intTypePromotion=3

CHƯƠNG III : DÃY SỐ

Chia sẻ: Dương Đại Lộc | Ngày: | Loại File: PPT | Số trang:177

0
83
lượt xem
25
download

CHƯƠNG III : DÃY SỐ

Mô tả tài liệu
  Download Vui lòng tải xuống để xem tài liệu đầy đủ

§1.PHƯƠNG PHÁP QUI NẠP 1 2 3 4 k k+1 n n+1 Để chứng minh mệnh đề T(n) (1) phụ thuộc n∈N*, ta làm như sau: (ví du: 1+2+3+…+n=n(n+1)/2 ̣ Bước 1: Kiểm tra T(1) đúng khi thay n = 1 Bước 2: giả sử mệnh đề đúng với n=k ta chứng minh mệnh đề đúng với n= k+1.

Chủ đề:
Lưu

Nội dung Text: CHƯƠNG III : DÃY SỐ

  1. CHƯƠNG III : DÃY SỐ §1.PHƯƠNG PHÁP QUI NẠP 1 2 3 4 k k+1 n n+1 Để cm mệnh đề T(n) (1) phụ thuộc n∈ N*, ta làm như sau: (ví du: 1+2+3+…+n=n(n+1)/2 ̣ Bước 1: Kiểm tra T(1) đúng khi thay n = 1 Bước 2: giả sử mệnh đề đúng với n=k, ta cm MĐ Đúng với n = k+1 Bước 3: KL mệnh đề đúng với ∀ n∈ N*
  2. Bài 1: cm,∀ n∈ N* , ta có: n(n+1) 1+2+3+…+n= (1) 2 +)n=1=>VT=1 ́ VP=1 =>VT=VP=>(1) đung k(k+1) Giả sử (1) đung với n=k∈ N*,tức la:1+2+3+…+k= ́ ̀ (2) 2 ̣ ̀ ́ Công k+1 vao 2 vê: k(k+1) 1+2+3+…+k+k+1= +k+1 2 k(k+1)+2(k+1) =>1+2+3+…+k+k+1= 2 (k+1)(k+2) =>1+2+3+…+k+k+1= 2 (1) Đung với n=k+1=>(1) đung với moi n ́ ́ ̣
  3. Bài 1: cm,∀ n∈ N* , ta có: n(3n+1) a)2+5+8+…+3n-1= (1) 2 Với n = 1 VT=2 =>VT=VP=>(1) đúng VP=1.(3+1)/2=2 Giả sử (1) đúng với n = k;tức là: k(3k+1) 2+5+8+…+3k-1= 2 Công 2 vế với 3(k+1)-1=3k+2 ta co: ̣ ́ k(3k+1) 2+5+8+…+3k-1+(3k+2)= +(3k+2) 2 3k 2 +7k+4 = 2 (k+1)(3k+4) 2+5+8+…+3k-1+3(k+1)-1= 2 =>(1) đung với n=k+1 ́ Vây,(1) đung với moi n ̣ ́ ̣
  4. 1 2n -1 111 b) + + +...+ n = n (1) 248 2 2 VT=1/2 =>VT=VP=>(1) đúng Với n = 1 VP=1/2 Giả sử (1) đúng với n = k;tức là: 1 2k -1 111 + + +...+ k = k (2) 248 2 k+1 2 Công 2 vế với 1/2 ; ta co: ̣ ́ k 111 1 1 2 -1 1 + + +...+ k + k+1 = k + k+1 248 22 2 2 2k+1 -1 111 1 1 => + + +...+ k + k+1 = k+1 =>(1) đung với n=k+1 ́ 248 22 2 Vây,(1) đung với ∀ n∈ N* ̣ ́
