Đề thi thử ĐH, CĐ - Môn Hóa

Chia sẻ: Phan Gia Khuê | Ngày: | Loại File: DOC | Số trang:5

0
239
lượt xem
154
download

Đề thi thử ĐH, CĐ - Môn Hóa

Mô tả tài liệu
  Download Vui lòng tải xuống để xem tài liệu đầy đủ

Tham khảo tài liệu 'đề thi thử đh, cđ - môn hóa', tài liệu phổ thông, ôn thi đh-cđ phục vụ nhu cầu học tập, nghiên cứu và làm việc hiệu quả

Chủ đề:
Lưu

Nội dung Text: Đề thi thử ĐH, CĐ - Môn Hóa

  1. Đề 01 ĐỀ THI THỬ VÀO ĐẠI HỌC, CAO ĐẲNG Môn thi: HÓA HỌC (Đề thi có 04 trang) Thời gian làm bài: 90 phút (không kể thời gian giao đề) Câu 1. Trong tự nhiên oxi có ba đồng vị 16O, 17O, 18O; cacbon có hai đồng vị 12C, 13C. Hỏi có thể có bao nhiêu loại phân tử khí cacbonic tạo thành từ các đồng vị trên? A. 6. B. 9. C. 12. D. 18. Câu 2. Tổng số electron thuôc cac phân lơp p trong nguyên tử của nguyên tố X là 15. Số điện tích hạt nhân của X bằng ̣ ́ A. 23. B. 29. C. 35. D. 33. Câu 3. Cho các hạt vi mô: O2- (Z = 8); F - (Z = 9); Na, Na+ (Z = 11), Mg, Mg2+ (Z = 12), Al (Z = 13). Thứ tự giảm dần bán kính hạt là: A. O2-, F -, Na, Na+, Mg, Mg2+, Al. B. Na, Mg, Al, Na+, Mg2+, O2-, F - C. Na, Mg, Al, O2-, F - , Na+, Mg2+. D. Na+, Mg2+, O2-, F -, Na, Mg, Al. Câu 4. Nguyên tử của nguyên tố X có cấu hình electron ở 2 phân lơp ngoài cùng là 3d24s2. Vị trí trong bảng tuần hoàn của X là: A. chu kì 4, phân nhóm chính nhóm IV. B. chu kì 4, phân nhóm phụ nhóm IV. C. chu kì 4, phân nhóm chính nhóm II. D. chu kì 4, phân nhóm phụ nhóm II. Câu 5. Cho 7 gam hỗn hợp Cu, Fe (trong đó Fe chiếm 40% khối lượng) tác dụng vơi dd HNO 3 loãng. Sau khi phản ứng xảy ra hoàn toàn, thu được khí NO (sản phẩm khử duy nhất), còn lại 4,6 gam kim loại không tan và dd X. Muối có trong dung dịch X là A. Fe(NO3)3. B. Cu(NO3)2. C. Fe(NO3)3 và Cu(NO3)2. D. Fe(NO3)2. Câu 6. Cho 5 gam brom có lẫn tạp chất là clo vào một dung dịch chứa 1,600 gam kali bromua. Sau phản ứng làm bay hơi dung dịch thì thu được 1,155 gam chất rắn khan. Phần trăm về khối lượng của clo trong mâu brom đem phản ứng là ̃ A. 5,1%. B. 6,1%. C. 7,1%. D. 8,1%. Câu 7. Khi đun nóng muối kali clorat, không có xúc tác, muối này bị phân huỷ đồng thời theo hai hương (a) KClO3 → KCl + O2 và (b) KClO3 → KClO4 + KCl Biết rằng phân huỷ hoàn toàn 7,35 gam KClO3 thu được 3,35 gam KCl. Phần trăm kali clorat bị phân huỷ theo (a) và (b) tương ứng là A. 66,67% và 33,33%. B. 33,33% và 66,67%. C. 55,55% và 44,45%. D. 44,45% và 55,55% . Câu 8. Cho 1,2 lít hỗn hợp gồm hiđro và clo vào bình thuỷ tinh đậy kín và chiếu sáng bằng ánh sáng khuếch tán. Sau một thời gian ngừng chiếu sáng thì thu được một hỗn hợp khí chứa 30% hiđroclorua về thể tích và hàm lượng của clo đã giảm xuống còn 20% so vơi lượng clo ban đầu. Thành