intTypePromotion=3

BÀI TẬP ÔN VỀ PHẢN ỨNG OXI HÓA-KHỬ

Chia sẻ: Abcdef_50 Abcdef_50 | Ngày: | Loại File: PDF | Số trang:25

0
167
lượt xem
13
download

BÀI TẬP ÔN VỀ PHẢN ỨNG OXI HÓA-KHỬ

Mô tả tài liệu
  Download Vui lòng tải xuống để xem tài liệu đầy đủ

1. BÀI TẬP XÁC ĐỊNH SỐ OXI HOÁBài 1: Xác định số oxi hoá của các nguyên tố trong các hợp chất, ion sau:N : NH3 , NH4+, H2N-NH2 (hidrazin), NH2OH (hidroxylamin), NO2-, NO3-O : H2O, O2- (ion oxit), H2O2 , O22- (ion peoxit)P : H3P, H3PO3 , H3PO4, HPO42- , PO43-, P4O6 , P4O10 , POCl3 , H4P2O7

Chủ đề:
Lưu

Nội dung Text: BÀI TẬP ÔN VỀ PHẢN ỨNG OXI HÓA-KHỬ

  1. BÀI TẬP PHẢN ỨNG OXI HÓA-KHỬ 1. BÀI TẬP XÁC ĐỊNH SỐ OXI HOÁ Bài 1: Xác định số oxi hoá của các nguyên tố trong các hợp chất, ion sau: N : NH3 , NH4+, H2N-NH2 (hidrazin), NH2OH (hidroxylamin), NO2 -, NO3- O : H2O, O2- (ion oxit), H2O2 , O22- (ion peoxit) P : H3P, H3PO3 , H3PO4, HPO42- , PO43-, P4O6 , P4O10 , POCl3 , H4P2O7 S : H2S, S2-, S2O32- , S4O6 , SO32- , SO42- Mn : Mn2+, Mn(OH)2 , MnO2 , MnO42-, MnO4-, Mn2(CO)10, CH3Mn(CO)5 Cr: Cr2+, Cr3+, Cr(OH)3, CrO2 -, Cr2O72-, CrO4 2- Fe: Fe2+, Fe(OH)2, Fe3+, Fe(OH)3, Fe(H2O)3(OH)3, [Fe(CN)4]2-, Fe(CO)5,
  2. Fe(CO)4 Cu : Cu+, Cu2O, CuCl, CuCl2, Cu(NH3)2+, Cu2+, CuO, Cu(NH3)42+ Ag : AgCl, AgBr, AgI, Ag(NH3)+ Pt : Pt(NH3)42+, PtCl62- Au : Au+, Au3+, Au(CN)4 - Hg : Hg22+, Hg2Cl2, Hg2SO4, Hg2+, HgO U : UO2+, UO22+, U3+, U4+ Zn : Zn(H2O)2(OH)2, Zn(H2O)(OH)3 - C : CH3OH, HCHO, HCCOH, C6H12O6, C6H5OH, C6H5NO2, C6H5CH=CH2 Co : Co2(CO)9, HCo(CO)4
  3. Ni : Ni(CO)4 Bài 2: Xác định số oxi hoá của các nguyên tố in nghiêng trong các hợp chất sau: Bài 3: Xác định số oxi hoá của các nguyên tố in nghiêng trong các hợp chất sau: 2. BÀI TẬP CÂN BẰNG PHẢN ỨNG OXI HOÁ -KHỬ Bài 1: Cân bằng các phản ứng oxi hoá-khử sau theo phương pháp thăng bằng e: Al + HNO3 --> Al(NO3)3 +NH4NO3 +H2O Mg + HNO3 --> Mg(NO3)2 +NO +H2O
  4. Fe + HNO3 --> Fe(NO3)3 +NO2 +H2O Fe3O4 + HNO3 --> Fe(NO3)3 +NO2 +H2O Fe(OH)2 + HNO3 --> Fe(NO3)3 +NO2 +H2O Mg + HNO3 --> Mg(NO3)2 +N2 +H2O FeCl2 + HNO3 --> Fe(NO3)3 +FeCl3+NO+H2O FeO + HNO3 --> Fe(NO3)3 +NO2 +H2O Bài 2: Cân bằng phản ứng oxi hoá-khử sau:
  5. Bài 3: Cân bằng các phản ứng oxi hoá -khử sau: Cu2SFeS2+HNO3 --> CuSO4+Cu(NO3)2+Fe2(SO4)3+NO2+H2O Bài 4: Cân bằng các phản ứng oxi hoá -khử sau: HNO2 --> HNO3 + NO + H2O K2MnO4+H2O --> KMnO4 + MnO2 + KOH
  6. H2O2 --> H2O + O2 KClO3 --> KClO4 + KCl CrO --> Cr2O3 + Cr CuCl (huyền phù) --> Cu + CuCl2 HIO --> HIO3 +I2+H2O I2+NaOH (loãng) --> NaI + NaIO + H2O I2+NaOH(nóng) --> NaI + NaIO3 + H2O NaClO --> NaCl+NaClO3 Cl2O --> Cl2+ClO2 ClO2 --> ClO3+Cl2
  7. Na2SO3 --> Na2S +Na2SO4 Na2S2O3 --> Na2SO3+S KOH+Cl2 --> KCl+KClO4+H2O Bài 5: Cân bằng các phản ứng oxi hoá-khử sau: NH4NO2 --> N2+H2O NH4NO3 --> N2O+H2O S+H2SO4 --> SO2+H2O Fe+FeCl3 --> FeCl2 C+CO2 --> CO KBrO3 +KBr+H2SO4 --> K2SO4+Br2+H2O
  8. Bài 6: Hoàn thành và cân bằng các phản ứng oxi hoá-khử sau: FeO + HNO3(l) --> Fe(NO3)3 + NxOy + H2O FexOy + HNO3 --> Fe(NO3)3 + NaOb + H2O Fe + HNO3 --> Fe(NO3)3 + NxOy + H2O FexOy + CO --> Fe+CO2 Cu2FeSx + O2 --> Cu2O+Fe3O4+… Bài 7: Cân bằng các phản ứng oxi hoá -khử sau: Fe + HNO3 --> Fe(NO3)3 + NO + NO2 + H2O (VNO=2VNO2) Al + HNO3 --> Al(NO3)3 + NO + NH4NO3 + H2O (nNO=nNH4NO3) Zn + H2SO4(đ) --> ZnSO4 + S + SO2 + H2O (nS=nSO2)
  9. NH3 + KClO3 --> KNO3 + KCl + Cl2 + H2O (nKCl=nCl2) Mg +HNO3 --> Mg(NO3)2 + NO2 + NO +H2O (VNO2=VNO) Bài 8: Cân bằng phản ứng oxi hoá-khử sau: KClO3+NH3 --> KNO3+KCl+Cl2+H2O NH3+NaClO --> NaNO3 +Cl2 +NaCl+H2O KClO+N2H4 --> KNO2+Cl2+ KCl+H2 Bài 9: Cân bằng các phản ứng oxi hoá -khử sau: CH2=CH2 + KMnO4 + H2SO4 --> CO2+MnSO4+K2SO4+H2O CH3CH=CH2+KMnO4+H2O --> CH3CHOHCH2OH+K2SO4+MnSO4+H2O CH3CH2OH+KMnO4+H2SO4 --> CH3COOH+K2SO4+MnSO4+H2O
  10. C2H2 +KMnO4 +H2O --> H2C2O4+KOH+MnO2 C6H5CH3 +KMnO4 + H2SO4 --> C6H5COOH +MnSO4+K2SO4 +H2O HOOC-COOH+KMnO4+H2SO4 -->CO2+K2SO4+MnSO4+H2O C6H5CH2CH3+KMnO4+H2SO4 --> C6H5COOH+CO2+K2SO4+MnSO4+H2O H2C2O4 +KMnO4 +H2SO4 --> CO2+K2SO4+MnSO4+H2O C2H5OH+K2Cr2O7 +H2SO4 --> CO2 + K2SO4+Cr2(SO4 )3+H2O CaC2O4 +KMnO4+H2SO4 --> CaSO4 +CO2 +K2SO4 +MnSO4+H2O C12H22O11 +H2SO4 --> CO2 +SO2 +H2O C3H5O9N3 --> CO2+H2O+N2+O2
