intTypePromotion=3

TÀI LIỆU: HÓA HỌC HỮU CƠ

Chia sẻ: Hoang Linh | Ngày: | Loại File: PDF | Số trang:13

4
437
lượt xem
167
download

TÀI LIỆU: HÓA HỌC HỮU CƠ

Mô tả tài liệu
  Download Vui lòng tải xuống để xem tài liệu đầy đủ

Khái niệm về hóa học hữu cơ và hợp chất hữu cơ: Hóa học hữu cơ là ngành hóa học chuyên nghiên cứu các hợp chất của cacbon, trừ cacbon oxit, cacbon đioxit và các muối cacbonat … Những hợp chất hữu cơ được nghiên cứu trong hóa học hữu cơ được gọi là hợp chất hữu cơ.

Chủ đề:
Lưu

Nội dung Text: TÀI LIỆU: HÓA HỌC HỮU CƠ

  1.                                    A.HIÑROÂCACBONNO Haõy hoïc vì töông I)Ankan(Parafin) CnH2n+2 (n  1) lai cuûa moãi chuùng 1)Caùch goïi teân: soá chæ vò trí-teân nhaùnh + teân maïch chính + an. ta và con chúng ta.  Löu yù: Ñaùnh soá thöù töï phaûi ñaùnh töø vò trí coù gaàn noái ñoâi nhaát.   1 2 3 4 Ví duï C H3  C H  C H 2  C H 3 2- metylbutan (isopentan) |            CH3            CH3   | 1 2 3 4 5 C H3  C H  C H 2  C H 2  C H 3 2,2- ñimetyl pentan (neoheptan) |            CH3 2)Tính chaát hoaù hoïc. *Phaûn öùng theá: askt CH4 + Cl2  CH3Cl + HCl *Phaûn öùng taùch H2 15000 C 2CH4  C2H2 + 2H2 lln  * Phaûn öùng oxi hoaù  3n  1  t0 CnH2n+2 +   O2  nCO2 + (n+1)H2O   2  0 t ,xt +Phaûn öùng oxi hoaù khoâng hoaøn toaøn: CH4 + O2  HCHO + H2O  II)Xicloankan CnH2n (n  3) CH3 | CH3 1,2,4-Trimetylxiclohexan    | CH3 *Tính chaát hoaù hoïc a) phaûn öùng coäng môû voøng. Ni,800 C + H2  C3H8 + Br2   Br  CH2  CH2  CH2  Br (1,3-ñibrompropan) + HBr  CH3  CH2  CH2  Br  0 Ni,120 C + H2  C4H10 (Butan)  b)Phaûn öùng theá Br 0 t + Br2   + HBr c) Phaûn öùng oxi hoaù
  2. 3n t0 CnH2n + O2  nCO2 + nH2O  Haõy hoïc vì 2 töông lai cuûa * Ñieàu cheá moãi chuùng ta và  t 0 ,xt CH3  CH2  CH2  CH2  CH2  CH3   + H2 con chúng ta.    0 t ,xt   C6H6 + 3H2 B.Hidrocacbon khoâng no I)Anken (olefin) coù ñoàng phaân hình hoïc [cis(cuøng), trans( khaùc)] 1)Danh phaùp CnH2n (n  2) Soá chæ vò trí –teân nhaùnh + teân maïch chính – soá vò trí noái 2 – en 1 2 3 4 C H2  C C H 2  C H3 | Vd:             CH 3 2–metylbut–1–en            2) Tính chất hoá học a) Phản ứng cộng. t 0 ,xt CH2=CH2      +    H2     CH3  CH3   CH 2  CH 2         Cl2   C H 2  C H 2 | |                                       Cl        Cl 1,2- đicloetan              C H2  C H2  CH 2  CH 2       Br2    | |  1,2- đibrometan   Br        Br             t 0 ,xt C2H4      +   HCl       CH3CH2Cl  0 t ,xt C2H4      +   H-OH      CH3CH2OH  b)Phản ứng trùng hợp CH 2  C CH 2  CH3 t 0 ,xt,P  CH 2  C CH 2  CH 3  n |           |  n              CH 3              CH 3  c)Phản ứng oxi hoá không hoàn toàn.  