phần phần trăm về thể tích của hiđro trong hỗn hợp ban đầu và trong hỗn hợp sau phản ứng lần lượt bằng A. 66,25% và 18,75%. B. 81,25% và 66,25%. C. 66,25% và 30,75% D. 88,25% và 30,75%. Câu 9. Một dung dịch có chứa H2SO4 và 0,543 gam muối natri của một axit chứa oxi của clo (muối X). Cho thêm vào dung dịch này một lượng KI cho đến khi iot ngừng sinh ra thì thu được 3,05 gam I2. Muối X là A. NaClO4. B. NaClO3. C. NaClO2. D. NaClO. Câu 10. Phản ứng giữa HNO3 vơi Fe3O4 tạo ra khí X (sản phẩm khử duy nhất) có tổng hệ số trong phương trình hoá học là 20 thì khí X là
  2. A. N2. B. NO. C. NO2. D. N2O. Câu 11. Cho 22 gam dd NaOH 10% vào 5 gam dd axit H3PO4 39,2%. Muối thu được sau phản ứng là A. Na2HPO4. B. NaH2PO4. C. Na2HPO4 và NaH2PO4. D. Na3PO4 và Na2HPO4. Câu 12. Dẫn từ từ khí NH3 đến dư vào dd ZnCl2. Hiện tượng quan sát được là A. có kết tủa lục nhạt, không tan. B. có kết tủa trắng không tan. C. có kết tủa xanh lam, không tan. D. có kết tủa trắng, sau đó tan ra. Câu 13. Ankan X tác dụng vơi clo (askt) tạo ra dẫn xuất monoclo trong đó clo chiếm 55,04% về khối lượng. X có công thức phân tử là A. CH4. B. C2H6. C. C3H8. D. C4H10. Câu 14. Biết m gam một anken Y phản ứng được vơi tối đa 20m/7 gam Br2. Công thức phân tử của Y là A.C2H4. B. C4H8. C. C3H6. D. C5H10. Câu 15. Cho dung dịch chứa 1,22 gam chất hữu cơ X là đồng đẳng của phenol tác dụng vơi nươc brom (dư) thu được 3,59 gam hợp chất Y chứa 3 nguyên tử brom trong phân tử (h = 100%). Công thức phân tử của X là A. C7H8O. B. C8H10O. C. C9H12O. D. C10H14O. Câu 16. Amin đơn chức X chứa 15,05% khối lượng nitơ. Tên X là A. metylamin. B. etylamin. C. pentylamin. D. phenylamin. Câu 17. Sắp xếp theo thứ tự tăng dần tính bazơ của các chất sau: (1) NH 3, (2) CH3NH2, (3) C6H5NH2, (4) (CH3)2NH, (5) C2H5NH2, (6) p-O2N-C6H4NH2. A. 6, 3, 1, 2, 5, 4. B. 3, 6, 1, 2, 4, 5. C. 4, 5, 2, 3, 1, 6. D. 1, 2, 3, 4, 5, 6. Câu 18. Tách nươc từ rượu (CH3)2CHCH(OH)CH3 trong điều kiện thích hợp thu được anken. Sản phẩm chính là A. 2-metylbuten-1. B. 2-metylbuten-2. C. 3-metylbuten-1. D. penten-2. Câu 19. Hai hiđrocacbon X, Y có cùng công thức phân tử C4H8. Khi phản ứng vơi brom, từ X thu được một dẫn xuất 1,2-đibrom-2-metylpropan; từ Y thu được hai dẫn xuất 1,3-đibrombutan và 1,3-đibrom-2-metylpropan. Tên gọi của X và Y tương ứng là A. 2-metylpropen và buten-2. B. 2-metylpropen và metylxiclopropan. C. buten-1 và buten-2. D. buten-2 và xiclobutan. Câu 20. Cho hỗn hợp gồm không khí dư và hơi của 24 gam metanol đi qua chất xúc tác Cu nung nóng, sản phẩm thu được có thể tạo 40 ml fomalin 36% có d = 1,1 g/ml. Hiệu suất của quá trình trên là A. 80,4%. B. 70,4%. C. 65,5%. D. 76,6%. Câu 21. Cho các chất Đimetylamin (1), Metylamin (2), Amoniac (3), Anilin (4), p-metylanilin (5), p-nitroanilin (6). Tính bazơ tăng dần theo thứ tự là A. (1), (2), (3), (4), (5), (6) B. (3), (2), (1), (4), (5), (6) C. (6), (4), (5), (3), (2), (1) D. (6), (5), (4), (3), (2), (1) Câu 22. Thuốc thử duy nhất có thể dùng để nhận biết 3 chất lỏng đựng trong 3 lọ mất nhãn: Phenol; Rượu Benzylic; Stiren là: A. Na. B. Dung dịch NaOH. C. Quỳ tím. D. Dung dịch Br2. Câu 23. Để chứng tỏ muối C6H5NH3Cl có trong một bình đựng, ta cần dùng các hoá chất là A. dung dịch Brôm. B. dung dịch NaOH và Br2. C. dung dịch AgNO3, NaOH, Br2. D. dung dịch AgNO3, Br2 Câu 24. Sắp xếp theo thứ tự tăng dần nhiệt độ sôi của các chất sau: CH 3OH(1), C2H5OH(2), CH3COOH(3), CH3COOC2H5(4), HCHO(5). A. 5, 4, 1, 2, 3. B. 1, 2, 3, 4, 5. C. 5, 4, 3, 2, 1. D. 3, 2, 1, 5, 4. Câu 25. Trong số các đồng phân là dẫn xuất của benzen có CTPT C8H10O, số đồng phân (X) thoả mãn điều kiện sau: (X) không phản ứng vơi NaOH và (X) − H→ (Y) txt → polime. X là 2O  , p,
  3. A. 1. B. 3. C. 4. D. 2. Câu 26. Một dung dịch chứa 1,22g chất hữu cơ X là đồng đẳng của phenol. Cho dung dịch trên tác dụng vơi nươc brom (dư) thu được 3,59g hợp chất Y chứa 3 nguyên tử brom trong phân tử. Biết p/ư xảy ra vơi hiệu suất 100%. Công thức phân tử của X là A. C7H8O. B. C8H10O. C. C9H12O. D. C10H14O. Câu 27. Bốn este có công thưc phân tử: C3H4O2, C3H6O2, C4H6O2, C4H8O2. Công thức phân tử ứng vơi 2 este khi bị thuỷ phân cho ra hai chất hữu cơ đều có khả năng tham gia phản ứng tráng gương: A. C3H4O2 và C4H8O2. B. C3H4O2 và C4H6O2. C. C3H4O2 và C3H6O2. D. C4H6O2 và C4H8O2. Câu 28. Chia hỗn hợp X gồm hai axit đơn chức, kế tiếp nhau trong dãy đồng đẵng ra hai phần bằng nhau. Phần I phản ứng vừa đủ vơi 500 ml dung dịch NaOH 1M. Phần II phản ứng vơi lượng dư dung dịch Ag 2O/NH3 tạo ra 43,2 gam Ag. Công thức cấu tạo và khối lượng của hai axit trong X là A. 9,2 gam HCOOH và 18 gam CH3COOH. B. 18 gam CH3COOH và 14,8 gam CH3CH2COOH. C. 18,4 gam HCOOH và 36 gam CH3COOH. D. 36 gam CH3COOH và 29,6 gam CH3CH2COOH. Câu 29. Một chất béo có công thức: CH2(OCOC17H33)-CH(OCOC15H31)-CH2(OCOC17H29). Số mol H2 cần để hiđro hoá hoàn toàn 1 mol chất béo là A. 1. B. 3. C. 4. D. 5. Câu 30. Polivinyl axetat là polime được điều chế từ sản phẩm trùng hợp monome nào sau đây: A. CH2=CH-COOCH3. B. CH2=CH-COOH. C. CH2=CH-COOC2H5. D. CH2=CH-OCOCH3. Câu 31. Trong số các polime sau: sợi bông (1); tơ tằm (2); len (3); tơ visco (4); tơ axetat (5); Nilon-6,6 (6); tơ enang (7). Loại tơ có nguồn gốc từ xenlulozơ là A. (1), (2), (3). B. (2), (3), (4) C. (1), (4), (5). D. (4), (6), (7). o Câu 32. Thuỷ phân một hợp chất gluxit Y theo phương trình hoá học: Y + H 2O  2X. X và Y đều