intTypePromotion=1

Bài giảng Hóa học 11 bài 45: Axit Cacboxylic

Chia sẻ: Lê Hoài Đức | Ngày: | Loại File: PPT | Số trang:42

0
266
lượt xem
57
download

Bài giảng Hóa học 11 bài 45: Axit Cacboxylic

Mô tả tài liệu
  Download Vui lòng tải xuống để xem tài liệu đầy đủ

Quý thầy cô giáo và các bạn học sinh có thể sử dụng bộ sưu tập tổng hợp 8 bài giảng Axit Cacboxylic để làm tư liệu tham khảo cho quá trình giảng dạy và học tập. Bài giảng giúp các bạn học sinh biết được cấu tạo, ứng dụng của Axit Cacboxylic. Hiểu tính chất hoá học chung của Axit Cacboxylic trên cơ sở tính chất của Axit axetic. Đồng thời nắm được các kỹ năng vận dụng tính chất hoá học chung của Axit và của Axit axetic để nêu được tính chất hoá học của Axit cacboxylic. Viết được các phương trình ion rút gọn các phản ứng của axit cacboxylic tác dụng với các chất.

Chủ đề:
Lưu

Nội dung Text: Bài giảng Hóa học 11 bài 45: Axit Cacboxylic

  1. HÓA HỌC 11 AXIT CACBOXYLIC
  2. I. Định nghĩa-Phân loại-Danh pháp. II. Cấu trúc và tính chất vật lý. III. Tính chất hoá học. IV. Điều chế và ứng dụng.
  3. DƯA, CÀ MUỐI
  4. I. Định nghĩa, phân loại, danh pháp 1. Định nghĩa: - Axit cacboxylic là những hợp chất hữu cơ mà phân tử có nhóm cacboxyl (- COOH) liên kết trực tiếp với nguyên tử C hoặc nguyên tử H. -> VD: CTTQ: R(COOH)a hay H-COOH CnH2n+2-2k-a(COOH)a R: CH 3-COOH là gốc hidrocacbon hoặc là H, C6k≥0, n≥0, H5-COOH a≥1 HOOC-COOH
  5. 2. Phân loại: VD: H-COOH CH2=CH-COOH CH3-COOH CH≡C-COOH CH3-CH2-COOH C6H5-COOH HOOC-COOH C6H5-CH2-COOH HOOC-CH2-COOH
  6. AXIT CACBOXYLIC Axit no, Axit Axit đa chức đơn chức, không no, Axit thơm, no đa chức và mạch hở: mạch hở, đơn chức: Không no đa H-COOH đơn chức: (Axit fomic) C6H5-COOH Chức. CH2=CH-COOH CH3COOH (Axit benzoic) HOOC-COOH (Axit acrylic) (axit axetic) (Axit oxalic) CTTQ axit no đơn chức mạch hở CnH2n+1COOH (n≥0) hay CnH2nO2 (n ≥1) •Chú ý: Ngoài ra còn một số cách phân loại khác như : + Axit tạp chức: Là axit caboxylic ngoài chứa nhóm cacboxyl còn chứa các nhóm chức khác VD: Axit lactic CH3CH(OH)COOH + Axit béo: Là các axit cacboxylic mạch cacbon dài, không nhánh: VD: C17H35COOH (axit stearic); C17H33COOH (axit oleic); C15H31COOH (axit panmitic)
  7. 3. Danh pháp: a. Tên thông thường: Một số axit có tên thông thường liên quan đến nguồn gốc tìm ra chúng. Tờn axit = Axit + tờn hidrocacbon mạch chớnh + “oic” b. Tên thay thế: * LưuVD: ý: -Gọi tên Chọn axitchính mạch sau:là mạch C chứa nhóm COOH dài nhất và có nhiều nhánh nhất. CTCT - Đánh STT bắt đầu từTên thường nguyên tử C của nhóm 1COOH Tên thay thế 4CH -3CH -2CH-1COOH CH33-CH-COOH 2 HCOOH Axit fomic Axit metanoic C2H5 CH3 Axit-2-metylbutanoic CH3-COOH Axit axetic Axit etanoic CH3CH2COOH Axit propionic Axit propanoic (CH3)2CH-COOH Axit isobutiric Axit 2-metylpropanoic CH3(CH2)3COOH Axit valeric Axit pentanoic CH2 =CH-COOH Axit acrylic Axit propenoic HOOC-COOH Axit oxalic Axit etanđioic