C H2  C H2  3CH2=CH2      +    2KMnO4 + 4H2O  3  |  |  + 2KOH + 2MnO2  OH      OH             CH 2  C CH 2  CH3 C H  C CH 2  CH 3 3 | + 2KMnO4 + 4H2O  3 | 2 |  + 2KOH + 2MnO2            CH 3 OH      OH 3)Điều chế 0 H 2SO 4 ,170 C CH3CH2OH   C2H4      +   H-OH      II)Ankadien (CnH2n-2) có hai liên kết đôi trong phân tử. 1) Phân loại   +  ankađien liên hợp cách nhau một liên kết đơn.                    +  ankađien cách nhau hai nối đôi trở lên.    2) Phản ứng hoá học a. Phản ứng cộng 0 CnH2n-2 + 2H2  CnH2n+2 t ,Ni  80 C 0 C H 2  C H  CH  CH 2 CH 2  CH  CH  CH 2    +   Br2       | |  Br        Br   2| Nguyễn Hoàng Linh Tel:01689107184  
  3. 80 C 0 C H 2  C H  CH  CH 2 CH 2  CH  CH  CH 2    +   HBr      | |  H        Br   Haõy hoïc vì töông lai cuûa moãi b. Phản ứng trùng hợp chuùng ta và con  0 n  CH 2  CH  CH  CH 2          CH 2  CH  CH  CH 2  n t ,xt,p  chúng ta.    CH 2  C CH  CH 2  CH 2  C  CH  CH 2  t 0 ,xt,p n |        |              CH3             CH 3 n 3) Điều chế ứng dụng của butađien & isopropen    Trong CN hiện nay butađien & isopropen được điều chế bằng cách tách H2 từ ankan     0 CH3−CH2−CH2−CH3    CH 2  CH  CH  CH 2 + 2H2  t ,xt,P  CH 2  C H  CH 2  CH 2 t 0 ,xt,P CH 2  C CH  CH 2 |   | + 2H2             CH 3             CH3 III. Ankin CnH2n-2 (n  2) 1. Danh pháp: cũng gọi như anken chỉ thay đuôi en thành đuôi in.  2. Tính chất hoá học.  a. Phản ứng cộng:   Cộng H2  0 t ,Ni C2H2   +   H2       C2H6 Pd,PbCO C2H2   +   H2      C2H4   3  Cộng Br2  20 C 0 CH3  C  C  CH3   CH3CCCH3  +  Br2       | |              Br   Br           Br   Br | | CH3CCCH3  +  Br2    CH3  C  C CH3     | |            Br   Br  Cộng H2O  HgSO , H SO CHCH   +   HOH   CH3CHO  4 80 C 0 2 4  Cộng HCl  HgCl CHCH   +   HCl    CH2=CHCl  (Vinyl clorua)  0 t 2  b. Phản ứng đime hoá và phản ứng trime hoá:  0 t ,xt CHCH       CH2=CHCCH    (Vinyl axetilen)   0 600 C,Bôt  C CHCH      C6H6 ( Benzen)  c. Phản ứng thế bằng ion kim loại (đây là phản ứng để nhận biết ankin có nối ≡ đầu mạch):  CHCH  +2 AgNO3  +2 NH3     AgCCAg(vàng) + 2NH4NO3                                                              (Bạc axetilua)  d. Phản ứng oxi hoá:đốt cháy và làm mất màu thuốc tím (KMnO4) 3n  1  t0 CnH2n-2 + O2  n CO2 + (n-1)H2O  2 3| Nguyễn Hoàng Linh Tel:01689107184  
  4. C. Hiđrôcacbon thơm Haõy hoïc vì I) Benzen và ankyl benzen töông lai cuûa 1)Đặc trưng có mạch vòng có 6 cạnh có 3 liên kết đơn xen kẻ 3 liên kết đôi.   moãi chuùng ta      CTTQ CnH2n-6 (n6)    và con chúng  ta.  2) Tính chất hoá học   a) Phản ứng thế Br bôt Fe + Br2   + HBr bôt Fe C6H5CH3 + Br2  C6H5BrCH3  + HBr áskt C6H5CH3 + Br2  C6H5CH2Br + HBr H SO đ C6H6 + HNO3  C6H5NO22 4 + H2O b) Phản ứng cộng . 