có phản ứng axit,t → tráng gương trong điều kiện thường. Y là A. tinh bột. B. mantozơ. C. saccazozơ. D. xenlulozơ. Câu 33. Chỉ được dùng một thuốc thử để phân biệt ba chất lỏng: Benzen, rượu etylic, anilin thì thuốc thử đó là A. dung dịch HCl. B. phenolphtalein. C. quì tím. D. dung dịch NaOH. Câu 34. Trong các kim loại Mg, Al, Fe, Zn, K, Ba, Ag. Kim loại nhẹ gồm A. Mg, Al, Fe, Zn. B. Mg, Ag, Al, Fe. C. Mg, Al, K, Ba. D. Mg, Ba, Zn, Al. Câu 35. Để loại bỏ tạp chất kẽm, chì, đồng có lẫn trong bạc (ở dạng bột) mà không làm thay đổi khối lượng bạc người ta dùng một lượng dư dung dịch A. AgNO3. B. Pb(NO3)2. C. Cu(NO3)2. D. Fe(NO3)3. Câu 36. Hoà tan 36 gam hỗn hợp đồng và oxit sắt từ (ở dạng bột) theo tỉ lệ mol 2 : 1 bằng dung dịch HCl dư. Phản ứng xong thu được dung dịch X và chất rắn Y. Khối lượng chất rắn Y bằng A. 12,8 gam. B. 6,4 gam. C. 23,2 gam. D. 16,0 gam. Câu 37. Điện phân nóng chảy a gam muối halogenua của kim loại M, thu được 0,96 gam M ở Catot và 0,896 lít khí (đktc) ở Anot. Mặt khác dung dịch chứa a gam muối halogenua nói trên tác dụng vơi AgNO 3 dư thu được 11,48 gam kết tủa. Công thức muối halogenua là A. CaF2. B. MgCl2. C. CaBr2. D. MgBr2. Câu 38. Trộn 200 ml dung dịch gồm HCl 0,1M và H 2SO4 0,05M vơi 300 ml dung dịch Ba(OH)2 nồng độ x M thu được m gam kết tủa và 500 ml dung dịch có pH = 13. Giá trị của x và m lần lượt là A. x = 0,015; m = 2,33. B. x = 0,150; m = 2,33. C. x = 0,200; m = 3,23. D. x = 0,020; m = 3,23.
  4. Câu 39. Cho bột nhôm vào dung dịch chứa AgNO 3 và Cu(NO3)2 lắc đều một thời gian thu được chất rắn X 1 và dung dịch X2 . Cho X1 tác dụng vơi dung dịch NaOH dư thu được khí H 2 và còn lại hỗn hợp hai kim loại. Cho X 2 tác dụng vơi dung dịch NaOH dư, được kết tủa X3 là hiđroxit của một kim loại. Các chất có trong X1, X2, X3 gồm A. X1 : Ag, Al ; X2 : Al(NO3)3 ; X3 : Al(OH)3. B. X1 : Ag, Cu ; X2 :Al(NO3)3, Cu(NO3)2 ; X3 : Al(OH)3. C. X1 : Ag, Cu, Al. ; X2 :Al(NO3)3, Cu(NO3)2 ; X3 : Cu(OH)2. D. X1 : Ag, Cu, Al ; X2 :Al(NO3)3 X3 : Cu(OH)2. Câu 40. Thực hiện phản ứng nhiệt nhôm 26,8 gam hỗn hợp bột nhôm và sắt (III) oxit được hỗn hợp G. Hoà tan G trong dung dịch NaOH dư, thoát ra 6,72 lít khí H2 (các phản ứng xảy ra hoàn toàn, thể tích khí đo ở đktc). Khối lượng nhôm có trong hỗn hợp ban đầu bằng A. 6,8 gam. B. 5,4 gam. C. 11,2 gam D. 10,8 gam. Câu 41. Có 5 mẫu kim loại Ba, Mg, Ag, Al, Fe. Người ta có thể nhận biết được từng kim loại mà chỉ cần dùng một dung dịch chứa một hoá chất làm thuốc thử là A. HCl. B. HNO3. C. NaOH. D. Fe2(SO4)3. Câu 42. Cho 4 dung dịch, trong mỗi dung dịch chứa một cation sau: Cu , Fe , Ag , Pb2+. Trong các kim loại Mg, Al, Fe, 2+ 3+ + Cu, Ag những kim loại phản ứng được vơi cả 