  8. 3. Danh pháp: a. Tên thông thường: Một số axit có tên thông thường liên quan đến nguồn gốc tìm ra chúng. b. Tên thay thế: Tờn axit = Axit + tờn hidrocacbon mạch chớnh + “oic” CH 5CH - 4CH - 3CH - 2CH –1COOH CH33 –– CH CH22-- CH - CH2- 2CH2 - CH 2 –COOH 6CH CH –– CH CH3 3 CHCH 3 3 CH3 7 CH3 Axit-5-etyl-2,6 đi metyl heptanoic Lưu ý: - Chọn mạch chính là mạch C chứa nhóm COOH dài nhất và có nhiều nhánh nhất. - Đánh STT bắt đầu từ nguyên tử C của nhóm COOH - Tên axit = Axit + vị trí nhánh + tên nhánh (theo ABC)+ tên hidrocacbon mạch chính + “oic”
  9. II. CẤU TRÚC - TÍNH CHẤT VẬT LÍ  1. CẤU TRÚC   NHÓM C = O không giống trong anđehit và xeton  Nhóm – O – H phân cực hơn nhóm – O – H trong ancol và phenol  Tính axit lớn hơn ancol và phenol
  10. 2. TÍNH CHẤT VẬT LÍ Trạng thái: ở điều kiện thường, axit cacboxylic ở trạng thái lỏng hoặc rắn Nhiệt độ sôi: cao hơn anđehit, xeton và ancol tương ứng có cùng số C Tính tan: do có liên kết hidro với nước, các axit tan được trong nước. Axit có vị chua
  11. Liên kết hidro liên phân tử ở hai dạng của axit cacboxylic       DẠNG POLIME   H O C R O   DẠNG DIME
  12. III. Tính chất hoá học 1. Tính axit và ảnh hưởng của nhóm thế. • Là các axit yếu. • Vẫn có đầy đủ tính chất của 1 axit: - Làm hồng quỳ tím. -Tác dụng với kim loại H2. -Tác dụng với bazơ. -Tác dụng với muối của axit yếu hơn.
  13. 1. Tính axit và ảnh hưởng của nhóm thế. R-COOH + H2O R-COO- + H3O+ [RCOO-].[H3O+] Ka= [RCOOH] Ka (250C) Trong các axit 17,72.10 -5 H-COOH no đơn chức, 1,75.10 -5 CH3 COOH axit fomic 1,33.10 -5 CH3CH2 COOH HCOOH là axit 1,29.10 -5 CH3[CH2]4 COOH mạnh nhất
  14. 1. Tính axit và ảnh hưởng của nhóm thế. Ka(250C) CH3 COOH 1,75.10-5 Cl CH2 COOH 13,5.10-5 F CH2 COOH 26,9.10-5 C¸c nguyªn tö cã ®é ©m ®iÖn lín ë gèc R hót electron khái nhãm cacboxyl nªn lµm t¨ng lùc axit.
  15. 2. Phản ứng tạo thành dẫn xuất axit a. Phản ứng với ancol (phản ứng este hoá). H+, t0 R-C-OH + H-OR’ R-C-OR’ + H2O O O Axit cacboxylic ancol este VD: CH3-C-OH +H-OC2H5 + 0 CH3-C- H ,t OC2H5+H2O O O Axit axetic etanol etylaxetat
  16. 2. Phản ứng tạo thành dẫn xuất axit b. Phản ứng tách nước (đehiđrat hoá). CH-C-O-H + H-O-C-CH3P2O5 CH3-C-O-C-CH3 -H2O O O O O (CH3CO)2O axit axetic anhiđrit axetic
  17. 3. Phản ứng ở gốc hiđrocacbon. 1. aPhản ứng thế ở gốc no. P CH3CH2CH2COOH+Cl2 CH3CH2CHCOOH + HCl Cl
  18. 3. Phản ứng ở gốc hiđrocacbon. 2. Phản ứng thế ở gốc thơm. COOH + HNO3 H2SO4 COOH +H2O NO2 Axit bezoic axit m-nitrobezoic
  19. 3. Ph¶n øng ë gèc hi®rocacbon. c. Phản ứng cộng vào gốc không no. CH3[CH2]7CH=CH[CH2]7COOH + H2 axit oleic CH3[CH2]7CH2CH2[CH2]7COOH (axit stearic) Ni, t0 CH3CH=CHCOOH + Br2 CH3CHBr-CHBr- COOH
  20. IV. Điều chế và ứng dụng. 1. Điều chế a. Trong phòng thí nghiệm • Ôxi hoá hiđocacbon, ancol… 1)+KMnO 2)+H O+ C6H5-CH3 4 3 C6H5-COOH H2O, t0 • Đi từ dẫn xuất halogen. KCN H3O+, t0 R–X R-C≡N R-COOH
ADSENSE
ADSENSE

CÓ THỂ BẠN MUỐN DOWNLOAD

 

Đồng bộ tài khoản
2=>2