  11. Bài 10: Cân bằng các phản ứng oxi hoá-khử sau theo phương pháp thăng bằng ion-electron: KMnO4 + FeSO4 + H2SO4 --> Fe2(SO4)3 + MnSO4 + K2SO4 + H2O KMnO4 +KNO2 + H2SO4 -->KNO3 + MnSO4 + K2SO4 + H2O KMnO4 + K2SO3 + H2SO4 --> MnSO4 + K2SO4 + H2O KMnO4 + Na Cl + H2SO4 --> MnSO4 + Cl2 + Na2SO4 + K2SO4 + H2O KMnO4 + HCl --> MnCl2 + Cl2 + KCl + H2O KMnO4 + PH3 + H2SO4 --> MnSO4 + H3PO4 + K2SO4 + H2O KMnO4 + Zn + H2SO4 --> MnSO4 + ZnSO4 + K2SO4 + H2O KMnO4 + K2SO3 + H2O --> MnO2 + K2SO4 + KOH KMnO4 + MnSO4 + H2O --> MnO2 + K2SO4 + H2SO4
  12. KMnO4 + H2O2 --> MnO2 + O2 + KOH + H2O KMnO4 + K2SO3 + KOH --> K2MnO4 + K2SO4 + H2O KMnO4 + FeS + H2SO4 --> Fe2(SO4)3 + MnSO4 + K2SO4 + H2O KMnO4 +FeS2 + H2SO4 --> Fe2(SO4)3 + MnSO4 + K2SO4 + H2O KMnO4 +CuFeS2 +H2SO4 --> Fe2(SO4)3 +MnSO4 +CuSO4+K2SO4 + H2O K2Cr2O7 + FeSO4 +H2SO4 --> Cr2(SO4)3 + Fe2(SO4)3 + K2SO4 + H2O K2Cr2O7 + K2SO3 + H2SO4 --> Cr2(SO4)3 + K2SO4 + H2O K2Cr2O7 + KI + H2SO4 --> Cr2(SO4)3 + I2 + K2SO4 + H2O K2Cr2O7 + H2S + H2SO4 --> Cr2(SO4)3 + S + K2SO4 + H2O K2Cr2O7 + HBr --> CrBr3 + Br2 + KBr + H2O
  13. K2Cr2O7 + HCl --> CrCl3 + Cl2 + KCl + H2O K2Cr2O7 + SnCl2 +HCl --> CrCl3 + SnCl4 + KCl + H2O K2CrO4 +(NH4)2S + H2O --> Cr(OH)3 + S + NH3 + KOH Bài 11: Hoàn thành và cân bằng các phản ứng oxi hoá-khử sau theo phương pháp thăng bằng ion-eletron: I2 + --> I- + S4O62- Bi(OH)3 + SnO22- --> Bi + SnO32-+ H2O Cl2+I- +OH- --> IO4- +… OCl-+I-+H2O --> …+I2+… Bài 12: Hoàn thành và cân bằng phản ứng oxi hoá-khử sau trong môi trường axit:
  14. ClO4- + I- +… --> HIO + Cl- H3AsO4 + H2C2O4 --> CO2 + HAsO2 +… Cr2O72- + CH3OH +… -->Cr3+ + HCOOH +… PbO2 + H2O2 +… --> O2 + Pb2+ +… Sb2O5 + H2S +… --> S + SbO+ +… IO3- + I- +… --> I2 +… NO3- + Al +… --> NH3 + Al3+ +… F2 + H2O --> F- + O3 +… H3AsO4 + I- +… --> HAsO2 + I2 +… Cr2O72- + Br- +… --> Cr3+ + Br2 +…
  15. Cr3+ + Cl2(k) +… --> Cr2O72- + Cl- +… Bài 13: Hoàn thành và cân bằng phản ứng oxi hoá-khử sau trong môi trường bazơ: NO3-+S2- +… --> NO2-+S +… MnO4-+I- +… --> MnO42-+IO3- +… ClO-+Fe(OH)2+… -->Cl-+Fe(OH)3 BrO3-+I2 +… --> IO3-+BrO- +… ClO4-+C +… --> CO32-+Cl2 +… HO2-+IO3- --> O2+I- +… IO3-+Cr(OH)3+… --> CrO42-+I- +…