0 t ,Ni C6H6 + H2  C6H12  áskt C6H6 + Cl2  C6H6Cl6 c) Phản ứng oxi hoá. 0 t C6H5CH3 + 2KMnO4  C6H5COOK  + 2MnO2 + KOH + H2O 3n  3  CnH2n-6 +  0  O2  nCO2 + (n-3)H2O t    2  3) Điều chế 0 600 C,Bôt  C CHCH      C6H6 ( Benzen) II) STIREN (C8H8) 1) Đặc trưng: có một vòng benzen liên kết với nhóm vinyl (CH=CH2)                        CH=CH2  2) TÍNH CHẤT HOÁ HỌC a. Phản ứng cộng C6 H 5 C H  C H 2 C6H5CH=CH2 + Br2   | | Br Br C H C H  CH 3 C6H5CH=CH2 + HCl  6 5 |  Cl t 0 ,xt,p C6H5CH=CH2 + H2  C6 H 5CH 2  CH 3  0 t ,xt,p C6H5CH=CH2 + 4H2  C6 H11CH 2  CH 3  b. Phản ứng trùng hợp CH-CH2 0 t ,xt,p n   (polistiren)                           CH=CH2    n c. Phản ứng oxi hoá 4| Nguyễn Hoàng Linh Tel:01689107184  
  5.              CH=CH2                                                   CH(OH)-CH2(OH) Haõy hoïc vì                           töông lai cuûa                         +  2KMnO4    +   4H2O     +2MnO2 (đen) + 2KOH moãi chuùng ta và con chúng  III) NAPHTALEN (C10H8) 1. Đặc trưng: có hai vòng benzen, dễ thăng hoa ngay ở nhiệt độ thường.  2. Tính chất hoá học:  a. Phản ứng thế                                                                           Br                                      CH COOH                                   +     Br2      3 + HBr                                                                                  NO2                                      H SO ,d                                   +   HNO3      2 4 + H2O   b. Phản ứng cộng H2                                      0 Ni,t                                   +   5H2          (C10H18)         D. DẪN SUẤT CỦA HIĐRÔCACBON I. DẪN XUẤT HALOGEN 1) Phản ứng thế nguyên tử X bằng nhóm (–OH) 0       CH3-CH2-CH2-Cl  +   NaOH           t    CH3-CH2-CH2-OH     +    NaCl                                                                              (ancol propylic)              2) Phản ứng tách hiđrôhalogenua C 2 H 5 OH,t 0            CH3-CH2-CH2-Br  +   KOH             CH3-CH=CH2   +   KBr    +   H2O   3) Phản ứng với Mg. ete     CH3-CH2-CH2-Br  +  Mg        CH3-CH2-CH2- Mg -Br    khan                 (etyl magie bromua)         II.ANCOL 1. Danh pháp: tên hiđrôcacbon ứng với mạch chính + số chỉ vị trí nhánh + ol 4 3 2 1 Ví dụ: C H 3  C H 2  C H  C H 3 | butan-2-ol OH 3 2 1 C H 3  C H  C H 2  OH 2-metyl propan-1-ol | CH 3 2. Tính chất hoá học a. Phản ứng thế với kim loại kiềm 2C2H5OH + 2Na  2C2H5ONa + H2  5| Nguyễn Hoàng Linh Tel:01689107184  
  6. C2H5ONa + H2O  C2H5OH + NaOH  b. Tính chất đặc trưng của glixerol 2C3H5(OH)3    +   Cu(OH)2      [C3H5(OH)2 O]2Cu   +   2H2O                                                            (dd màu xanh lam)  Haõy hoïc vì c. Phản ứng tách nước töông lai cuûa 0 170 C,H SO d moãi chuùng ta và  C2H5OH     C2H4 + H2O  2 4  con chúng ta.  d. Phản ứng oxi hoá C2H5OH   +   CuO       CH3CH=O   + Cu   + H2O   C H 3  C H 2  C H  CH 3  +  CuO        C H 3  C H 2  C CH3 + Cu   + H2O   |                           OH                         O 3. Điều chế a. Điều chế glixerol [C3H5(OH)3]  0 450 C                   CH2=CHCH3   +   Cl2      