intTypePromotion=2
Array
(
    [0] => Array
        (
            [banner_id] => 141
            [banner_name] => KM2 - Tặng đến 100%
            [banner_picture] => 986_1568345559.jpg
            [banner_picture2] => 823_1568345559.jpg
            [banner_picture3] => 278_1568345559.jpg
            [banner_picture4] => 449_1568779935.jpg
            [banner_picture5] => 
            [banner_type] => 7
            [banner_link] => https://tailieu.vn/nang-cap-tai-khoan-vip.html
            [banner_status] => 1
            [banner_priority] => 0
            [banner_lastmodify] => 2019-09-18 11:12:45
            [banner_startdate] => 2019-09-13 00:00:00
            [banner_enddate] => 2019-09-13 23:59:59
            [banner_isauto_active] => 0
            [banner_timeautoactive] => 
            [user_username] => minhduy
        )

)

40 đề thi thử chọn lọc môn Hoá học tập 2

Chia sẻ: Tài Liệu Y Học | Ngày: | Loại File: PDF | Số trang:267

0
182
lượt xem
65
download

40 đề thi thử chọn lọc môn Hoá học tập 2

Mô tả tài liệu
  Download Vui lòng tải xuống để xem tài liệu đầy đủ

40 đề thi thử chọn lọc môn Hoá học tập 2 tập hợp các đề thi thử Đại học môn Hóa kèm đáp án. Đây là tài liệu bổ ích giúp các em ôn tập và luyện thi Đại học môn Hóa đạt kết quả cao.

Chủ đề:
Lưu

Nội dung Text: 40 đề thi thử chọn lọc môn Hoá học tập 2

  1. GSTT GROUP 40 ĐỀ THI THỬ ĐẠI HỌC CHỌN LỌC Môn HÓA HỌC Tập 2 2014 TÀI TRỢ BỞI LOVEBOOK.VN
  2. Anh chị GSTT chúc em trở thành một tân sinh viên của Đại Học em hằng mơ ước! Hẹn gặp em ở giảng đường Đại Học! TUYỂN TẬP 40 ĐỀ THI THỬ ĐẠI HỌC MÔN HÓA PHIÊN BẢN 2014 1|G S T T G R O U P
  3. Chúng tôi xin gửi lời cảm ơn chân thành tới nhà sách LOVEBOOK.VN đã giúp chúng tôi hoàn thiện cuốn tài liệu này.  Để tham khảo thêm đề và lời giải chi tiết mời các em đọc bộ sách “Tuyển tập 90 đề thi thử kèm lời giải chi tiết và bình luận tập 1, 2, 3” của LOVEBOOK.VN.  Để nắm chắc toàn bộ 90 đề trong bộ sách khi chỉ còn 1 tháng ôn thi nữa, mời các em tham gia lớp học tháng 6 của VEDU.EDU.VN. Hầu hết các tác giả của bộ sách đều tham gia giảng dạy tại lớp học đặc biệt này. Thay mặt nhóm GSTT Trưởng nhóm Lương Văn Thùy 2|L O V E B O O K . V N
  4. Giới Thiệu Tổng Quát Về GSTT Group Cuốn sách này được viết bởi toàn bộ các bạn đến từ GSTT GROUP. Vì vậy, chúng tôi xin được gửi tới các em học sinh và các độc giả đôi nét về tập thể tác giả này. Bài viết được trích trong profile của GSTT GROUP. I. Giới thiệu chung Sống trong đời sống cần có một tấm lòng Để làm gì em biết không ? Để gió cuốn đi… Lấy cảm hứng từ ca từ trong bài hát “Để gió cuốn đi” của cố nhạc sĩ Trịnh Công Sơn và câu hỏi là “làm thế nào để cống hiến cho xã hội nhiều nhất khi mình đang còn là sinh viên?”, chúng tôi đã thành lập nên GSTT Group. Được thành lập vào ngày 6/5/2011, GSTT Group đã trải qua hơn một năm hình thành và phát triển. GSTT Group là nơi hội tụ các sinh viên ưu tú đến từ các trường đại học. Các thành viên của GSTT Group đều có những thành tích đáng nể trong học tập. Các thành viên của GSTT Group đều là những thủ khoa, á khoa, đạt giải Olympic Quốc gia, quốc tế và những bạn sinh viên giỏi ở các trường. Trong những ngày đầu thành lập GSTT Group chủ yếu hoạt động ở mảng online bằng việc thực hiện những bài giảng trực tuyến và hỗ trợ các em học sinh trên diễn đàn. Kể từ đầu năm 2012, GSTT Group đã mở rộng hoạt động của mình sang các lĩnh vực khác như tổ chức giảng dạy tình nguyện ở các trung tâm bảo trợ xã hội, tổ chức thi thử đại học cho học sinh 12, tổ chức chương trình giao lưu với học sinh lớp 12 tại các trường cấp 3,… Không chỉ giàu lòng nhiệt huyết với các thế hệ đàn em đi sau, GSTT Group còn rất chú trọng tới việc học tập của các thành viên. Kể từ năm học 2012—2013, GSTT Group thành lập các câu lạc bộ học tập dành cho các thành viên. Một số câu lạc bộ đã đi vào hoạt động như : Câu lạc bộ tiếng Anh, câu lạc bộ Luật, Câu lạc bộ kinh tế đối ngoại, Câu lạc bộ Y. Ngoài ra, để các thành viên GSTT Group có điều kiện trải nghiệm, làm quen với công việc khi ra trường, GSTT Group tổ chức chương trình JOB TALK. Những chia sẻ về công việc và cuộc sống của các vị khách mời sẽ giúp các thành viên trưởng thành hơn khi ra trường. Với phương châm “cho đi là nhận về mãi mãi ”, chúng tôi nguyện đem hết sức mình để mang những kiến thức của mình truyền đạt lại cho các thế hệ đàn em Sứ mệnh: Kết nối yêu thương Tầm nhìn: Trong 1 năm tới hình ảnh GSTT Group sẽ đến với tất cả các em học sinh trên cả nước, đặc biệt là những em có mảnh đời bất hạnh. GSTT Group sẽ là một đại gia đình với nhiều thế hệ học sinh, sinh viên, ăn sâu trong tiềm thức học sinh, sinh viên Việt Nam. Slogan: 1. Light the way 2. Sharing the value II. Danh mục hoạt động: Hướng tới học sinh 1. Hoạt động online a. Video bài giảng trực tuyến các cấp và đại học, trọng tâm ôn thi đại học b. Hỗ trợ các học sinh học tập trên diễn đàn học tập 2. Hoạt động offline a. Giảng dạy tình nguyện thường xuyên tại các trung tâm bảo trợ xã hội và ở vùng sâu vùng xa b. Giao lưu chia sẻ kinh nghiệm thi cử tới các trường cấp 3 3|G S T T G R O U P