  5. n(n+1)(2n+1) 2 2 2 c)1 +2 +...+n = (1) 6 Với n = 1 VT=1 VP=1 =>VT=VP=>(1) đúng Giả sử (1) đúng với n = k;tức là: k(k+1)(2k+1) 2 2 2 1 +2 +...+k = (2) 6 Công 2 vế với (k+1)2,ta có: ̣ k(k+1)(2k+1) 2 2 2 2 +(k+1)2 1 +2 +...+k +(k+1) = 6 k(k+1)(2k+1)+6(k+1)2 = 6 (k+1)(k+2)(2k+3) 2 2 2 2 1 +2 +...+k +(k+1) = 6 Vây: (1) đúng với ∀ n∈ N* ̣ =>(1) đúng khi n = k+1
  6. ́ 2)cm: a)n3+3n2+5n chia hêt cho 3(1) Với n = 1=>13+3.1+5=9 chia hêt cho 3=>đung ́ ́ Giả sử (1) đung với n=k∈ N*;tức la: ́ ̀ ́ k3+3k2+5k chia hêt cho 3(1) Với n=k+1 ta co: A=(k+1)3+3(k+1)2+5(k+1) ́ =(k3+3k2+5k)+3k2+9k+9=(k3+3k2+5k)+3(k2+3k+3) =>A chia hêt cho 3=>(1) đung với n =k+1 ́ ́ Vây: (1) đúng với ∀ n∈ N* ̣ C2:n3+3n2+5n=(n3+3n2+2n)+3n=n(n+1)(n+2)+3n ́ Do n(n+1)(n+2)chia hêt cho 3=>… ́ b)4n+15n-1 chia hêt cho 9
  7. ́ b)4n+15n-1 chia hêt cho 9(1) Với n = 1=>41+15-1=18 chia hêt cho 9=>đung ́ ́ Giả sử (1) đung với n=k∈ N*;tức la: ́ ̀ ́ 4k+15k-1 chia hêt cho 9(2) Với n=k+1 ta co: A=4k+1+15(k+1)-1=4.4k+15k+15-1 ́ =4(4k+15k-1)-45k+18=4(4k+15k-1)-9(5k-2) =>A chia hêt cho 9=>(1) đung với n =k+1 ́ ́ Vây: (1) đúng với ∀ n∈ N* ̣ ́ c)n3+11n chia hêt cho 6 C2:n3+11n=(n3+3n2+2n)-3n2+9n=n(n+1)(n+2)-3n(n-3) Do n(n+1)(n+2)chia hêt cho 6;và n(n-3) chia hêt cho 2 ́ ́ (Vì n le=>n-3 chăn;n chăn=>n-3 le); vây, n3+11n chia hêt cho 6 ̉ ̉ ̃ ̉ ̣ ́
  8. ́ c)n3+11n chia hêt cho 6(1) Với n = 1=>1+11=12 chia hêt cho 6=>(1) đung ́ ́ Giả sử (1) đung với n=k∈ N*;tức la: ́ ̀ ́ k3+11k chia hêt cho 6(2) Với n=k+1 ta co: A=(k+1)3+11(k+1) ́ =k3+3k2+3k+1+11k+11=(k3+11k)+3k2+3k+12 =(k3+11k)+3k(k+1)+12 ́ ́ Do k(k+1) chia hêt cho 2=>A chia hêt cho 6 =>(1) đung với n =k+1 ́ Vây, (1) đung với moi n ̣ ́ ̣ d)3n>3n+1(3);n ≥ 2
  9. d)3n>3n+1(1);n≥ 2 Với n = 2=>VT=9;VP=7=>VT>VP(đung) ́ Giả sử (1) đung với n=k∈ N*;k>1;tức la: ́ ̀ 3k>3k+1 Nhân 2 vế với 3 ta co: ́ 3.3k>3(3k+1)=>3k+1>9k+3 Mà 9k+3=(3k+4)+6k-1>3k+4=3(k+1)+1 =>3k+1>3(k+1)+1 =>(1) đung với n =k+1 ́ Vây, (1) đung với moi n ̣ ́ ̣ e)2n+1>2n+3 (1); n≥ 2