CH2=CHCH2Cl   +   HCl    C H2  C H  C H2 0        CH2=CHCH2Cl   +   Cl2  +  H2O     t | | | + HCl  Cl        OH    Cl C H  C H  C H2 C H  C H  C H2                   | 2 | |   +  2NaOH         | 2 |  |   +  NaCl  Cl        OH    Cl OH      OH    OH b. Điều chế ancol etylic [C2H5OH]  0 H SO d,t (C6H10O5 )n +  nH2O    nC6H12O6  2 4  men  ruou C6H12O6      2C2H5OH  +  2CO2   III. PHENOL 1. Đặc trưng: có vòng benzen liên kết trực tiếp với nhóm   OH                     OH                                                                        2. TÍNH CHÂT HOÁ HỌC  a. Tác dụng với kim loại kiềm.             2C6H5OH   +  2Na    2C6H5ONa   +  H2   b. Tác dụng với dd bazo                     C6H5OH   +  NaOH  C6H5ONa   +  H2O   c.   Tác dụng với Br2                         OH                                                                Br            Br                          C6H5OH   +  3 Br2                       (trắng)    +   3HBr  Br                                                           (2,4,6-tribromphenol)                                                              OH                                                             NO2            NO2                    C6H5OH   +  3 HNO3                       (Vàng)    +   3H2O  NO2                                                             (2,4,6-trinitrophenol)  6| Nguyễn Hoàng Linh Tel:01689107184  
  7. 3. Điều chế                                                        Haõy hoïc vì                                                                   Br  töông lai cuûa                                                                    moãi chuùng ta và  bôt Fe                      +   Br2        + HBr con chúng ta.  200  300atm C6H5Br + 2 NaOH(đ, dư)   C6H5Na + NaBr + H2O t0 C6H5Na + H2O + CO2   C6H5OH   + Na2CO3   IV. ANĐÊHIT 1. Đặc trưng có nhóm chức ( –CH=O), có phản ứng tráng gương. Đặc biệt HCHO +  AgNO3 trong môi trường NH3 tạo ra 4Ag. Công thức chung là *Đối với anđê hit no đơn chứcCnH2nO(n1) hoặc  CnH2n+1CHO (n0)  *Đối với anđêhit đa chức R(CHO)a 2.  Danh pháp Số chỉ vị trí nhánh+ tên nhánh+ tên hidrocacbon no tương ứng với mạch chính + al  4 3 2 1 Ví dụ: C H3  C H  C H 2  C HO | 3-metyl butanal            CH 3 3. Tính chất hoá học a. Phản ứng cộng với H2 (đóng vai trò chất oxi hoá)  Ni HCHO  +   H2      CH3OH   Ni       PTTQ: RCHO  +   H2      RCH2OH   b. Phản ứng oxi hoá không hoàn toàn (đóng vai trò chất khử): Dưới đây là phan ứng tráng gương.  t0 HCHO  +  2AgNO3   + 3NH3  +  H2O      HCOONH4   + 2 NH4NO3  + 2 Ag (trắng)   0 t RCHO   + 2AgNO3   + 3NH3  +  H2O      RCOONH4   + 2 NH4NO3  + 2 Ag (trắng)   0 t RCHO    +    O2    RCOOH   4. Điều chế. 0 t RCH2OH     +    CuO      RCHO   +  Cu  +  H2O   xt,t 0 CH4   +   O2      HCHO  +  H2O   t0 C2H2  +  H2O        CH3CHO   V. XETON 1. Đặc trưng. Có nhóm     – C   ở giữa. cách gọi tên.      