  5. Hướng tới sinh viên 1. Hoạt động online a. Bài giảng trực tuyến các môn học b. Hỗ trợ học tập trên diễn đàn học tập 2. Hoạt động offline a. Các câu lạc bộ học tập: câu lạc bộ tiếng Anh, Câu lạc bộ Y, câu lạc bộ Kinh tế đối ngoại, câu lạc bộ tài chính ngân hàng, câu lạc bộ Luật,… b. Chương trình JOB TALK. Chương trình giao lưu, trò chuyện với người từ các ngành nghề lĩnh vực khác nhau. c. Giảng dạy cho sinh viên ngay tại giảng đường các trường đại học III. Một số thành tựu nổi bật đạt được: 1. Thực hiện 230 bài giảng trực tuyến 2. Hỗ trợ học tập trên diễn đàn GSTT.VN và trên fan page facebook cho trên 40.000 học sinh trên cả nước từ năm 2011 – 2013. 3. Hỗ trợ ôn thi cuối kỳ cho hơn 200 sinh viên ĐH Bách Khoa HN 4. Giúp đỡ 169 em ở làng trẻ SOS – Hà Nội học tập. 5. Tổ chức 2 chương trình giao lưu cùng thủ khoa đại học ở trường THPT chuyên Lương Văn Tụy – Ninh Bình và THPT Nguyễn Siêu – Hưng Yên 6. Tổ chức thi thử đại học cho 1000 em học sinh ở khu vực Hà Nội. GSTT GROUP Ngôi nhà chung của học sinh, sinh viên Việt Nam Website: http://www.gstt.vn Facebook: http://www.faceook.com/SHARINGTHEVALUE Mail: gstt.vn@gmail.com Youtube: http://www.youtube.com/luongthuyftu 4|L O V E B O O K . V N
  6. Đề số 1 I. PHẦN CHUNG CHO TẤT CẢ THÍ SINH (40 câu, từ câu 1 đến câu 40) Câu 1: Một hỗn hợp X có khối lượng m gam gồm Ba và Al. Cho m gam X tác dụng với nước dư, thu được 8,96 lít khí H2. Cho m gam X tác dụng với dung dịch Ba(OH)2 dư thu được 22,4 lít khí H2 (các phản ứng đều xảy ra hoàn toàn, các thể tích khí đo ở điều kiện tiêu chuẩn). m có giá trị là A. 16,8 gam. B. 27,2 gam. C. 24,6 gam. D. 29,9 gam. Câu 2: Có 3 dung dịch hỗn hợp là dung dịch: X (NaHCO3 và Na2CO3); Y (NaHCO3 và Na2SO4); Z (Na2CO3 và Na2SO4). Chỉ dùng thêm 2 dung dịch nào dưới đây để nhận biết được 3 dung dịch trên? A. HNO3 và Ba(NO3)2. B. HCl và NaCl. C. NaOH và NaCl. D. NH3 và NH4Cl. Câu 3: Oxi hoá nhẹ 3,2 gam ancol CH3OH thu được hỗn hợp sản phẩm gồm anđehit, axit, ancol dư và nước trong đó số mol anđehit bằng 3 lần số mol axit. Cho toàn bộ sản phẩm phản ứng với lượng dư dung dịch AgNO3/NH3 thu được 15,12 gam Ag. Hiệu suất phản ứng oxi hoá là A. 70%. B. 65%. C. 40%. D. 56%. Câu 4: Cho sơ đồ phản ứng sau : Tên của Y là A. Vinylbenzoat. B. Metylacrylat. C. Benzylacrylat. D. Phenylacrylat. Câu 5: Nung nó ng tưng cạ p chá t trong bình kín: (1) Fe + S(r), (2) Fe2O3 + CO(k), (3) Au + O2(k), (4) Cu + ̀ Zn(NO3)2(r), (5) Cu + KNO3(r), (6) Al + NaCl (r). Cá c trương hơp xả y ra phả n ưng oxi hoá kim loạ i là ̀ ̣ ́ A. (1), (4), (5). B. (1), (4). C. (1), (3), (6). D. (1), (5). Câu 6: Cho các phản ứng hoá học sau đây: (1) Al4C3 + 12H2O  4Al(OH)3 + 3CH4 (2) 2Na + 2H2O  2NaOH + H2 +OH− Hg2+ (3) CH3Cl + H2O→ CH3OH + HCl (4) C2H2 + H2O → CH3CHO (5) Na2O2 + H2O  NaOH + H2O2 (6) 2F2 + 2H2O  4HF + O2 Số phản ứng hoá học trong đó H2O đóng vai trò chất oxi hoá hoặc chất khử là A. 1. B. 3. C. 2. D. 4. Câu 7: Dãy gồm các chất đều tác dụng với dung dịch AgNO3/NH3 là A. axit fomic, vinylaxetilen, propin. B. anđehit axetic, but-1-in, etilen. C. anđehit axetic, axetilen, but-2-in. D. anđehit fomic, axetilen, etilen. Câu 8: Sục V lít CO2 (ở đktc) vào 1 lít dung dịch hỗn hợp NaOH 0,02M và Ba(OH)2 0,02M đến phản ứng hoàn toàn thu được 1,97 gam kết tủa và dung dịch X. Cho dung dịch NaOH vào dung dịch X lại thu được kết tủa. Giá trị của V là A. 1,12 lít. B. 0, 224 lít hoặc 1,12 lít C. 0,448 lít. D. 0,896 lít hoặc 0,448 lít. Câu 9: Hỗn hợp khí A (ở nhiệt độ thường) gồm hiđrocacbon X mạch hở và oxi dư có tỷ lệ thể tích 4:21 cho vào một bình kín dung tích không đổi thấy áp suất là p atm. Bật tia lửa điện, đốt cháy hoàn toàn hỗn hợp, sau phản ứng, loại bỏ hơi nước rồi đưa về nhiệt độ ban đầu được hỗn hợp B có áp suất 0,52p atm. Số chất X thỏa mãn dữ kiện đầu bài là A. 5. B. 1. C. 4. D. 6. Câu 10: Đốt cháy hoàn toàn 1,18 gam một amin đơn chức Y bằng một lượng không khí vừa đủ. Dẫn toàn bộ khí sau phản ứng vào bình đựng dung dịch Ca(OH)2 dư thu được 6 gam kết tủa và 9,632 lít khí (ở đktc) duy nhất thoát ra khỏi bình. Công thức phân tử của Y là A. C2H7N. B. C4H11N. C. C3H9N. D. CH5N. Câu 11: Dung dịch X chứa 0,375 mol K2CO3 và 0,3 mol KHCO3. Thêm từ từ dung dịch chứa 0,525 mol HCl vào dung dịch X được dung dịch Y và V lít CO2 (đktc). Thêm dung dịch nước vôi trong dư vào Y thấy tạo thành m gam kết tủa. Giá trị của V và m là A. 6,72 lít; 26,25 gam. B. 3,36 lít; 52,5 gam. C. 3,36 lít; 17,5 gam. D. 8,4 lít; 52,5 gam. 5|G S T T G R O U P