  10. e)2n+1>2n+3 (1); n≥ 2 Với n = 2=>VT=8;VP=7=>VT>VP(đung) ́ Giả sử (1) đung với n=k∈ N*;k>1;tức la: ́ ̀ 2k+1>2k+3(2) Nhân 2 vế với 2 ta co: ́ 2.2k+1>2(2k+3)=>2k+2>4k+6=2(k+1)+3+(2k+1) Mà 2(k+1)+3+(2k+1)>2(k+1)+3 =>2k+1>2(k+1)+3 =>(1) đung với n =k+1 ́ Vây, (1) đung với moi n ̣ ́ ̣ 1 1 1 3)Cho Sn= + +...+ ;n N*(1) 1.2 2.3 n(n+1) ́ a)tinh S1;S2;S3
  11. 1 1 1 3)Cho Sn= + +...+ ;n N*(1) 1.2 2.3 n(n+1) ́ a)tinh S1;S2;S3 11 1 12 S1 = = ;S 2 = + = 1.2 2 1.2 2.3 3 1 1 13 S3 = + + = 1.2 2.3 3.4 4 b)Dự đoan Sn và cm qnap ́ Dự đoan Sn =n/(n+1) (1); (1) đung với n=1 ́ ́ Giả sử (1) đung với n=k;tức la: ́ ̀ 1 1 1 k Sk = + +...+ = ;k N*(3) 1.2 2.3 k(k+1) k+1 1 1 1 1 k 1 Sk+1 = + +...+ + = + 1.2 2.3 k(k+1) (k+1)(k+2) k+1 (k+1)(k+2)
  12. 1 1 1 3)Cho Sn= + +...+ ;n N*(1) 1.2 2.3 n(n+1) 1 1 1 1 k 1 Sk+1 = + +...+ + = + 1.2 2.3 k(k+1) (k+1)(k+2) k+1 (k+1)(k+2) (k+1)2 1 1 1 1 k+1 Sk+1 = + +...+ + = = 1.2 2.3 k(k+1) (k+1)(k+2) (k+1)(k+2) k+2 =>(1)đung với n=k+1=>(1) đung với moi n ́ ́ ̣ 11 11 11 1 n C2:Sn = - + - +...+ - =1- = 12 23 n n+1 n+1 n+1
  13. n 2 (n+1)2 4)cm:a)13 +23 +...+n 3 = ;n N*(1) 4 Với n = 1 =>VT=VP=1=>(1) đúng Giả sử (1) đúng2với n 2 k;tức là: = k (k+1) 3 3 3 1 +2 +...+k = (2) 43 Công 2 vế với (k+1) ,ta có: 2 ̣ 2 k (k+1) 3 3 3 3 +(k+1)3 1 +2 +...+k +(k+1) = 24 k (k+1)2 +4(k+1)2 = 4 (k+2)2 2 (k+1) 3 3 3 3 1 +2 +...+k +(k+1) = 4 (1)=>MĐ đúng khi n = k+1 Vây: (1) đúng với ∀ n∈ N* ̣ b)1.4+2.7+…+n(3n+1)=n(n+1)2(1)
  14. b)1.4+2.7+…+n(3n+1)=n(n+1)2(1) Với n = 1=>VT=VP=4=>(1) đung ́ Giả sử (1) đúng với n = k;tức là: 1.4+2.7+…+k(3k+1)=k(k+1)2(2) Công 2 vế với (k+1)(3k+4) ta co: ̣ ́ 1.4+2.7+…+k(3k+1)+(k+1)(3k+4)=k(k+1)2+(k+1)(3k+4) =>1.4+2.7+…+k(3k+1)+(k+1)(3k+4)=(k+1)(k+2)2 (1)=>MĐ đúng khi n = k+1 Vây: (1) đúng với ∀ n∈ N* ̣
