,707106781… 2 dt ( ABC ) AB. AC  AC  2 AC $10 Tø gi¸c 1) Tø gi¸c låi ABCD c¹nh:a,b,c,d Th×: B+D S= ( p − a)( p − b)( p − c)( p − d ) − abcd cos 2 2 2) Tø gi¸c låi ABCD néi tiÕp ®−êng trßn b¸n kÝnh R,c¹nh:a,b,c,d Th×: a+b+c+d *) S= ( p − a)( p − b)( p − c)( p − d ) p= 2 (ac + bd )(ab + cd )(ad + bc) *) R= 4S 2S *) NÕu gãc gi÷a 2 ®−êng chÐo lµ: α th×: sin α = ac + bd Bµi 1: Cho tø gi¸c néi tiÕp ABCD cã: a=5,32; b=3,45; c=3,96; d=4,68. TÝnh gãc α gi÷a 2 ®−êng chÐo. α =8208, Bµi 2: Cho tø gi¸c ABCD néi tiÕp ®−êng trßn cã b¸n kÝnh R. BiÕt: a=3,657; b=4,155; c=5,651; d=2,765. TÝnh b¸n kÝnh R. R=2,9916… Bµi 3: Cho tø gi¸c låi ABCD cã: a=18; b=34; c=56; d=27 & B+D=2100. 19

CÓ THỂ BẠN MUỐN DOWNLOAD

Đồng bộ tài khoản