  7. Câu 12: Cho 11,6 gam muối FeCO3 tác dụng vừa đủ với dung dịch HNO3, được hỗn hợp khí CO2, NO và dung dịch X. Khi thêm dung dịch HCl (dư) vào dung dịch X được dung dịch Y. Khối lượng bột đồng kim loại tối đa có thể hòa tan trong dung dịch Y (biết NO là sản phẩm khử duy nhất) là A. 14,4 gam. B. 32 gam. C. 16 gam. D. 7,2 gam. Câu 13: Số proton, nơtron, electron có trong một ion Cr 3+ (cho 52 Cr) lần lượt là 24 A. 24, 28, 21. B. 24, 30, 21. C. 24, 28, 24. D. 24, 28, 27. Câu 14: Cho các dung dịch: Na2CO3, NaHCO3, AlCl3, CaCl2, Ca(HCO3)2, Mg(HCO3)2, K2SO3, K2SO4 lần lượt tác dụng với dung dịch Ba(OH)2. Số trường hợp xảy ra phản ứng là A. 8. B. 5. C. 7. D. 6. Câu 15: Muốn tổng hợp 60 kg thủy tinh hữu cơ (thủy tinh plexiglat) thì khối lượng axit và ancol phải dùng lần lượt là (biết hiệu suất quá trình este hóa và quá trình trùng hợp lần lượt là 60% và 80%) A. 107,5kg và 40kg. B. 85kg và 40kg. C. 32,5kg và 20kg. D. 85,5 kg và 41 kg. Câu 16: Hòa tan 2,29 gam hỗn hợp Ba và Na vào nước thu được dung dịch X và 672 ml khí (đktc). Nhỏ từ từ dung dịch FeCl3 vào dung dịch X cho đến dư, lọc kết tủa, rửa sạch, sấy khô và nung đến khối lượng không đổi thu được m gam chất rắn. Giá trị của m là A. 6,4. B. 4,8. C. 1,6. D. 3,2. Câu 17: X và Y là 2 hợp chất chỉ có chức ancol, trong đó khối lượng mol của X nhỏ hơn của Y. Khi đốt cháy hoàn toàn mỗi chất X, Y đều tạo ra số mol CO2 ít hơn số mol H2O. Đốt cháy hoàn toàn hỗn hợp Z gồm những lượng bằng nhau về số mol của X và Y thu được tỷ lệ số mol CO2 và H2O tương ứng là 2:3. Số hợp chất thỏa mãn các tính chất của Y là A. 6 chất. B. 2 chất. C. 4 chất. D. 5 chất. Câu 18: Chia dung dịch Z chứa các ion: Na+, NH4+, SO42-, CO32-thành 2 phần bằng nhau. Phần 1 cho tác dụng với dung dịch Ba(OH)2 dư, đun nóng thu được 4,3 gam kết tủa X và 470,4 ml khí Y ở 13,50C và 1atm. Phần 2 cho tác dụng với dung dịch HCl dư thu được 235,2 ml khí ở 13,50C và 1atm. Tổng khối lượng muối trong Z là A. 1,19 gam. B. 9,52 gam. C. 4,76 gam. D. 2,38 gam. Câu 19: Hỗn hợp X gồm Al, Fe2O3 có khối lượng 21,67 gam. Tiến hành phản ứng nhiệt nhôm hỗn hợp X trong điều kiện không có không khí (giả thiết chỉ xảy ra phản ứng Al khử Fe2O3 thành kim loại). Hòa tan hỗn hợp chất rắn sau phản ứng bằng dung dịch NaOH dư thu được 2,016 lít H2 (đktc) và 12,4 gam chất rắn không tan. Hiệu suất của phản ứng nhiệt nhôm là A. 45%. B. 50%. C. 71,43%. D. 75%. Câu 20: Hợp chất X mạch hở có công thức phân tử C4H9NO2. Cho X phản ứng vừa đủ với dung dịch NaOH sinh ra chất khí Y và dung dịch Z. Khí Y làm xanh giấy quỳ tím ẩm. Dung dịch Z có khả năng làm mất màu nước brom và không có khả năng tráng bạc. Số đồng phân của X thỏa mãn dữ kiện đầu bài là A. 5. B. 2. C. 4. D. 3. Câu 21: Dãy gồm các chất đều phản ứng với phenol là A. nước brom, axit axetic, dung dịch NaOH. B. nước brom, anđehit axetic, dung dịch NaOH. C. nước brom, kim loại natri, dung dịch NaOH. D. dung dịch NaCl, dung dịch NaOH, kim loại natri. Câu 22: Từ 10 kg gạo nếp chứa 80% tinh bột, khi lên men sẽ thu được thể tích dung dịch ancol etylic 400 là (biết rằng hiệu suất của toàn bộ quá trình lên men đạt 80% và ancol etylic có khối lượng riêng 0,789 g/ml) A. 15, 116 lít. B. 17,994 lít. C. 11,516 lít. D. 1,842 lít. Câu 23: Trong các chất sau đây:(1) H2S; (2) SO2; (3) NaCl; (4) CaO; (5) NH3; (6) HBr; (7) H2SO4; (8) CO2; (9) K2S. Các chất chứa liên kết cộng hoá trị là A. (1), (2), (5), (6), (7), (8). B. (3), (5), (6), (7), (8), (9). C. (1), (4), (5), (7), (8), (9). D. (1), (2), (3), (4), (8). Câu 24: Cho sơ đồ: +CuO +O2 +CH3 OH trùng hợp X→ Y→ D→ D→ thủy tinh plexiglat. Công thức cấu tạo của X là A. CH3CH(CH3)CH2OH. B. CH2=C(CH3)CH2CH2OH. C. CH3CH(CH3)CH2CH2OH. D. CH2=C(CH3)CH2OH. 6|L O V E B O O K . V N