4 dung dịch trên là A. Mg, Al, Fe. B. Mg, Al. C. Mg, Al, Cu. D. Mg, Al, Ag. Câu 43. Hỗn hợp X gồm FeO, Fe2O3, Fe3O4 nặng 6,96 g và số mol FeO bằng số mol Fe2O3. Cho hỗn hợp X tan hết trong dung dịch HNO3 loãng, thu được V lít khí NO (đktc) duy nhất. Giá trị của V là A. 0,224/3 lít. B. 0,224 lít. C. 2,24 lít. D. 2,24/3 lít. Câu 44. Nhiệt phân hoàn toàn hỗn hợp NH4NO3, Cu(NO3)2, AgNO3, Fe(NO3)2 thì chất rắn thu được sau phản ứng gồm A. CuO, Fe2O3, Ag2O. B. CuO, Fe2O3, Ag. C. CuO, FeO, Ag. D. NH4NO2, Cu, Ag, FeO. Câu 45. Nung 9,4 gam muối nitrat của kim loại M có hoá trị không đổi đến phản ứng hoàn toàn, được 4 gam một oxit của kim loại M. Công thức muối nitrat là A. Mg(NO3)2 B. Zn(NO3)2. C. Cu(NO3)2. D. Pb(NO3)2. Câu 46. Nung nóng AgNO3 được chất rắn X và khí Y. Dẫn khí Y vào cốc nươc được dung dịch Z. Cho toàn bộ X vào Z thấy X tan một phần và thoát ra khí NO duy nhất. Giả thiết các phản ứng xảy ra hoàn toàn. Phần trăm khối lượng của X không tan trong Z là A. 20%. B. 25%. C. 30%. D. 40%. Câu 47. Cho 0,81 gam Al và 2,8 gam Fe tác dụng vơi 200 ml dung dịch X chứa AgNO3 và Cu(NO3)2. Sau khi phản ứng xảy ra hoàn toàn thu được dung dịch Y và 8,12 gam hỗn hợp 3 kim loại. Cho 8,12 gam hỗn hợp 3 kim loại này tác dụng vơi dung dịch HCl dư, kết thúc phản ứng thấy thoát ra 0,672 lít H2 (đktc). Nồng độ mol của AgNO3 và Cu(NO3)2 lần lượt là A. 0,15M và 0,25M. B. 0,10M và 0,20M. C. 0,25M và 0,15M. D. 0,25M và 0,25M. Câu 48. Cho 5,7 gam hỗn hợp bột P gồm Mg, Al, Zn, Cu tác dụng hoàn toàn vơi oxi dư thu được hỗn hợp rắn Q có khối lượng là 7,86 gam. Thể tích tối thiểu dung dịch HCl 1M cần dùng để hoà tan hoàn toàn Q là A. 180 ml. B. 270 ml. C. 300 ml. D. 360 ml. Câu 49. Cho một lượng bột CaCO3 tác dụng hoàn toàn vơi dung dịch HCl 32,85%. Sau phản ứng thu được dung dịch X trong đó nồng độ HCl còn lại là 24,20%. Thêm vào X một lượng bột MgCO 3 khuấy đều cho phản ứng xảy ra hoàn toàn thu được dung dịch Y trong đó nồng độ HCl còn là 21,10%. Nồng độ phần trăm các muối CaCl 2 và MgCl2 trong dung dịch Y tương ứng là A. 10,35% và 3,54%. B. 12,35% và 8,54%. C. 12,35% và 3,54%. D. 8,54% và 10,35%. Câu 50. Điên phân dung dịch chứa a mol CuSO4, b mol NaCl (vơi điện cực trơ, màng ngăn xốp). Dung dịch thu được sau ̣ phản ứng hoà tan được Al2O3. Quan hệ giữa a và b là
  5. A. a < 2b hoặc a > 2b. B. a < b. C. b > 2a hoặc b < 2a. D. b ≥ 2a. 1 2 3 4 5 6 7 8 9 1 1 1 1 1 1 1 1 1 1 20 0 1 2 3 4 5 6 7 8 9 C D C B D C A B C C D D B B B D A B B B 2 2 2 2 2 2 2 2 2 3 3 3 3 3 3 3 3 3 3 40 1 2 3 4 5 6 7 8 9 0 1 2 3 4 5 6 7 8 9 C D C A D B B C C D C B A C D B B B C D 4 4 4 4 4 4 4 4 4 5 1 2 3 4 5 6 7 8 9 0 D A B B C B A B A C

CÓ THỂ BẠN MUỐN DOWNLOAD

Đồng bộ tài khoản