Phương pháp nhận biết chất hữu cơ

Chia sẻ: Dao Huong | Ngày: | Loại File: PDF | Số trang:6

4
2.050
lượt xem
425
download

Phương pháp nhận biết chất hữu cơ

Mô tả tài liệu
  Download Vui lòng tải xuống để xem tài liệu đầy đủ

Thuốc thử: -Hiện tương:Sản phẩm sau PƯ làm hồng giấy quỳ ẩm. -Phương trình: HCl làm hồng giấy quỳ ẩm 2.Anken: -Thuốc thử1:Nước Brom(Maù da cam) -Hiện tương:làm Mất màu nước Brom. -Phương trình: -Thuốc thử2: dung dịch thuốc tím -Hiện tương:làm mất màu thuốc tím. -Phương trình: Với dung dịch đậm đặc ở nhiệt độ cao nối đôi C=C dễ bị gáy cho ceton, axit hay tuỳ theo CTCT của anken. -Thuốc thử:3: Oxi: -Hiện tương:Chất sau PƯ tham gia PƯ tráng gương. -Phương trình: 3.AnKađien( n lớn hơn hoặc bằng 3. -Thuốc thử:Nước Brom -Hiện tương:Làm mất màu nước...

Chủ đề:
Lưu

Nội dung Text: Phương pháp nhận biết chất hữu cơ

  1. Phương pháp nhận biết chất hữu cơ 1.Ankan: -Thuốc thử: -Hiện tương:Sản phẩm sau PƯ làm hồng giấy quỳ ẩm. -Phương trình: HCl làm hồng giấy quỳ ẩm 2.Anken: -Thuốc thử1:Nước Brom(Maù da cam) -Hiện tương:làm Mất màu nước Brom. -Phương trình: -Thuốc thử2: dung dịch thuốc tím -Hiện tương:làm mất màu thuốc tím. -Phương trình: Với dung dịch đậm đặc ở nhiệt độ cao nối đôi C=C dễ bị gáy cho ceton, axit hay tuỳ theo CTCT của anken. -Thuốc thử:3: Oxi: -Hiện tương:Chất sau PƯ tham gia PƯ tráng gương. -Phương trình: 3.AnKađien( n lớn hơn hoặc bằng 3. -Thuốc thử:Nước Brom -Hiện tương:Làm mất màu nước Brom. -Phương trình: 4.Ankin( ) -Thuốc thử1:Nước Brom -Hiện tương:làm mất màu nước Brom -Phương trình: -Thuốc thử 2: dung dịch thuốc thuốc tím -Hiện tương:Làm mất màu dung dịch thuốc tím -Phương trình: -Thuốc thử 3: dung dịch trong :
  2. -Hiện tương:Cho kết tủa màu vàng nhạt -Phương trình: -Thuốc thử 4: dung dịch CuCl trong -Hiện tương:cho kết tủa màu đỏ -Phương trình: 6.Toluen -Thuốc thử: dung dịch đun nóng -Hiện tương:Mất màu dung dịch thuốc tím -Phương trình: hoặc viết là : 7.Stiren -Thuốc thử: dung dịch thuốc tím ở nhiệt độ thường -Hiện tương:mất màu dung dịch thuốc tím -Phương trình: B> Những PƯ đặc trưng của các dẫn xuất hiđrocacbon 1.Ancol -Thuốc thử:kim loại kiềm(K,Na) -Hiện tương:có khí bay ra -Phương trình: 2.Ancol bậc I -Thuốc thử:CuO đen to -Hiện tương:Cu(đỏ),sản phầm sau PƯ tham gia PƯ tráng gương cho Ag -Phương trình: Lưu ý: 3.Ancol bậc II. -Thuốc thử:CuO đen, -Hiện tươngCuđỏ),sản phầm sau PƯ ko tham gia PƯ tráng gương -Phương trình: ko tham gia pư tráng gương 4.Ancol đa chức( etylglicol,glixerin) -Thuốc thử: xanh lam
  3. -Hiện tương: dung dịch trong xanh màu lam. Phương trình: 5.Anilin -Thuốc thử: nước Brom -Hiện tương:Tạo kết tủa trắng. -Phương trình: 6.Anđehit RCHO -Thuốc thử: dung dịch trong -Hiện tương:Tạo kết tủa Ag màu trắng -Phương trình: hoặc viết -Thuốc thử 2: (xanh lam) trong NaOH -Hiện tương:Tạo kết tủa màu đỏ -Phương trình: andehit cũng có phản ứng làm mất màu brôm ( PT giống như TH của Glucozo ) HOCH2-(CHOH)4-CHO + Br2 + H2O => HOCH2(CHOH)4COOH + 2HBr Andehit no hay ko no đều làm mất màu nước Br2 vì đây là pư oxi hóa khử. Muốn phân biệt andehit no và ko no dùng dd Br2 trong CCl4, môi trường CCl4 thì Br2 ko thể hiện tính oxi hóa nên chỉ pư với andehit ko no 7. Axit cacboxylic -Thuốc thử:Giấy quỳ tím -Hiện tương:giấy quỳ hoá đỏ -Thuốc thử 2: hoặc -Hiện tương:có khí bay lên -Phương trình: 8.Aminoaxit [tex](H_2N)_nR(COOH)_m -Thuốc thử:giấy quỳ tím