  8. Câu 25: Cho 15,2 gam chất hữu cơ X phản ứng vừa đủ với 300 ml dung dịch NaOH 1M thu được dung dịch Y. Cô cạn dung dịch Y chỉ thu được hơi nước 23,6 gam hỗn hợp muối khan Z. Đốt cháy hoàn toàn Z thu được Na2CO3, 14,56 lít CO2 (đkc) và 6,3 gam H2O (biết X có công thức phân tử trùng với công thức đơn giản nhất). Công thức phân tử của X là A. C8H10O3. B. C8H8O3. C. C8H8O. D. C9H8O2. Câu 26: Để nhận biết các chất etanol, propenol, etylenglycol, phenol có thể dùng cặp chất A. nước brom và dung dịch NaOH. B. nước brom và Cu(OH)2. C. dung dịch KMnO4 và Cu(OH)2. D. dung dịch NaOH và Cu(OH)2. Câu 27: Hoà tan hoàn toàn x gam hỗn hợp gồm NaI và NaBr vào nước thu được dung dịch X. Cho Br2 dư vào X được dung dịch Y. Cô cạn Y thu được y gam chất rắn khan. Tiếp tục hoà tan y gam chất rắn khan trên vào nước được dung dịch Z. Cho Cl2 dư vào Z được dung dịch T. Cô cạn T thu được z gam chất rắn khan. Biết các phản ứng xảy ra hoàn toàn và 2y = x + z. Phần trăm khối lượng của NaBr trong hỗn hợp ban đầu là A. 7,3%. B. 3,7%. C. 6,7%. D. 4,5%. Câu 28: Cho Bari kim loại lần lượt vào các dung dịch sau: NaHCO3, CuSO4, (NH4)2CO3, NaNO3, MgCl2. Số trường hợp tạo kết tủa là A. 3. B. 4. C. 1. D. 2. Câu 29: Hòa tan hết 6,08 gam hỗn hợp gồm Cu, Fe bằng dung dịch HNO3 thu được dung dịch X và 1,792 lít NO (đktc). Thêm từ từ 2,88 gam bột Mg vào dung dịch X đến khi phản ứng xảy ra hoàn toàn thu được 0,448 lít NO (đktc), dung dịch Y và m gam chất rắn không tan. Giá trị của m là A. 4,96 gam. B. 6,40 gam. C. 4,40 gam. D. 3,84 gam. Câu 30: Cho 6,9 gam một ancol đơn chức phản ứng với CuO nung nóng, thu được chất rắn A và 9,3 gam hỗn hợp X gồm anđehit, nước và ancol dư. Cho toàn bộ lượng hỗn hợp X phản ứng hoàn toàn với lượng dư dung dịch AgNO3 trong NH3, đun nóng, thu được m gam Ag. Giá trị của m là A. 32,4. B. 64,8. C. 24,3. D. 16,2. Câu 31: Nung nóng hỗn hợp X gồm 0,1 mol axetilen; 0,2 mol propen; 0,1 mol etilen và 0,6 mol hiđro với xúc tác Ni, sau một thời gian thu được hỗn hợp Y có tỉ khối so với H2 bằng 12,5. Cho hỗn hợp Y tác dụng với brom dư trong CCl4 thấy có tối đa a gam brom phản ứng. Giá trị của a là A. 24. B. 16. C. 32. D. 48. Câu 32: Cho các thí nghiệm sau: (1) Sục từ từ đến dư khí CO2 vào dung dịch NaAlO2 (hay Na[Al(OH)4]). (2) Sục từ từ đến dư khí NH3 vào dung dịch AlCl3. (3) Nhỏ từ từ đến dư dung dịch HCl loãng vào dung dịch NaAlO2 (hay Na[Al(OH)4]). Những thí nghiệm có hiện tượng giống nhau là A. (1) và (3) . B. (1), (2) và (3). C. (2) và (3). D. (1) và (2). Câu 33: Khi đun một ancol X với H2SO4 đặc ở 1700C, thu được 3 anken đồng phân có công thức C7H14. Khi hiđro hoá các anken đó thì đều thu được 2,2-đimetylpentan. Tên gọi của X là A. 2,2-đimetylpentan-3-ol. B. 2,2-đimetylpentan-4-ol. C. 4,4-đimetylpentan-2- ol. D. 3,3-đimetylpentan-2-ol. Câu 34: Cặp chất nào dưới đây không tồn tại trong cùng một dung dịch? A. CuSO4 và HNO3. B. Na2SO4 và KCl. C. KNO3 và CuCl2. D. NaHCO3 và HCl. Câu 35: Dãy gồm các chất và ion vừa có tính oxi hóa, vừa có tính khử là A. O3, Fe2+, FeCl2, CrO3. B. HCl, Na2S, NO2, Fe3+. C. NO2, Fe 2+, Cl2, FeCl3, SO32-. D. FeO, H2S, Cu, HNO3. Câu 36: Cho 9,6 gam hỗn hợp hơi gồm metanal và propin tác dụng hoàn toàn với lượng dư dung dịch AgNO3/NH3 thu được 73,89 gam kết tủa. Cho kết tủa này vào dung dịch HCl dư, sau khi kết thúc phản ứng còn lại m gam chất không tan. Giá trị của m là A. 25,92 gam. B. 47,445 gam. C. 51,84 gam. D. 73,365 gam. Câu 37: Lấy 9,1 gam hợp chất X có công thức phân tử là C3H9O2N tác dụng với dung dịch NaOH dư, đun nóng, 1 có 2,24 lít (đo ở đktc) khí Y thoát ra làm xanh giấy quỳ tím ẩm. Đốt cháy hết 2 lượng khí Y nói trên, thu được 4,4 gam CO2. Công thức cấu tạo của X và Y lần lượt là A. CH2=CHCOONH4; NH3. B. HCOOH3NC2H3; C2H3NH2. 7|G S T T G R O U P
  9. C. CH3COOH3NCH3; CH3NH2. D. HCOOH3NC2H5; C2H5NH2. Câu 38: Đó t chá y hoà n toà n 10,33 gam hõ n hơp X gò m axit acrylic, axit ađipic, axit propanoic và ancol etylic ̣ (trong đó só mol axit acrylic bà ng só mol axit propanoic) thu đươc hõ n hơp khí và hơi Y. Dã n Y và o 3,5 lít dung ̣ ̣ dịch Ca(OH)2 0,1M thu đươc 27 gam ké t tủ a và nươc lọ c Z. Đun nó ng nươc lọ c Z lại thu đươc ké t tủ a. Né u cho ̣ ́ ́ ̣ 10,33 gam hõ n hơp X tren tá c dụ ng với 100ml dung dịch KOH 1,2M, sau phả n ưng co cạ n dung dịch thì thu ̣ ́ được khối lượng chá t rá n là A. 12,21 gam. B. 12,77 gam. C. 10,12 gam. D. 13,76 gam. Câu 39: Cho 2,13 gam hỗn hợp gồm Cu và Al ở dạng bột tác dụng hoàn toàn với oxi thu được hỗn hợp X gồm hai oxit có khối lượng 3,33 gam. Thể tích dung dịch HCl 0,6M vừa đủ để phản ứng hết với X là A. 200 ml. B. 250 ml. C. 300 ml. D. 150 ml. Câu 40: Thực hiện phản ứng nhiệt phân hoàn toàn các chất