O 4 3 2 1                C H 3  C H 2  C C H 3    butan-2-on  hoặc etyl metyl xeton  || O 4 3 2 1                C H 3  C H 2  C C H 3   metyl vinyl xeton  || O     2. Tính chất hoá học Ni,t R  C H  R' 0                R-CO-R’   +  H2          |   OH                 CH 3  CH 2  C CH 3     +  H2     CH 3  CH 2  C H  CH 3    ( butan-2-ol)   Ni,t 0  | O OH 7| Nguyễn Hoàng Linh Tel:01689107184  
  8. CN Haõy hoïc vì | töông lai cuûa               CH 3  C CH 3    + HCN       CH 3  C CH 3   (Xiano hidrin)    moãi chuùng ta và  O | OH con chúng ta.                CH 3  C CH 3   +   Br2       CH 3  C CH 2 Br   +  HBr   CH3COOH   O O VI. AXIT CACBOXYLIC 1. Đặc trưng và phân loại: Trong phân tử có nhóm –COOH, và có thể làm quỳ tím hoá đỏ. Có các loại axit sau: +Axit no đơn chức mạch hở: CnH2n+1COOH, n0 hoặc CmH2mO2, m1  +Axit không no, đơn chức mạch hở: CnH2n-1COOH, n0 hoặc CmH2m-2O2, m1  +Axit thơm đơn chức: CnH2n-7COOH,  n6  + Axit đa chức   2. Danh pháp Axit + số chỉ nhánh + tên nhánh + tên mạch chính + oic 4 3 2 1 Vd: C H3  C H  C H 2  C OOH axit-3 metyl butanoic |            CH3 3. Tính chất hoá học a. Tác dụng với giấy quỳ làm giấy quỳ chuyển sang màu đỏ. b. Tác dụng vói kim loại (tác dụng được hết các kim loại đứng trước H2) Zn   +    2CH3COOH       (CH3COO)2Zn    +  H2   c. Tác dụng với oxit bazo và bazo tạo thành muối và nước. 2CH3COOH   +  CuO     (CH3COO)2Cu    +     H2O     CH3COOH     +  Ba(OH)2    (CH3COO)2Ba    +   H2O  d. Tác dụng với muối ( muối của axit yếu) 2CH3COOH   +   Na2CO3    2CH3COONa  + CO2  +   H2O  e. Tác dụng với ancol tạo thành este  H SO đ  CH3COOH    +   C2H5OH      CH3COOC2H5  +   H2O  2 0 4 t f. Tính chất đặc trưng của axit fomic HCOOH  +2AgNO3 + 4NH3     (NH4)2CO3   +  2Ag  +  2NH4NO3   4. Điều chế men  giâm C2H5OH   +  O2      CH3COOH   +  H2O   2CH3CHO   +  O2        2CH3COOH     0 xt,t CH3OH     +  CO     CH3COOH   VII.ESTE:khi thay nhóm OH ở nhóm cacboxyl của axit cacboxylic bằng nhóm OR thì được este. 1. Có các loại este sau: a. Este no, đơn chức CnH2nO2 ( n2). Hoặc CnH2n+1COOCmH2m+1 b. Este không no, đơn chức: CnH2n-2O2 ( n2) 2. Một số tính chất của este H ,t0   R  COO  R’  H  OH  R  COOH  R’OH    0 HOH, t               R  COO  R’  NaOH     RCOONa   R’O H                               0 LiAlH ,t                RCOOR’ R  CH2  OH R’OH 4   8| Nguyễn Hoàng Linh Tel:01689107184  