  15. 3 4 n+2 1 c) + +...+ =1- 2 n (n+1)2n 1.2.2 2.3.2 n(n+1)2 Với n = 1 =>VT=VP=3/4=>(1) đúng Giả sử (1) đúng với n = k;tức là: 3 4 k+2 1 + +...+ =1- 2 k (k+1)2k 1.2.2 2.3.2 k(k+1)2 Công 2 vế với (k+3)/(k+1)(k+2)2k+1 ,ta có: ̣ 3 4 k+2 k+3 + +...+ + 2 k k+1 1.2.2 2.3.2 k(k+1)2 (k+1)(k+2)2 1 k+3 =1- + k k+1 1 (k+1)2 (k+1)(k+2)2 VP=1- (k+2)2k+1 (1)=>MĐ đúng khi n = k+1 Vây: (1) đúng với ∀ n∈ N* ̣ ́ d)n3+2n chia hêt cho 3
  16. ́ d)n3+2n chia hêt cho 3(1) Với n = 1=>1++2=3 chia hêt cho 3=>(1) đung ́ ́ Giả sử (1) đung với n=k∈ N*;tức la: ́ ̀ ́ k3+2k chia hêt cho 3(2) Với n=k+1 ta co: A=(k+1)3+2(k+1) ́ =k3+3k2+3k+1+2k+2=(k3+2k)+3(k2+k+1) ́ =>A chia hêt cho 3 =>(1) đung với n =k+1 ́ Vây, (1) đung với moi n ̣ ́ ̣ ́ e)32n-1+2n+1 chia hêt cho 7
  17. 1 1 3)1+ +...+ VT(1) đúng VP=2 Giả sử (1) đúng với n = k;tức là: 1 1 1 1+ +...+
  18. 1 1 1 13 + ...+ > ;n>1(1) 4) + n+1 n+2 2n 24 Với n = 2 VT=1/(2+1)+1/4=7/12>VP =>(1) đúng Giả sử (1) đúng với n = k;tức là: 1 1 1 13 + ...+ > (2) + k+1 k+2 2k 24 1 1 1 1 1 + ...+ + + + Với n=k+1,ta có: 2k 2k + 1 2k+2 k+2 k+3 1 1 1 1 1 1 = + ...+ +( − + + ) 2k 2k + 1 2k+2 k+1 k+1 k+2 13 1 1 1 > +( − ) > 13 / 24 + 24 2k + 2 2k+2 k+1 Vì 1/(2k+1)+1/2(k+1)>1/2(k+1)+1/2(k+1)=1/(k+1) Vây: (1) đúng với ∀ n∈ N* ̣ =>MĐ đúng khi n = k+1
  19. 1 1 1 n+1 5)(1- )(1- )...(1- 2 )= ;n>1(1) 4 9 n 2n Với n = 2 VT=1/(1-14)=3/4=VP =>(1) đúng Giả sử (1) đúng với n = k>1;tức là: 1 1 1 k+1 (1- )(1- )...(1- 2 )= ;k>1(2) 4 9 k 2k Nhân 2 vế với [1 -1/(k+1)2], ta được: 1 1 1 1 k+1 1 (1- )(1- )...(1- 2 )[1- ]= [1- ] 2 2 4 9 k (k+) 2k (k+1) k+1 k 2 +2k k+2 VP= 2k . (k+1)2 = 2(k+1) Vây: (1) đúng với ∀ n∈ N* ̣ =>(1) đúng khi n = k+1
  20. ́ Chia hêt cho 5 6)un =7.22n-2 +3 2n-1 (1) ́ +)n=1=>U1=7.20+31=10 chia hêt cho 5 =>(1) đúng Giả sử (1) đúng với n = k;tức là: uk =7.22k-2 +32k-1 (2) Chia hêt cho 5 ́ Khi đó với n=k+1, ta có: u k+1 =7.22k +32k+1 =7.2 2k-2+2 +32k-1+2 .9 = 4(7.2 ) + 5.3 2k-2 2k-1 2k-2 2k-1 2k-1+2 =7.2 .4+3 +3 ́ chia hêt cho 5 ́ =>Un+1 chia hêt cho 5 Vây: (1) đúng với ∀ n∈ N* ̣ =>(1) đúng khi n = k+1

CÓ THỂ BẠN MUỐN DOWNLOAD

 

Đồng bộ tài khoản