sau: KClO3 (xúc tác MnO2), NH4NO3, NaHCO3, NH4NO2, KMnO4, KNO3, BaCO3, AgNO3. Số phản ứng tạo ra O2 là A. 4. B. 5. C. 3. D. 6. II. PHẦN RIÊNG (10 câu) Thí sinh chỉ được làm một trong hai phần (phần A hoặc phần B) 1. Phần A: Dành cho thí sinh theo chương trình chuẩn (10 câu, từ câu 41 đến câu 50) Câu 41: Khối lượng glucozơ có trong nước quả nho bằng bao nhiêu để sau khi lên men thu được 100 lít rượu vang 10o (biết hiệu suất phản ứng lên men đạt 95%, ancol etylic nguyên chất có khối lượng riêng 0,8 g/ml, giả thiết trong nước quả nho chỉ có một loại đường là glucozơ) là A. 32,952 kg. B. 15,652 kg. C. 16,476 kg. D. 31,304 kg. Câu 42: Cho 3,04 gam hỗn hợp X gồm FeO, Fe3O4, Fe2O3. Để khử hoàn toàn hỗn hợp X cần 0,1 gam hiđro. Mặt khác, hoà tan hỗn hợp X trong H2SO4 đặc, nóng thì thể tích khí SO2 (sản phẩm khử duy nhất ở đktc) là A. 336 ml. B. 448 ml. C. 112 ml. D. 224 ml. Câu 43: Cho biết các phản ứng xảy ra sau: 2FeBr2 + 3Br2 → 2FeBr3 2NaBr + Cl2 → 2NaCl + Br2 Phát biểu đúng là A. Tính khử của Cl− mạnh hơn Br − . B. Tính khử của Br − mạnh hơn Fe2+. C. Tính oxi hoá của Br2 mạnh hơn Cl2. D. Tính oxi hoá của Cl2 mạnh hơn của Fe3+. Câu 44: Hòa tan hết 10,24 gam Cu bằng 200 ml dung dịch HNO3 3M được dung dịch X. Thêm 400 ml dung dịch NaOH 1M vào dung dịch X. Lọc bỏ kết tủa, cô cạn dung dịch rồi nung chất rắn đến khối lượng không đổi thu được 26,44 gam chất rắn. Số mol HNO3 đã phản ứng với Cu là A. 0,48 mol. B. 0,58 mol. C. 0,4 mol. D. 0,56 mol. Câu 45: Hợp chất có công thức phân tử C4H9Br có số đồng phân cấu tạo là A. 6. B. 4. C. 3. D. 5. Câu 46: Để chống ăn mòn cho đường ống dẫn dầu bằng thép chôn dưới đất, người ta dùng phương pháp điện hoá. Trong thực tế, người ta dùng kim loại nào sau đây làm điện cực hi sinh? A. Sn. B. Cu. C. Na. D. Zn. Câu 47: Chia hỗn hợp A gồm ancol metylic và một ancol đồng đẳng làm 3 phần bằng nhau. - Phần 1: cho phản ứng hết với Na thu được 0,336 lí H2 (đkc). - Phần 2: oxi hóa bằng CuO thành hỗn hợp anđehit với hiệu suất 100%, sau đó cho toàn bộ sản phẩm hữu cơ tác dụng với lượng dư AgNO3 /NH3 thu được 10,8 gam bạc. Số mol của ancol metylic và ancol đồng đẳng trong mỗi phần lần lượt là A. 0,012 và 0,018. B. 0,01 và 0,02. C. 0,015 và 0,015. D. 0,02 và 0,01. Câu 48: Hoà tan hoàn toàn 0,3 mol hỗn hợp gồm Al và Al4C3 vào dung dịch KOH (dư), thu được a mol hỗn hợp khí và dung dịch X. Sục khí CO2 (dư) vào dung dịch X, lượng kết tủa thu được là 46,8 gam. Giá trị của a là A. 0,45. B. 0,40. C. 0,60. D. 0,55. Câu 49: Cho các phản ứng hoá học sau: (1) (NH4)2SO4 + CaBr2 → (2) CuSO4 + Ca(NO3)2 → (3) K2SO4 + CaCl2 → (4) H2SO4 + CaCO3 → (5) (NH4)2SO4 + Ca(OH)2 → (6) Fe2(SO4)3 + CaCl2 → Các phản ứng có cùng phương trình ion thu gọn là 8|L O V E B O O K . V N
  10. A. (1), (2), (3), (6). B. (3), (4), (5), (6). C. (1), (3), (5), (6). D. (2), (3), (4), (6). Câu 50: Một peptit có công thức cấu tạo thu gọn là: CH3CH(NH2)CONHCH2CONH(CH3)CHCONH(C6H5)CHCONHCH2COOH Khi đun nóng peptit trên trong môi trường kiềm sao cho các liên kết peptit đều bị phá vỡ thì số sản phẩm hữu cơ thu được là A. 3. B. 2. C. 4. D. 5. 2. Phần B: Dành cho thí sinh theo chương trình nâng cao (10 câu, từ câu 51 đến câu 60) Câu 51: Cho Eopin(Zn-Cu) = +1,10V; Eo(Zn2+/Zn) = - 0,76V và Eo(Ag+/Ag) = +0,80V. Suất điện động chuẩn của pin Cu - Ag là A. +0,56. B. +0,46V. C. +0,34V. D. +1,14V. Câu 52: Nguyên tử nguyên tố có số hiệu nguyên tử bằng 24 có tổng số electron độc thân là A. 5. B. 6. C. 3. D. 4. Câu 53: Một pin điện hoá có điện cực Zn nhúng trong dung dịch ZnSO4 và điện cực Cu nhúng trong dung dịch CuSO4. Sau một thời gian pin đó phóng điện thì khối lượng A. điện cực Zn giảm còn khối lượng điện cực Cu tăng. B. điện cực Zn tăng còn khối lượng điện cực Cu giảm. C. cả hai điện cực Zn và Cu đều giả m. D. cả hai điện cực Zn và Cu đều tăng. +X +NaOH dư,t0 Câu 54: Cho dãy chuyển hóa sau: Phenol→ Phenyl axetat → Y (hợp chất thơm). Hai chất X, Y trong sơ đồ lần lượt là A. axit axetic, natri phenolat. B. axit axetic, phenol. C. anhiđrit axetic, natri phenolat. D. anhiđrit axetic, phenol. Câu 55: Poli(metyl metacrylat) và nilon-6 được tạo thành từ các monome tương ứng là A. CH2=C(CH3)–COOCH3 và H2N–[CH2]5–COOH. B. CH2=CH–COOCH3 và H2N–[CH2]6–COOH. C. CH2=C(CH3)–COOCH3 và H2N–[CH2]6–COOH. D. CH3–COO–CH=CH2 và H2N–[CH2]5–COOH. Câu 56: Đốt cháy m gam đồng (II) sunfua trong khí oxi dư thu được chất rắn X có khối lượng bằng (m – 4,8) gam Nung X trong khí NH3 dư tới khối lượng không đổi được chất rắn Y. Hoà tan Y trong