  9. VD:  CH3[CH2 ]7 CH=CH[CH2]7 COOCH3   +  H2             CH3[CH2]16COOCH3  0 Ni,t                             Metyl oleat                    Metyl stearat  0 H O, t      CH3COO C6H5    +  2NaOH       CH3COONa  + C6H5ONa   +   H2O   2 Điều chế C6H5-OH + (CH3CO)2O  CH3COOC6H5 +  CH3COOH Phenol              anhiđrit axetic                    phenyl axetat    VIII)LIPIT Một số chất béo thường gặp:  (C15H31COO)3C3H5   :Tripanmitin.  (C17H35COO)3C3H5   :Tristearin.   (C17H33COO)3C3H5   :Triolein (ko no).  (C17H31COO)3C3H5   :Trilinolein (ko no).  Tính chất hoá học + 0 H ,t (RCOO)3 C3H5   +  3HOH   C3H5(OH)3   +  3RCOOH   (RCOO)3 C3H5   + 3NaOH   C3H5(OH)3   + 3RCOONa   IX)CACBOHIDRAT 1.Phân loại  Gluxit là tên gọi một loại hợp chất hữu cơ rất phổ biến trong cơ thể sinh vật   Thường có công thức ptử chung Cn(H2O)m.   Các chất gluxit được phân làm 3 loại.  a) Monosaccarrit là những gluxit đơn giản nhất, không bị thuỷ phân thành những gluxit đơn  giản hơn. Ví dụ: glucozơ, fructozơ (C6H12O6), ribozơ (C5H10O5)   b)Điscaccarit là những sản phẩm ngưng tụ từ 2 đến 10 phân tử monosaccarit với sự tách bớt  nước. Quan trọng nhất là các đisaccarit hay điozơ có công thức chung C12H22O11. Các đisaccarit này  bị thuỷ phân tạo thành 2 phân tử monosaccarit. Ví dụ thuỷ phân saccarozơ. + 0 H ,t C12H22O11 + H2O  C6H12O6 + C6H12O6  Saccarozơ fructozơ glucozơ c) Polisaccarit là những hợp chất cao phân tử. Khi bị thủy phân, polisaccarit tạo thành một số  lớn phân tử monosaccarit.  Ví dụ: Tinh bột, xenlulozơ, glicogen đều có công thức chung là (C6H10O5)n  2.Glucozơ tồn tại hai dạng   -glucozơ nhóm -OH phía trên &   -glucozơ nhóm -OH nằm phía dưới. 2C6H12O6  +Cu(OH)2      (C6H11O6)2Cu   +  2H2O                                                (Dd màu xanh lam)  0 t C5H11O5CHO +2AgNO3 +3NH3  +H2O     C5H11O5COONH4 + 2Ag   + NH4NO3                                                                                 ( amonigluconat)  0 t C5H11O5CHO + 2Cu(OH)2  +  NaOH   C5H11O5COONa + Cu2O  + 3H2O                                                                               (natrigluconat)       (đỏ gạch)  + 0 H ,t C5H11O5CHO  + H2        C5H11O5CH2OH (Sobitol)        enzim   C6H12O6       2C2H5OH  + 2CO2   C5H11O5CHO + Br2 + H2O   C5H11O5COOH + 2HBr  Chú ý Fructozo ko làm mất màu dd Br2.  Các tính khác đều giống glucozo.  9| Nguyễn Hoàng Linh Tel:01689107184  
  10. Fructozo ngọt hơn glucozo.  Điều chế + 0 H ,t (C6H10O5)n  + nH2O   nC6H12O6   H + ,t 0 C12H22O11     +  H2O    C6H12O6  + C6H12O6   saccarozo                                  Fructozo        glucozo  3.Saccarozơ  Tính chất hoá học  Tan Cu(OH)2 tạo dd màu xanh lam:  2C12H22O11 +Cu(OH)2   (C12H21O11)2Cu + 2H2O    Thủy phân trong môi trường axit  + 0 H ,t  C12H22O11     +  H2O  C6H12O6  + C6H12O6   saccarozo                                 Fuctozo     glucozo  4.TINH BỘT, XENLULOZƠ  + 0 H ,t (C6H10O5)n  + nH2O  nC6H12O6   Phản ưng giưa hô tinh bôt va I2   dd màu xanh tím   Xenlulozo tác dụng với HNO3 tạo nên   xenlulozo trinitrat *  H + ,t 0 [C6H7O2(OH)3]n +3nHNO3  [C6H7O2(ONO2)]n  + 3nH2O   * Xenlulozo trinitrat:là chất dễ cháy và nổ mạnh được dùng làm thuốc súng.   **Bảng tóm tắt một số tính chất của một số Cacbohiđrat        C6H12O6  C6H12O6  C12H22O11  C12H22O11  (C6H10O5)n    [C6H7O2(OH)3]n  (glucozo)  (Fructozo)  (Saccarozo)  (mantozo)  Tinh bot      xenlulozo     AgNO3/NH3  Ag    Ag    Ko pứ   Ag    Ko pứ   Ko pứ   Cu(OH)2  Dd mau xanh  Dd mau xanh  Dd mau xanh lam  Dd mau xanh  Ko pứ   Ko pứ   lam  lam  lam  Cu(OH)2,t0  Cu2O   đỏ  Cu2O  đỏ  Ko pứ   Cu2O      Ko pứ   Ko pứ   gạch  gạch  đỏ gạch  HNO3/H2SO4  Có pứ   Có pứ   Có pứ   Có pứ   Có pứ   [C6H7O2(ONO2)]n    H2O/H+  Ko pứ   Ko pứ   Glucozo+Fructozo  2Glucozo  Glucozo  Glucozo  X. AMIN có công thức phân tử chung như sau: +Amin no đơn chức : CnH2n+3N + Amin không no đơn chức: CnH2n+1N +Amin thơm CnH2n-5N A)Lực bazơ (C6H5)NH
  11. 4)Pứ đặc trưng anilin(C6H5NH2) 0 H 2 O, t C6H5NH2 + 3Br2    C6H2Br3NH2    +   3HBr    Chất nhận biết anilin    (trắng)  0 H 2 O, t C6H5NH2 + 3HNO3   C6H2(NO2)3NH2   +  3H2O   XI. AMINOAXIT là hc chứa cả nhóm amino(NH2 ) và nhóm cacboxyl(COOH)  Chú ý:vì nó chứa cả hai nhóm trên nên chúng là hợp chất lưỡng tính.  - Khi nhóm (COOH)>(NH2 ) Quỳ chuyển thành màu đỏ.  - Khi nhóm (COOH)
  12. Vì trong phân tử protein còn có nhóm - NH2 và - COOH tự do nên có tính bazơ và tính axit tuỳ thuộc  vào số lượng nhóm nào chiếm ưu thế.  Trong dung dịch, protein có thể biến thành ion lưỡng cực   +H3N - R - COO-.  Khi tổng số điện tích dương và điện tích âm của ion lưỡng cực bằng không thì protein được gọi là ở  trạng thái đẳng điện.  e) Thuỷ phân protein: khi thủy phân đến cùng protein sẻ cho các axit amin. f) Phản ứng có màu của protein Tương tự peptit và aminoaxit, protein tham gia phản ứng cho màu.   Phản ứng biure: Cho protein tác dụng với muối đồng (CuSO4) trong môi trường kiềm cho màu tím  do sự tạo thành phức chất của đồng (II) với hai nhóm peptit.   Phản ứng với HNO3 : Cho HNO3 đậm đặc vào protein sẽ xuất hiện màu vàng. 3. Phân loại protein  Gồm 2 nhóm chính:  a) Protein đơn giản:    Anbumin: Gồm một số protein tan trong nước, không kết tủa bởi dung dịch NaCl bão hoà nhưng kết  tủa bởi (NH4)2SO4 bão hoà. Đông tụ khi đun nóng. Có trong lòng trắng trứng, sữa.  Còn một số loại khác: Globulin Prolamin GlueinProtamin  b) Các protein phức tạp: Cấu tạo từ protein và các thành phần khác không phải protein. Khi thuỷ phân,  ngoài aminoaxit còn có các thành phần khác như hiđratcacbon, axit photphoric.  3. Ứng dụng của protein  Dùng làm thức ăn cho người và động vật.   Dùng trong công nghiệp dệt, giày dép, làm keo dán.   Một số protein dùng để chế tạo chất dẻo (như cazein của sữa).  XIII. Polime : là hc có ptử khốí rất lớn do nhiều đơn vị nhỏ (mắc xích) liên kết với nhau   *Phân loại   Polime thiên nhiên vd:tinh bột,xenlulozo...  (theo nguồn gốc)  Polime tổng hợp  vd:teflon ( CF2 -CF2 ) n , ( CH2  CH 2 ) n  polietilen    Polime bán tổng hợp  vd:tơ visco ,tơ xenlulozo axetat  *Phân loại          polime trùng hơp vd:teflon  ( CF2 -CF2 ) n , ( CH2  CH 2 ) n polietilen  (theo p2 tổng hợp)       polime trùng ngưng vd:nilon-6,6; nilon-6.  **Một số loại polime quan trọng:-nilon-6,6 ( HN-  CH2 6 NH-CO  CH2  4 CO ) n nNH2(CH2)6NH2 + nHOOC(CH2)4COOH  ( HN-  CH 2 6 NH-CO  CH 2  4 CO ) n + nH2O Hexametylen điamin            Axit ađipic                                      tơ nilon-6,6                                                        -Nilon-6    ( HN-  CH 2 5 CO ) n (tơ capron)     Poli vinylclorua    ( CH2  C H )n |                                                      Cl                   -Nilon-7     ( HN-  CH 2 6 CO ) n tơ enang      CH3      -Poli(metyl metacrylat)     CH2-C                                            [Thủy tinh hữu cơ(plexiglas)]       n                                                                             COOCH3                                                          12 | Nguyễn Hoàng Linh Tel:01689107184  
  13.                                                                                                                  -Poli(metyl acrylat)  CH  C H 2                                                                                                |  n            COOCH 3 t0 nHOOC-C6H4-COOH+nOH-[CH2]2-OH      ( CO  C 6 H 4COO CH 2 2 O ) n  + 2nH2O  axit terephtalic                   etylenglycol           Poli (etylen-terephtalat),Tơ lapsan     Tơ               tơ thiên nhiên:bông,len,tơ tằm.                     Tơ hóa học:          tơ tổng hợp:poliamit(nilon,capron);tở vinylic(vinilon,nitron...)                      Tơ nhân tạo: to visco, tơ xenlulozo axetat....  Caosu Thiên nhiên(isopren) ( CH 2  C  CH3  =CH  CH 2 )n  n=1500-15000                    Tổng hợp        caosu buna     ( CH2  CH=CH  CH 2 )n                                              caosu buna-S  ( CH 2  CH=CH  CH 2  CH  C6 H5   CH 2 )n                       caosu buna-N   ( CH 2  CH=CH  CH 2  CH  CN   CH 2 )n   Keo ure-fomandehit  0 nH2N-CO-NH2  +nCH2O     ( HN-CO-NH-CH2 ) n   +   nH2O  xt,t    Một số bài tập nhận biết: 1. Cho 5 lọ mất nhãn gồm: propen, axetilen, glixerol, phenol, tinh bột. Bằng phương  pháp hoá học hãy nhận biết các chất trên.  2. Cho 4 lọ mất nhãn sau metanal, 1-clopropan, benzen và axit axetic. Bằng phương  pháp hoá học hãy nhận biết các chất trên.  3. Cho 5 lọ mất nhãn gồm 1-clopent-2-en, pent-2-en, 1-clopentan, 1-brombut-2-en,       2-brompropan. Bằng phương pháp hoá học hãy nhận biết các chất trên.    Good luck to you!!!  Verry good, good, good….!!!  Chúc các bạn thành công trên con đường mình đã chọn.  Nếu bạn tin rằng mình không làm được thì mãi mãi bạn không làm được!!!  The end    13 | Nguyễn Hoàng Linh Tel:01689107184  

CÓ THỂ BẠN MUỐN DOWNLOAD

 

Đồng bộ tài khoản