  16. Bài 14: Cân bằng các phản ứng oxi hoá-khử sau: K2[Pt(NO2)4].2H2O --> KNO2+Pt+NO2+H2O K[PtF6]+H2 --> Pt+KF+HF K[PtF6] --> PtF4+F2+KF K[PtF6] +H2O --> PtO2+K2[PtF6]+O2+HF K[PtF6] +HCl(đ) --> H2[PtF6]+Cl2+KCl K[PtF6]+KOH(đ,nguội) --> PtO2+O2+KF+H2O (NH4)2[PtCl6] --> Pt(bột)+NH4Cl+Cl2 (NH4)2[PtCl6] --> Pt+NH4Cl+HCl+N2 K2[PtCl6]+KNO2+H2O --> K2[Pt(NO2)4]+KNO3+KCl+HCl
  17. H2[PtCl4]+N2H4.H2O+NH3.H2O --> Pt+NH4Cl+H2O+N2 H2[PtCl4]+HCl+KMnO4 --> H2[PtCl6]+MnCl2+H2O K2[Pt(CN)4] --> KCN+Pt+C2N2 K[Pt(C2H4)Cl3]+H2 --> Pt+C2H6+KCl+HCl RuO4+H2O2(l) --> RuO2+O2+H2O NiS+CO --> Ni+CO2+CS2 NiSO4+NaClO+NaOH(l) -->NiO(OH)+NaCl+Na2SO4+H2O Ni(NO3)2+NaOH(đ)+Br2 --> NiO(OH)+NaNO3+NaBr+H2O CoCl2+NaNO2+CH3COOH --> Na3[Co(NO2)6]+ NaCl+Na(CH3COO)+ NO +H2O CoF3+N2O5 --> Co(NO3)3+NF3+O2
  18. K2FeO4+H2SO4(l) --> Fe2(SO4)3+O2+K2SO4+H2O K2FeO4 --> K3FeO4+KFeO2+O2 Fe+SO2(ẩm) --> FeSO3+FeSO3S NH4ReO4 --> ReO2+N2+H2O ReF6+NaOH(l) --> NaReO4+ReO2+NaF+H2O Tc2O7+CCl4 --> TcCl4+CCl2O+Cl2 K2MnO4 --> K3MnO4+MnO2+O2 (nK3MnO4=2nMnO2) K2MnO4+H2O --> KMnO4+MnO2+KOH K2MnO4+K2S2O6(O2) --> KMnO4+K2SO4 KMnO4 --> K2MnO4+MnO2+ O2
  19. KMnO4 --> K3MnO4+MnO2+O2 (nMnO2=2nK3MnO4) MnSO4+HNO3+NaBiO3 --> HMnO4+Bi(NO3)3+Na2SO4+NaNO3+H2O K2Cr2O7+C --> Cr2O3+K2CO3+CO W+HF+HNO3(đ) --> H2[WO2F4]+NO+H2O SnO2+KNCS --> SnS+CO+N2+K2S CuS+HNO3 --> Cu(NO3)2+S+NO+H2O As2S 3+HNO3 --> H3AsO4+H2SO4+NO2+H2O HgS+HCl+HNO3 --> HgCl2+NO+H2SO4+H2O Bài 15 : Hoàn thành và cân b ằng phản ứng oxi hoá-khử sau: I-+NO2- --> I2+NO (môi trường axit)
  20. Au+CN-+O2 --> Au(CN)4- (môi trường trung tính) MnO4- --> MnO42-+O2 (môi trường kiềm) P --> PH3+H2PO2- (môi trường kiềm) Zn+As2O3 --> AsH3+Zn2+ (môi trường axit) V --> HV6O173-+H2 (môi trường kiềm) Bài 16: Cân bằng các phản ứng oxi hoá-khử sau: HClO3+HCl --> Cl2+ClO2+H2O (nCl2=nClO2) KMnO4+SO2+H2O --> MnSO4+K2SO4+H2SO4 HI+HNO3 --> I2+NO+H2O NH3+NaOCl --> N2H4+NaCl+H2O

CÓ THỂ BẠN MUỐN DOWNLOAD

 

Đồng bộ tài khoản