dung dịch HNO3 loãng dư, thu được V lít khí Z (đktc) không màu, hóa nâu trong không khí. Giá trị của m (gam) và V (lít) là A. 28,8 gam và 2,24 lít. B. 28,8 gam và 4,48 lít. C. 24,0 gam và 4,48 lít. D. 19,2 gam và 2,24 lít. Câu 57: Đốt cháy hoàn toàn một thể tích khí thiên nhiên gồm metan, etan, propan bằng oxi không khí (trong không khí, oxi chiếm 20% thể tích), thu được 7,84 lít khí CO2 (ở đktc) và 9,9 gam nước. Thể tích không khí (ở đktc) nhỏ nhất cần dùng để đốt cháy hoàn toàn lượng khí thiên nhiên trên là A. 78,4 lít. B. 56,0 lít. C. 70,0 lít. D. 84,0 lít. Câu 58: Thuỷ phân hoàn toàn 150 gam hỗn hợp các đipeptit thu được 159 gam các aminoaxit. Biết rằng các đipeptit được tạo bởi các aminoaxit chỉ chứa một nguyên tử N trong phân tử. Nếu lấy 1/10 khối lượng aminoaxit thu được tác dụng với HCl dư thì lượng muối thu được là A. 20,375 gam. B. 23,2 gam. C. 20,735 gam. D. 19,55 gam. Câu 59: Có một dung dịch X gồm CH3COOH 1M và CH3COONa 0,10M (cho CH3COOH có K a = 10−4,76 ). Giá trị pH của dung dịch X là A. 2,88. B. 3,76. C. 11,12. D. 10,24. Câu 60: Cho dung dịch các chất sau: axit glutamic; glyxin, lysin, alanin, đimetylamin, anilin, phenylamoniclorua, kalibenzoat, etilenglicol. Số dung dịch làm quỳ tím chuyển màu hồng, màu xanh, không đổi màu lần lượt là A. 2, 4, 3. B. 3, 2, 4. C. 3, 3, 3. D. 2, 3, 4. 9|G S T T G R O U P
  11. ĐÁP ÁN 1D 2A 3C 4D 5A 6B 7A 8A 9C 10C 11B 12B 13A 14C 15A 16C 17A 18C 19D 20A 21C 22C 23A 24D 25B 26B 27B 28C 29C 30B 31B 32D 33C 34D 35C 36D 37D 38B 39B 40A 41C 42D 43D 44D 45B 46C 47D 48C 49A 50A 51B 52A 53A 54C 55A 56B 57C 58D 59B 60D 10 | L O V E B O O K . V N
  12. GIẢI CHI TIẾT VÀ BÌNH LUẬN Câu 1: Đáp án D Ta có: nH2 (TH1) < nH2(TH2) ⇒ TH1 Al chưa tan hết. Gọi x, y là số mol Ba và Al có trong m (g) hỗn hợp. +TH1: X + H2 O. Ba + 2H2 O → Ba(OH)2 + H2 2Al + Ba(OH)2 + H2 O → Ba(AlO2 )2 + 3H2 x → x → x x 3x 8,96 nH2 = 4x = = 0,4 ⇒ x = 0,1 (mol) 22,4 +TH2: X + Ba(OH)2 dư. Ba + 2H2 O → Ba(OH)2 + H2 2Al + Ba(OH)2 + H2 O → Ba(AlO2 )2 + 3H2 x x y 1,5y 22,4 nH2 = x + 1,5y = = 1 (mol) ⇒ y = 0,6 (mol) 22,4 Vậy: m = mAl + mBa = 0,6.27 + 0,1.137 = 29,9(g). Câu 2: Đáp án A -Cho các dung dịch tác dụng với dung dịch Ba(OH)2 dư. Lấy kết tủa thu được cho tác dụng với dung dịch HNO3 dư: + Kết tủa nào tan + sủi bọt khí ⇒ Kết tủa là BaCO3 ⇒ dung dịch X. + Kết tủa nào không tan và không có bọt khí ⇒ Kết tủa BaSO4 ⇒ dung dịch Y. + Kết tủa nào tan một phần và sủi bọt khí ⇒ Kết tủa là BaCO3+ BaSO4 ⇒ dung dịch Z. Câu 3: Đáp án C Pthh: 2CH3OH + O2 → 2HCHO + 2H2O CH3OH + O2 → HCOOH + H2O Gọi nHCOOH = x mol ⇒ nHCHO = 3x mol AgNO3 /NH3 AgNO3 /NH3 Ta có: HCOOH → 2Ag ; HCHO → 4Ag 15,12 Suy ra: nAg = 2nHCOOH + 4nHCHO ⇒ 14x = = 0,14 (mol) ⇒ x = 0,01 (mol). 108 4a Vậy: H% = = 40% 0,1 Câu 4: Đáp án D Ta có: CH2 = CH − COO − C6 H5 (Y) → C6 H5 ONa (A1 ) → C6 H5 OH (B1 ) → C6 H2 (NO2 )3 OH (C1 ). CH2 = CH − COONa (A2 ) → CH2 = CH − COOH (B2 ) → CH2 = CH − COOCH3 (C2 ). Vậy Y là Phenylacrylat. Câu 5: Đáp án A Các phản ứng (4) và (5) thì O2 tạo thành do nhiệt phân muối nitrat sẽ oxi hóa các kim loại. Câu 6: Đáp án B Các phương trình trong đó H2O đóng vai trò chất oxi hóa hoặc chất khử là: (2), (4): H2O đóng vai trò là chất oxi hóa. (6): H2O đóng vai trò là chất khử. Chú ý: Phương trình (5) với sản phẩm như đề bài là trong điều kiện nhiệt độ thấp, còn với điều kiện nhiệt độ cao ta có phương trình: 2Na2O2 + 2H2O → 4NaOH + O2. Câu 7: Đáp án A Etilen không tác dụng với dung dịch AgNO3/NH3 nên loại B và D. Loại C vì but-2-in không có phản ứng. Chú ý: Chỉ các liên kết 3 đầu mạch mới có khả năng phản ứng với dung dịch AgNO3/NH3. Câu 8: Đáp án C Ta có: nOH− = nNaOH + 2nBa(OH)2 = 0,06 mol. Ta thấy nBaCO3 = 0,01 < nBa(OH)2 suy ra xảy ra 2 trường hợp. + Trường hợp 1: OH- dư. nCO2 = nBaCO3 = 0,01 mol ⇒ V = 0,1.22,4 = 0,224 lít. + Trường hợp 2: OH- hết, CO2 hòa tan một phần kết tủa. 11 | G S T T G R O U P