  4. -Hiện tương:Biến dổi màu giấy quỳ tuỳ theo số nhóm -Phương trình:Nếu n=m:giấy quỳ ko đổi màu Nếu n>m:giấy quỳ hoá xanh Nếu n -Thuốc thử 2: hoặc dung dịch -Hiện tương:Có khí bay lên -Phương trình: C>Những PƯ đặc trưng của cacbohiđrat-amin 1. -Thuốc thử:giấy quỳ tím -Hiện tương:làm xanh giấy quỳ ẩm 2.Glucozơ - -Thuốc thử1:với -Hiện tương: dung dịch trong xanh màu lam * tác dụng với Cu(OH)2 đun nóng tạo kết tủa đỏ gạch CH2OH[CHOH]4CHO + 2Cu(OH)2 + NaOH ---> CH2OH[CHOH]4COONa + Cu2O + 3 -Thuốc thử 2: dung dịch trong -Hiện tương:tạo kết tủa Ag màu trắng. -Phương trình: * Glucozo Chứa nhóm anđehit nên làm mất màu dung dịch Br2 CH2(OH)-CH(OH)-CH(OH)-CH(OH)-CH(OH)-CHO + Br2 + H2O = CH2(OH)- CH(OH)-CH(OH)-CH(OH)-CH(OH)-COOH + HBr * có thể dùng muối Fe3+ cho vào dung dịch sau phản ứng vì glucozơ có phản ứng tạo axitgluconic ,axit này tạo phức màu vàng với Fe3+(Phức chelat! có màu rất đặc trưng ) Axit gluconic tạo phức chelat với Fe3+ có màu vàng hơi xanh 3CH2(OH)-CH(OH)-CH(OH)-CH(OH)-CH(OH)-COOH + Fe3+ = (CH2(OH)- CH(OH)-CH(OH)-CH(OH)-CH(OH)-COO)3Fe ( màu vàng ) 3.Saccarozơ
  5. -Thuốc thử:Thuỷ phân thì sản phẩm tham gia phản ứng tráng gương -Phương trình: ** Nhận biết bằng cách thấy vôi sữa bị vẩn đục (canxi saccarat) và quan trọng ở đây Phản ứng được dùng để tinh chế đường khi sục CO2 vào thì sẽ giải phóng ra lại saccarozơ. (canxi saccarat) + thêm nữa là saccarozo cũng có phản ứng với Cu(OH)2 tạo dung dịch màu xanh lam do trong phân tử saccarozo đc cấu tạo bởi 1 glucozo và 1 fructozo 4.Mantozo -Thuốc thử1: với -Hiện tương: dung dịch trong màu xanh lam * tác dụng với Cu(OH)2 đun nóng tạo kết tủa đỏ gạch và có phản ứng tráng Gương do Mantozo đc cấu tạo bới 2 Glucozo. -Thuốc thử 2: dung dịch trong -Hiện tương:tạo kết tủa Ag màu trắng -Thuốc thử 3:sản phẩm thuỷ phân(H^+) tham gia phản ứng tráng gương -Phương trình: 5.Tinh bột -Thuốc thử1: sản phẩm thuỷ phân tham gia phản ứng tráng gương -Phương trình: -Thuốc thử 2: dung dịch iot -Hiện tương:cho màu xanh lam đặc trưng * phân biệt MANTOZO và GLUCOZO Mặc dù matozơ là đi saccarit nhưng chỉ có một liên kết C-O ở gốc GLUCÔZƠ thứ 2 mở vòng để trở về dạng anđehit được nên GIỐNG NHƯ GLUCOZƠ ,MANTOZƠ tráng gương theo tỉ lệ 1:2(1MOL GLUCOZƠ HAY MATOZƠ cho 2mol Ag ). Để phân biệt matozơ và glucozơ ta có thể làm như sau : Lấy cùng một khối lượng như nhau 2 chất đó cho tráng gương chất nào cho nhiều Ag hơn là glucozơ ! (Vì nGlucozơ=m/180 còn nMatozơ=m/342 mà!) nhưng lưu ý là không thực hiện phản ứng trong môi trường axit tránh sự thuỷ phân Mantozơ! * phân biệt GLUCOZO và FRUCTOZO
  6. nhiều người nói rằng dùng dung dịch Br2 vì fructozo không phản ứng với nước Br2. nhưng có cách khác thay thế đó là dùng PƯ đặc trung khi glucozo chuyển thành Glutamic ròi cho tác dụng với Fe+ như đã nói ở trên.  
Đồng bộ tài khoản