  13. nCO2 = nOH− − nBaCO3 = 0,06 − 0,01 = 0,05 (mol) ⇒ V = 0,05.22,4 = 1,12 (lít). Câu 9: Đáp án C Từ giả thiết ta gọi nA = 4 (mol) suy ra nO2 = 21 (mol). y y Cx Hy + (x + 4) O2 → xCO2 + 2 H2 O Phản ứng: y 4 → 4 (x + 4) → 4x y Sau phản ứng: O2 dư: 21 − 4 (x + ) , và 4x mol CO2 suy ra nsau = 21 − y (mol). 4 Do V và T không đổi nên tỉ lệ số mol bằng tỉ lệ với áp suất tương ứng: 21 − y 0,52p = ⇒y=8 25 p Với y = 8 ta có các chất khí sau: +C3H8 (có 1 chất) +C4 H8 (có 3 chất CH2 = CH − CH2 CH3 ; CH3 − CH = CH − CH3 ; CH3 − C(CH3 ) = CH2 . Câu 10: Đáp án C Gọi Y là Cx Hy N với số mol là a. y y 1 Phản ứng: Cx Hy N + (x + ) O2 ⟶ xCO2 + H2 O + N2 4 2 2 y ay a Mol a a (x + ) ax 4 2 2 (12x + y + 14). a = 1,18 y ax = 0,06 nCO2 = ax = 0,06 x=3 nN2 (không khí) = 4a (x + ) mol. Có: { ⇔ {ay = 0,18 ⇒ { 4 y a y=9 nN2 = 4a (x + ) + a = 0,02 4 2 Vậy Y là C3H9N. Câu 11: Đáp án B Khi cho từ từ dung dịch HCl vào dung dịch X thì: K 2 CO3 + HCl → KHCO3 + KCl (1) Mol: 0,375 → 0,375 → 0,375 KHCO3 + HCl → KCl + H2 O + CO2 Mol: 0,15 ← 0,15 → 0,15 Sau phản ứng (1), dung dịch có: 0,375+ 0,3 = 0,675 mol KHCO3 và 0,525-0,375 = 0,15 mol HCl nên tiếp tục xảy ra phản ứng (2). Kết thúc phản ứng còn dư 0,675 – 0,15 = 0,525 mol KHCO3 Ta có: VCO2 = 0,15.22,4 = 3,36(lít). nCaCO3 = nKHCO3 = 0,525(mol) ⇒ mCaCO3 = 0,525.100 = 52,5 (g). Câu 12: Đáp án B Phản ứng: 3FeCO3 + 10HNO3 → 3Fe(NO3 )3 + 3CO2 + NO + H2 O 1 0,1 Mol: 0,1 → → 0,1 → 3 3 Dung dịch X chứa 0,1 mol Fe 3+ và 0,3 mol NO− 3 3Cu + 8H + + 2NO− → 3Cu2+ + 2NO + 4H2 O 3 Mol: 0,45 ← 0,3 Cu + 2Fe3+ → Cu2+ + 2Fe2+ Mol: 0,05←0,1 nCu = 0,45 + 0,05 = 0,5 mol ⇒ mCu = 0,5.64 = 32(g) Câu 13: Đáp án A Trong Cr3+ có p =24 ⇒ e = p - 3 = 21 và n = 52 – 24 = 28. Câu 14: Đáp án C Các chất tác dụng được với dung dịch Ba(OH)2 là: Na2CO3; NaHCO3; AlCl3; Ca(HCO3)2; Mg(HCO3)2; K2SO3 ; K2SO4. Câu 15: Đáp án A 12 | L O V E B O O K . V N
  14. Câu 22: Đáp án C Ta có ∶ C6 H10 O5 → C6 H12 O6 → 2C2 H5 OH 162(kg) → 92(kg) 92.10 0,8.0,8 Suy ra: VC2 H5 OH = . = 11,516 (lít). 162 0,789.0,4 Câu 23: Đáp án A Các chất chứa liên kết cộng hóa trị (bao gồm cộng hóa trị phân cực và cộng hóa trị không phân cực) là: H2S (1); SO2 (2); NH3 (5); HBr (6); H2SO4 (7); CO2 (8). Câu 24: Đáp án D +CuO +O2 CH2 = C(CH3 )CH2 OH (X) → CH2 = C(CH3 ) − CHO → CH2 = C(CH3 )COOH +CH3 OH → CH2 = C(CH3 )COOCH3 . Câu 25: Đáp án B 15,2 + 0,3.40 − 23,6 Áp dụng định luật bảo toàn khối lượng suy ra: nH2 O = = 0,2 (mol) 18 Ta có: nNaOH : nH2 O = 0,3: 0,2 = 3: 2 và vì X tác dụng với dung dịch NaOH chỉ tạo ra muối và nước nên X có dạng R − COO − C6 H3 (OH) − R’. R − COO − C6 H3 (OH) − R’ + 3NaOH → RCOONa + R’ − C6 H3 (ONa)2 + 2H2 O 1 Theo phản ứng: nX = nNaOH = 0,1(mol). 3 15,2 MX = = 152 suy ra: R + R’ + 136 = 152 ⇒ R + R’ = 16 (−H + −CH3 ). 0,1 Vậy X có công thức phân tử là C8H8O3. Chú ý: Nhờ vào sự đánh giá bên trên ta có thể đưa ra được dạng của X, khi đó sẽ không cần xét tới các dữ liệu phía sau và bài làm sẽ nhanh hơn rất nhiều. Câu 26: Đáp án B - Cho các mẫu thử tác dụng với nước Br2: propenol làm mất màu nước brom. - Cho các mẫu thử còn lại tác dụng với Cu(OH)2: + Mẫu thử tạo ra dung dịch màu xanh lam → phenol. + Mẫu thử tạo ra dung dịch màu xanh thẫm đặc trưng → etilenglicol. + Mẫu thử không tạo ra hiện tượng gì → etanol. Câu 27: Đáp án B Gọi a, b lần lượt là số mol của NaI và NaBr có trong dung dịch X. Suy ra: 150a + 103b = x. + Dung dịch X + Br2 dư → dung dịch Y. Dung dịch Y chứa (a + b) mol NaBr ⇒ 103(a + b) = y. + Dung dịch Y + Cl2 → dung dịch Z. Dung dịch Z chứa (a+b) mol NaCl ⇒ 58,5(a + b) = z. 5 Theo bài ra: 2y = x + z ⇒ 2.103(a + b) = 150a + 103b + 58,5(a + b) ⇒ b = a. 89 5 103b 103. 89 a %mMg = = . 100% = 3,7%. 103b + 150a 103. 5 a + 150a 89 Câu 28: Đáp án C Với a = b + 0,5c ⇒ Các chất tham gia phản ứng vừa đủ với nhau. Vậy sau phản ứng dung dịch chỉ chứa muối Zn(NO3)2, kim loại thu được là Ag và Cu. Câu 29: Đáp án C Gọi x, y lần lượt là số mol Cu, Fe có trong hỗn hợp. Dung dịch X tác dụng với Mg tạo NO ⇒ Cu và Fe tan hết. 64x + 56y = 6,08 x = 0,06 Theo bài ra ta có: { ⇔{ 2x + 3y = 0,08.3 y = 0,04 Dung dịch X chứa HNO3 dư, 0,06 mol Cu(NO3)2 và 0,04 mol Fe(NO3)3. 14 | L O V E B O O K . V N
  15. - Dung dịch X + Mg: nMg = 0,12(mol). Các phản ứng xảy ra: 3Mg + 8HNO3 → 3Mg(NO3 )2 + 2NO + 4H2 O 0,03 0,03 Mg + 2Fe3+ → Mg 2+ + 2Fe2+ 0,02 0,04 Mg + Cu2+ → Mg 2+ + Cu 0,06 0,06 0,06 Mg + Fe2+ → Mg 2+ + Fe 0,01 0,01 0,01 Sau phản ứng: Mg hết và Fe2+ còn dư. Chất rắn còn lại gồm 0,06 mol Cu và 0,01 mol Fe. Vậy m = mCu + mFe = 0,06.64 + 0,01.56 = 4,4 (g). Câu 30: Đáp án B Ancol cần tìm là tác dụng với CuO tạo ra anđehit nên ancol đó có dạng RCH2OH. Phản ứng: RCH2 OH + CuO → RCHO + Cu + H2 O 9,3 − 6,9 nCuO (phản ứng) = nO (lấy đi) = = 0,15 (mol). 16 6,9 Suy ra: Mancol < = 46 suy ra ancol cần tìm là CH3 OH. 0,15 Vậy nHCHO = 0,15 (mol) ⇒ nAg = 4nHCHO = 0,6 mol ⇒ mAg = 0,6.108 = 64,8(g). Câu 31: Đáp án B mhỗn hợp X 0,1.26 + 0,2.42 + 0,1.28 + 0,6.2 nkhí sau = = = 0,6 (mol) MY 12,5.2 Số mol khí giảm đi bằng số mol H2 phản ứng: nH2(phản ứng) = 0,1 + 0,2 + 0,1 + 0,6 − 0,6 = 0,4 (mol). Số liên kết π còn lại trong hỗn hợp là: (0,1.2 + 0,2 + 0,1) – 0,4 = 0,1 mol nBr2 = nπ = 0,1 mol ⇒ mBr2 = 0,1.160 = 16 (g). Câu 32: Đáp án D Những thí nghiệm giống nhau là (1) và (2): xuất hiện kết tủa keo trắng. Thí nghiệm (3): xuất hiện kết tủa keo trắng và tan dần khi HCl dư. Câu 33: Đáp án C X là 4,4-đimetylpentan-2-ol. Câu 34: Đáp án D Chú ý: Những chất không thể cùng tồn tại trong cùng một dung dịch khi chúng có khả năng phản ứng với nhau. Câu 35: Đáp án C 1 nNaOH(phản ứng) = 0,5 − 0,2 = 0,3 (mol). Ta thấy: nY = nNaOH nên Y là C3 H5 (OH)3 . 3 Muối gồm muối hữu cơ và 0,2 mol NaCl. 34,9 − 0,2.58,5 ̅ Ta có: mrắn = mNaCl + mhữu cơ ⇒ Mmuối = = 77,33 ⇒ X là (HCOO)C3 H5 (OOCCH3 )2 . 0,3 Câu 36: Đáp án D Gọi nHCHO = x; nC3 H4 = y mol. AgNO3 /NH3 AgNO3 /NH3 HCHO → 4Ag và CH3 C ≡ CH → CH3 C ≡ CAg. 30x + 40y = 9,6 x = 0,12 Ta có hệ: { ⇔{ 108.4x + 147y = 73,89 y = 0,15 Khi cho kết tủa tác dụng với dung dịch HCl dư: CH3 C ≡ CAg + HCl → CH3 C ≡ CH + AgCl Kết tủa thu được sau phản ứng gồm 0,12 mol Ag và 0,15 mol AgCl. Vậy m = mAg + mAgCl = 0,1.108 + 0,15.143,5 = 73,365 (g). Câu 37: Đáp án D Ta có: nY = 0,1 mol. Đốt cháy một nửa Y thu được 0,1 mol CO2. 15 | G S T T G R O U P
  16. 159 − 150 Ta có: nH2 O = = 0,5 (mol). 18 ̅ ̅ H2 N − R − COOH + HCl → ClH3 N − R – COOH 1 nHCl = namino axit = = 0,1 (mol) 10 Áp dụng định luật bảo toàn ta có: mmuối = mamino axit + mHCl = 15,9 + 0,1.36,5 = 19,55(g). Câu 59: Đáp án B Phản ứng: CH3 COOH → CH3 COO− + H + Ban đầu: 1 0,1 Điện ly: x → x → x Cân bằng: 1- x 0,1- x x (0,1 − x). x Ta có: K a = = 10−4,76 1−x Giả sử x
  17. Đề số 2 I. PHẦN CHUNG CHO TẤT CẢ THÍ SINH (40 câu, từ câu 1 đến câu 40) Câu 1: Cho các chất: NaHSO3 ; NaHCO3 ; KHS; NH4 Cl; AlCl3 ; CH3 COONH4 , Al2 O3 , Zn, ZnO, NaHSO4 . Số chất lưỡng tính là A. 8. B. 6. C. 7. D. 5. Câu 2: Thực hiện các thí nghiệm sau: (a) Nung NH4NO3 rắn. (b) Đun nóng NaCl tinh thể với dung dịch H2SO4 (đặc). (c) Cho CaOCl2 vào dung dịch HCl đặc. (d) Sục khí CO2 vào dung dịch Ca(OH)2 (dư). (e) Sục khí SO2 vào dung dịch KMnO4. (g) Cho dung dịch KHSO4 vào dung dịch NaHCO3. (h) Cho ZnS vào dung dịch HCl (loãng). (i) Cho Na2CO3 vào dung dịch Fe2(SO4)3. Số thí nghiệm sinh ra chất khí là A. 4. B. 5. C. 2. D. 6. Câu 3: Có 5 kim loại: Mg, Ba, Zn, Fe, Ag. Nếu chỉ dùng thêm 1 chất thì có thể dùng chất nào trong số các chất cho dưới đây để nhận biết các kim loại đó là A. dung dịch H2SO4 loãng. B. dung dịch Ca(OH)2. C. dung dịch NaOH. D. dung dịch FeSO4. Câu 4: Hỗn hợp A gồm CH4 , C2 H4 , C3 H4 . Nếu cho 26,8 gam hỗn hợp X tác dụng với dung dịch AgNO3/NH3 dư thì thu được 29,4 gam kết tủa. Nếu cho 8,4 lít hỗn hợp X (đktc) tác dụng với dung dịch brom thì thấy có 54 gam brom phản ứng. % thể tích CH4 trong hỗn hợp X là A. 40%. B. 25%. C. 35%. D. 30%. Câu 5: Hoà tan hết m gam Al2 (SO4 )3 vào nước được dung dịch X. Cho 360 ml dung dịch NaOH 1M vào X, thu được 2a gam kết tủa. Mặc khác, nếu cho 400 ml dung dịch NaOH 1M vào X thì thu được a gam kết tủa. Các phản ứng xảy ra hoàn toàn, giá trị của m là: A. 20,520. B. 19,665 C. 15,390. D. 18,810. Câu 6: Cho propan qua xúc tác (ở nhiệt độ cao) thu được hỗn hợp X gồm C3 H8 , C3 H4 , C3 H6 và H2 . Tỉ khối của X so với H2 bằng d. Nếu cho 6,16 lít X (đktc) vào dung dịch brom (dư) thấy có 24 gam brom phản ứng. Giá trị của d bằng A. 10. B. 15. C. 12. D. 8. Câu 7: Hợp chất hữu cơ X tác dụng được với dung dịch KOH và dung dịch brom nhưng không tác dụng với dung dịch KHCO3. Tên gọi của X là A. ancol benzylic. B. axit acrylic. C. anilin. D. vinyl axetat. Câu 8: Cho các phản ứng: t0 (1). O3 + dung dịch KI → (6). F2 + H2 O → t0 (2). MnO2 + HCl đặc → (7). NH3 (dư) + Cl2 → t0 (3). KClO3 + HCl đặc → (8). HF + SiO2 → (4) Dung dịch HCl đặc + FeS2 → (9). C2 H5 NH2 + NaNO2 + HCl t0 (5). NH3 (khí) + CuO → Số trường hợp tạo ra đơn chất là A. 5. B. 8. C. 7. D. 6. Câu 9: Đốt cháy hoàn toàn 2,24 lít (đktc) hỗn hợp khí gồm: CH4 , C2 H4 , C2 H6 , C3 H8 thu được 6,16 gam CO2 và 4,14 gam H2 O. Số mol C2 H4 trong hỗn hợp trên là A. 0,08 mol. B. 0,09 mol. C. 0,01 mol. D. 0,02 mol. Câu 10: Hoà tan Fe3 O4 trong lượng dư dung dịch H2 SO4 loãng thu được dung dịch X. Dung dịch X tác dụng được với bao nhiêu chất trong số các chất sau: Cu, NaOH, Br2 , AgNO3 , KMnO4 , MgSO4, Mg(NO3 )2 , Al, H2 S? A. 5. B. 8. C. 6. D. 7. Câu 11: Cho 9 gam axit axetic phản ứng với 13,8 gam ancol etylic (xúc tác H2 SO4 đặc), đun nóng, thu được 8,25 gam etyl axetat. Hiệu suất của phản ứng este hoá là 19 | G S T T G R O U P

CÓ THỂ BẠN MUỐN DOWNLOAD

YOMEDIA
Đồng bộ tài khoản